From 1ab40ef36a6863e99bbbcfebd848f004ed29f718 Mon Sep 17 00:00:00 2001
From: kutscher <kutscher@irmb.tu-bs.de>
Date: Tue, 2 Jan 2018 13:00:11 +0100
Subject: [PATCH] fixed GenBlocksGridVisitor replace BCArray3D& with
BCArray3DPtr DLR-F16: working copy for Pheonix, MPIIORestartCoProcessor has a
BUG! MPIIORestart3CoProcessor is reimplementation of MPIIORestartCoProcessor
with bug fixing. Buf is fixed in MPIIORestart2CoProcessor. add new
implementations for MPIIORestartCoProcessor: MPIIORestart11CoProcessor and
MPIIORestart21CoProcessor, which have separation in dataformat for blocks,
data set and bc Changed BCAlgorithm for object collection in BCProcessor
Fixed issue with GenBlocksGridVisitor
---
.gitignore | 1 +
.../BoundaryConditions/BCAlgorithm.cpp | 40 +-
.../BoundaryConditions/BCAlgorithm.h | 27 +-
.../BoundaryConditions/BCArray3D.h | 5 +-
.../BoundaryConditions/BCProcessor.cpp | 5 +-
.../BoundaryConditions/BoundaryConditions.h | 5 +-
.../BoundaryConditions/NoSlipBCAlgorithm.h | 3 +-
.../NonEqDensityBCAlgorithm.h | 3 +-
.../ThinWallBCProcessor.cpp | 2 +-
.../BoundaryConditions/VelocityBCAlgorithm.h | 3 +-
...ssor.cpp => MPIIORestart11CoProcessor.cpp} | 2768 +++++++++--------
...rocessor.h => MPIIORestart11CoProcessor.h} | 380 +--
...essor.cpp => MPIIORestart1CoProcessor.cpp} | 49 +-
...Processor.h => MPIIORestart1CoProcessor.h} | 10 +-
.../MPIIORestart21CoProcessor.cpp | 1225 ++++++++
.../CoProcessors/MPIIORestart21CoProcessor.h | 185 ++
.../CoProcessors/MPIIORestart2CoProcessor.cpp | 71 +-
.../CoProcessors/MPIIORestart2CoProcessor.h | 2 +
.../TimeAveragedValuesCoProcessor.cpp | 10 +
.../Data/D3Q27EsoTwist3DSplittedVector.h | 5 +-
source/VirtualFluidsCore/Grid/Block3D.h | 6 +-
source/VirtualFluidsCore/Grid/Grid3D.cpp | 27 +-
source/VirtualFluidsCore/Grid/Grid3D.h | 1 +
.../LBM/CompressibleCumulant2LBMKernel.cpp | 1081 +++++++
.../LBM/CompressibleCumulant2LBMKernel.h | 72 +
.../Utilities/ConfigurationFile.hpp | 4 +-
.../BoundaryConditionsBlockVisitor.cpp | 6 +-
.../Visitors/GenBlocksGridVisitor.cpp | 103 +-
.../Visitors/GenBlocksGridVisitor.h | 6 -
.../Visitors/SpongeLayerBlockVisitor.cpp | 43 +-
30 files changed, 4394 insertions(+), 1754 deletions(-)
create mode 100644 .gitignore
rename source/VirtualFluidsCore/CoProcessors/{MPIIORestartCoProcessor.cpp => MPIIORestart11CoProcessor.cpp} (66%)
rename source/VirtualFluidsCore/CoProcessors/{MPIIORestartCoProcessor.h => MPIIORestart11CoProcessor.h} (73%)
rename source/VirtualFluidsCore/CoProcessors/{MPIIORestart3CoProcessor.cpp => MPIIORestart1CoProcessor.cpp} (97%)
rename source/VirtualFluidsCore/CoProcessors/{MPIIORestart3CoProcessor.h => MPIIORestart1CoProcessor.h} (95%)
create mode 100644 source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.cpp
create mode 100644 source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.h
create mode 100644 source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.cpp
create mode 100644 source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.h
diff --git a/.gitignore b/.gitignore
new file mode 100644
index 000000000..e660fd93d
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1 @@
+bin/
diff --git a/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.cpp b/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.cpp
index 39d1a31b5..a7ea21360 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.cpp
+++ b/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.cpp
@@ -5,38 +5,16 @@ BCAlgorithm::BCAlgorithm() : compressible(false)
}
//////////////////////////////////////////////////////////////////////////
-void BCAlgorithm::apply()
+void BCAlgorithm::setNodeIndex(int x1, int x2, int x3)
{
- int cbc = 0;
- int cn = 0;
- int j;
-
- int nsize = (int)nodeVector.size();
-
- for (j = cn; j < nsize;)
- {
- x1 = nodeVector[j++];
- x2 = nodeVector[j++];
- x3 = nodeVector[j++];
-
- bcPtr = bcVector[cbc];
- cbc++;
-
- applyBC();
- }
- cn = j;
-}
-//////////////////////////////////////////////////////////////////////////
-void BCAlgorithm::addNode(int x1, int x2, int x3)
-{
- nodeVector.push_back(x1);
- nodeVector.push_back(x2);
- nodeVector.push_back(x3);
+ this->x1 = x1;
+ this->x2 = x2;
+ this->x3 = x3;
}
//////////////////////////////////////////////////////////////////////////
-void BCAlgorithm::addBcPointer(BoundaryConditionsPtr bcPtr)
+void BCAlgorithm::setBcPointer(BoundaryConditionsPtr bcPtr)
{
- bcVector.push_back(bcPtr);
+ this->bcPtr = bcPtr;
}
//////////////////////////////////////////////////////////////////////////
void BCAlgorithm::setCompressible(bool c)
@@ -75,12 +53,6 @@ bool BCAlgorithm::isPreCollision()
return preCollision;
}
//////////////////////////////////////////////////////////////////////////
-void BCAlgorithm::clearData()
-{
- nodeVector.clear();
- bcVector.clear();
-}
-//////////////////////////////////////////////////////////////////////////
BCArray3DPtr BCAlgorithm::getBcArray()
{
return bcArray;
diff --git a/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.h b/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.h
index 65fecd92f..2b4342a1c 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.h
+++ b/source/VirtualFluidsCore/BoundaryConditions/BCAlgorithm.h
@@ -36,25 +36,19 @@ public:
BCAlgorithm();
virtual ~BCAlgorithm() {}
- void apply();
virtual void addDistributions(DistributionArray3DPtr distributions) = 0;
- void addNode(int x1, int x2, int x3);
- void addBcPointer(BoundaryConditionsPtr bcPtr);
+ void setNodeIndex(int x1, int x2, int x3);
+ void setBcPointer(BoundaryConditionsPtr bcPtr);
void setCompressible(bool c);
void setCollFactor(LBMReal cf);
char getType();
bool isPreCollision();
virtual BCAlgorithmPtr clone()=0;
- void clearData();
BCArray3DPtr getBcArray();
void setBcArray(BCArray3DPtr bcarray);
-
-protected:
virtual void applyBC() = 0;
-
- std::vector <int> nodeVector;
- std::vector <BoundaryConditionsPtr> bcVector;
+protected:
bool compressible;
char type;
bool preCollision;
@@ -75,21 +69,6 @@ protected:
CalcFeqForDirFct calcFeqsForDirFct ;
CalcMacrosFct calcMacrosFct;
CalcFeqFct calcFeqFct;
-
-
-
-private:
- //friend class boost::serialization::access;
- //template<class Archive>
- //void serialize(Archive & ar, const unsigned int version)
- //{
- // ar & nodeVector;
- // ar & bcVector;
- // ar & compressible;
- // ar & type;
- // ar & distributions;
- // ar & collFactor;
- //}
};
diff --git a/source/VirtualFluidsCore/BoundaryConditions/BCArray3D.h b/source/VirtualFluidsCore/BoundaryConditions/BCArray3D.h
index a33885fe8..4cc7cb6f4 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/BCArray3D.h
+++ b/source/VirtualFluidsCore/BoundaryConditions/BCArray3D.h
@@ -100,9 +100,10 @@ private:
//////////////////////////////////////////////////////////////////////////
void deleteBC(std::size_t x1, std::size_t x2, std::size_t x3);
- friend class MPIIORestartCoProcessor;
+ friend class MPIIORestart1CoProcessor;
friend class MPIIORestart2CoProcessor;
- friend class MPIIORestart3CoProcessor;
+ friend class MPIIORestart11CoProcessor;
+ friend class MPIIORestart21CoProcessor;
friend class boost::serialization::access;
template<class Archive>
diff --git a/source/VirtualFluidsCore/BoundaryConditions/BCProcessor.cpp b/source/VirtualFluidsCore/BoundaryConditions/BCProcessor.cpp
index 8fda8e602..b93647dd2 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/BCProcessor.cpp
+++ b/source/VirtualFluidsCore/BoundaryConditions/BCProcessor.cpp
@@ -9,7 +9,6 @@ BCProcessor::BCProcessor()
BCProcessor::BCProcessor(LBMKernelPtr kernel)
{
DistributionArray3DPtr distributions = boost::dynamic_pointer_cast<EsoTwist3D>(kernel->getDataSet()->getFdistributions());
- //bcArray->resize( distributions->getNX1(), distributions->getNX2(), distributions->getNX3(), BCArray3D::FLUID);
bcArray = BCArray3DPtr(new BCArray3D( distributions->getNX1(), distributions->getNX2(), distributions->getNX3(), BCArray3D::FLUID));
}
//////////////////////////////////////////////////////////////////////////
@@ -50,7 +49,7 @@ void BCProcessor::applyPreCollisionBC()
{
BOOST_FOREACH(BCAlgorithmPtr bc, preBC)
{
- bc->apply();
+ bc->applyBC();
}
}
//////////////////////////////////////////////////////////////////////////
@@ -58,7 +57,7 @@ void BCProcessor::applyPostCollisionBC()
{
BOOST_FOREACH(BCAlgorithmPtr bc, postBC)
{
- bc->apply();
+ bc->applyBC();
}
}
//////////////////////////////////////////////////////////////////////////
diff --git a/source/VirtualFluidsCore/BoundaryConditions/BoundaryConditions.h b/source/VirtualFluidsCore/BoundaryConditions/BoundaryConditions.h
index ad42ba649..e4da79f0c 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/BoundaryConditions.h
+++ b/source/VirtualFluidsCore/BoundaryConditions/BoundaryConditions.h
@@ -256,9 +256,10 @@ protected:
char algorithmType;
private:
- friend class MPIIORestartCoProcessor;
+ friend class MPIIORestart1CoProcessor;
friend class MPIIORestart2CoProcessor;
- friend class MPIIORestart3CoProcessor;
+ friend class MPIIORestart11CoProcessor;
+ friend class MPIIORestart21CoProcessor;
friend class boost::serialization::access;
template<class Archive>
diff --git a/source/VirtualFluidsCore/BoundaryConditions/NoSlipBCAlgorithm.h b/source/VirtualFluidsCore/BoundaryConditions/NoSlipBCAlgorithm.h
index 30012852f..d6f2a8b54 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/NoSlipBCAlgorithm.h
+++ b/source/VirtualFluidsCore/BoundaryConditions/NoSlipBCAlgorithm.h
@@ -13,8 +13,9 @@ public:
virtual ~NoSlipBCAlgorithm();
BCAlgorithmPtr clone();
void addDistributions(DistributionArray3DPtr distributions);
-protected:
void applyBC();
+protected:
+
private:
//friend class boost::serialization::access;
//template<class Archive>
diff --git a/source/VirtualFluidsCore/BoundaryConditions/NonEqDensityBCAlgorithm.h b/source/VirtualFluidsCore/BoundaryConditions/NonEqDensityBCAlgorithm.h
index e206fa7ea..52753316b 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/NonEqDensityBCAlgorithm.h
+++ b/source/VirtualFluidsCore/BoundaryConditions/NonEqDensityBCAlgorithm.h
@@ -13,8 +13,9 @@ public:
~NonEqDensityBCAlgorithm();
BCAlgorithmPtr clone();
void addDistributions(DistributionArray3DPtr distributions);
-protected:
void applyBC();
+protected:
+
private:
//friend class boost::serialization::access;
//template<class Archive>
diff --git a/source/VirtualFluidsCore/BoundaryConditions/ThinWallBCProcessor.cpp b/source/VirtualFluidsCore/BoundaryConditions/ThinWallBCProcessor.cpp
index c5366bc6d..56e84fee5 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/ThinWallBCProcessor.cpp
+++ b/source/VirtualFluidsCore/BoundaryConditions/ThinWallBCProcessor.cpp
@@ -32,7 +32,7 @@ void ThinWallBCProcessor::applyPostCollisionBC()
if (bc->getType() == BCAlgorithm::ThinWallNoSlipBCAlgorithm)
{
boost::dynamic_pointer_cast<ThinWallNoSlipBCAlgorithm>(bc)->setPass(2);
- bc->apply();
+ bc->applyBC();
boost::dynamic_pointer_cast<ThinWallNoSlipBCAlgorithm>(bc)->setPass(1);
}
}
diff --git a/source/VirtualFluidsCore/BoundaryConditions/VelocityBCAlgorithm.h b/source/VirtualFluidsCore/BoundaryConditions/VelocityBCAlgorithm.h
index a231e27ca..ff5564acd 100644
--- a/source/VirtualFluidsCore/BoundaryConditions/VelocityBCAlgorithm.h
+++ b/source/VirtualFluidsCore/BoundaryConditions/VelocityBCAlgorithm.h
@@ -13,8 +13,9 @@ public:
~VelocityBCAlgorithm();
BCAlgorithmPtr clone();
void addDistributions(DistributionArray3DPtr distributions);
-protected:
void applyBC();
+protected:
+
private:
//friend class boost::serialization::access;
//template<class Archive>
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestartCoProcessor.cpp b/source/VirtualFluidsCore/CoProcessors/MPIIORestart11CoProcessor.cpp
similarity index 66%
rename from source/VirtualFluidsCore/CoProcessors/MPIIORestartCoProcessor.cpp
rename to source/VirtualFluidsCore/CoProcessors/MPIIORestart11CoProcessor.cpp
index 83783567f..34cf47802 100644
--- a/source/VirtualFluidsCore/CoProcessors/MPIIORestartCoProcessor.cpp
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart11CoProcessor.cpp
@@ -1,1360 +1,1408 @@
-#include "MPIIORestartCoProcessor.h"
-#include <boost/foreach.hpp>
-#include "D3Q27System.h"
-//#include "LBMKernel.h"
-#include "CompressibleCumulantLBMKernel.h"
-#include "IncompressibleCumulantLBMKernel.h"
-#include "ThinWallBCProcessor.h"
-#include "D3Q27EsoTwist3DSplittedVector.h"
-#include <UbSystem.h>
-#include <MemoryUtil.h>
-
-//! BLOCK_SIZE defines the quantity of the BoundaryCondition-structures written as one block to the file
-//! To avoid overflow in the parameter \a count of the function MPI_File_write_at
-//! structures BoundaryCondition are being written in blocks containing each of them BLOCK_SIZE structures
-#define BLOCK_SIZE 1024
-
-MPIIORestartCoProcessor::MPIIORestartCoProcessor(Grid3DPtr grid, UbSchedulerPtr s,
- const std::string& path,
- CommunicatorPtr comm) :
- CoProcessor(grid, s),
- path(path),
- comm(comm),
- mpiTypeFreeFlag(false)
-{
- UbSystem::makeDirectory(path+"/mpi_io_cp");
-
- memset(&blockParamStr, 0, sizeof(blockParamStr));
-
- //------------------------- define MPI types ---------------------------------
-
- MPI_Datatype typesGP[3] = { MPI_DOUBLE, MPI_INT, MPI_CHAR };
- int blocksGP[3] = { 34, 6, 5 };
- MPI_Aint offsetsGP[3], lbGP, extentGP;
-
- offsetsGP[0] = 0;
- MPI_Type_get_extent(MPI_DOUBLE, &lbGP, &extentGP);
- offsetsGP[1] = blocksGP[0]*extentGP;
-
- MPI_Type_get_extent(MPI_INT, &lbGP, &extentGP);
- offsetsGP[2] = offsetsGP[1]+blocksGP[1]*extentGP;
-
- MPI_Type_create_struct (3, blocksGP, offsetsGP, typesGP, &gridParamType);
- MPI_Type_commit(&gridParamType);
-
- //-----------------------------------------------------------------------
-
- MPI_Type_contiguous(41, MPI_INT, &blockParamType);
- MPI_Type_commit(&blockParamType);
-
- //-----------------------------------------------------------------------
-
- MPI_Datatype typesBlock[2] = { MPI_INT, MPI_CHAR };
- int blocksBlock[2] = { 13, 1 };
- MPI_Aint offsetsBlock[2], lbBlock, extentBlock;
-
- offsetsBlock[0] = 0;
- MPI_Type_get_extent(MPI_INT, &lbBlock, &extentBlock);
- offsetsBlock[1] = blocksBlock[0]*extentBlock;
-
- MPI_Type_create_struct(2, blocksBlock, offsetsBlock, typesBlock, &block3dType);
- MPI_Type_commit(&block3dType);
-
- //-----------------------------------------------------------------------
- MPI_Datatype typesDataSet[3] = { MPI_DOUBLE, MPI_INT, MPI_CHAR };
- int blocksDataSet[3] = { 2, 5, 2 };
- MPI_Aint offsetsDatatSet[3], lbDataSet, extentDataSet;
-
- offsetsDatatSet[0] = 0;
- MPI_Type_get_extent(MPI_DOUBLE, &lbDataSet, &extentDataSet);
- offsetsDatatSet[1] = blocksDataSet[0]*extentDataSet;
-
- MPI_Type_get_extent(MPI_INT, &lbDataSet, &extentDataSet);
- offsetsDatatSet[2] = offsetsDatatSet[1]+blocksDataSet[1]*extentDataSet;
-
- MPI_Type_create_struct(3, blocksDataSet, offsetsDatatSet, typesDataSet, &dataSetType);
- MPI_Type_commit(&dataSetType);
-
- //-----------------------------------------------------------------------
-
- MPI_Datatype typesBC[3] = { MPI_LONG_LONG_INT, MPI_FLOAT, MPI_CHAR };
- int blocksBC[3] = { 5, 38, 1 };
- MPI_Aint offsetsBC[3], lbBC, extentBC;
-
- offsetsBC[0] = 0;
- MPI_Type_get_extent(MPI_LONG_LONG_INT, &lbBC, &extentBC);
- offsetsBC[1] = blocksBC[0]*extentBC;
-
- MPI_Type_get_extent(MPI_FLOAT, &lbBC, &extentBC);
- offsetsBC[2] = offsetsBC[1]+blocksBC[1]*extentBC;
-
- MPI_Type_create_struct(3, blocksBC, offsetsBC, typesBC, &boundCondType);
- MPI_Type_commit(&boundCondType);
-
- //---------------------------------------
-
- MPI_Type_contiguous(BLOCK_SIZE, boundCondType, &boundCondType1000);
- MPI_Type_commit(&boundCondType1000);
-
- //---------------------------------------
-
- MPI_Type_contiguous(6, MPI_INT, &boundCondTypeAdd);
- MPI_Type_commit(&boundCondTypeAdd);
-
-}
-//////////////////////////////////////////////////////////////////////////
-MPIIORestartCoProcessor::~MPIIORestartCoProcessor()
-{
- MPI_Type_free(&gridParamType);
- MPI_Type_free(&blockParamType);
- MPI_Type_free(&block3dType);
- MPI_Type_free(&dataSetType);
- MPI_Type_free(&boundCondType);
- MPI_Type_free(&boundCondType1000);
- MPI_Type_free(&boundCondTypeAdd);
-
- if (mpiTypeFreeFlag)
- {
- MPI_Type_free(&dataSetDoubleType);
- MPI_Type_free(&bcindexmatrixType);
- }
-}
-
-//////////////////////////////////////////////////////////////////////////
-void MPIIORestartCoProcessor::process(double step)
-{
- if (scheduler->isDue(step))
- {
- if (comm->isRoot()) UBLOG(logINFO, "MPIIORestartCoProcessor save step: "<<step);
- if (comm->isRoot()) UBLOG(logINFO, "Save check point - start");
- /*if (comm->isRoot())*/ clearAllFiles((int)step);
- writeBlocks((int)step);
- writeDataSet((int)step);
- writeBoundaryConds((int)step);
- if (comm->isRoot()) UBLOG(logINFO, "Save check point - end");
-
- //readDataSet((int)step);
- }
-}
-//////////////////////////////////////////////////////////////////////////
-void MPIIORestartCoProcessor::clearAllFiles(int step)
-{
- MPI_File file_handler1, file_handler2, file_handler3;
- MPI_Info info = MPI_INFO_NULL;
- MPI_Offset new_size = 0;
-
- UbSystem::makeDirectory(path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step));
- std::string filename1 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBlocks.bin";
- //MPI_File_delete(filename1.c_str(), info);
- int rc1 = MPI_File_open(MPI_COMM_WORLD, filename1.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, MPI_INFO_NULL, &file_handler1);
- if (rc1 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename1);
- MPI_File_set_size(file_handler1, new_size);
- //MPI_File_sync(file_handler1);
- MPI_File_close(&file_handler1);
-
- std::string filename2 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpDataSet.bin";
- //MPI_File_delete(filename2.c_str(), info);
- int rc2 = MPI_File_open(MPI_COMM_WORLD, filename2.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, info, &file_handler2);
- if (rc2 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename2);
- MPI_File_set_size(file_handler2, new_size);
- //MPI_File_sync(file_handler2);
- MPI_File_close(&file_handler2);
-
- std::string filename3 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBC.bin";
- //MPI_File_delete(filename3.c_str(), info);
- int rc3 = MPI_File_open(MPI_COMM_WORLD, filename3.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, info, &file_handler3);
- if (rc3 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename3);
- MPI_File_set_size(file_handler3, new_size);
- //MPI_File_sync(file_handler3);
- MPI_File_close(&file_handler3);
-}
-//////////////////////////////////////////////////////////////////////////
-void MPIIORestartCoProcessor::writeBlocks(int step)
-{
- int rank, size;
- MPI_Comm_rank(MPI_COMM_WORLD, &rank);
- //MPI_Comm_size(MPI_COMM_WORLD, &size);
- size=1;
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeBlocks start collect data rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- int blocksCount = 0; // quantity of blocks in the grid, max 2147483648 blocks!
- int minInitLevel = this->grid->getCoarsestInitializedLevel();
- int maxInitLevel = this->grid->getFinestInitializedLevel();
-
- std::vector<Block3DPtr> blocksVector[25]; // max 25 levels
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- //grid->getBlocks(level, rank, blockVector[level]);
- grid->getBlocks(level, blocksVector[level]);
- blocksCount += static_cast<int>(blocksVector[level].size());
- }
-
- GridParam* gridParameters = new GridParam;
- gridParameters->trafoParams[0] = grid->getCoordinateTransformator()->Tx1;
- gridParameters->trafoParams[1] = grid->getCoordinateTransformator()->Tx2;
- gridParameters->trafoParams[2] = grid->getCoordinateTransformator()->Tx3;
- gridParameters->trafoParams[3] = grid->getCoordinateTransformator()->Sx1;
- gridParameters->trafoParams[4] = grid->getCoordinateTransformator()->Sx2;
- gridParameters->trafoParams[5] = grid->getCoordinateTransformator()->Sx3;
- gridParameters->trafoParams[6] = grid->getCoordinateTransformator()->alpha;
- gridParameters->trafoParams[7] = grid->getCoordinateTransformator()->beta;
- gridParameters->trafoParams[8] = grid->getCoordinateTransformator()->gamma;
-
- gridParameters->trafoParams[9] = grid->getCoordinateTransformator()->toX1factorX1;
- gridParameters->trafoParams[10] = grid->getCoordinateTransformator()->toX1factorX2;
- gridParameters->trafoParams[11] = grid->getCoordinateTransformator()->toX1factorX3;
- gridParameters->trafoParams[12] = grid->getCoordinateTransformator()->toX1delta;
- gridParameters->trafoParams[13] = grid->getCoordinateTransformator()->toX2factorX1;
- gridParameters->trafoParams[14] = grid->getCoordinateTransformator()->toX2factorX2;
- gridParameters->trafoParams[15] = grid->getCoordinateTransformator()->toX2factorX3;
- gridParameters->trafoParams[16] = grid->getCoordinateTransformator()->toX2delta;
- gridParameters->trafoParams[17] = grid->getCoordinateTransformator()->toX3factorX1;
- gridParameters->trafoParams[18] = grid->getCoordinateTransformator()->toX3factorX2;
- gridParameters->trafoParams[19] = grid->getCoordinateTransformator()->toX3factorX3;
- gridParameters->trafoParams[20] = grid->getCoordinateTransformator()->toX3delta;
-
- gridParameters->trafoParams[21] = grid->getCoordinateTransformator()->fromX1factorX1;
- gridParameters->trafoParams[22] = grid->getCoordinateTransformator()->fromX1factorX2;
- gridParameters->trafoParams[23] = grid->getCoordinateTransformator()->fromX1factorX3;
- gridParameters->trafoParams[24] = grid->getCoordinateTransformator()->fromX1delta;
- gridParameters->trafoParams[25] = grid->getCoordinateTransformator()->fromX2factorX1;
- gridParameters->trafoParams[26] = grid->getCoordinateTransformator()->fromX2factorX2;
- gridParameters->trafoParams[27] = grid->getCoordinateTransformator()->fromX2factorX3;
- gridParameters->trafoParams[28] = grid->getCoordinateTransformator()->fromX2delta;
- gridParameters->trafoParams[29] = grid->getCoordinateTransformator()->fromX3factorX1;
- gridParameters->trafoParams[30] = grid->getCoordinateTransformator()->fromX3factorX2;
- gridParameters->trafoParams[31] = grid->getCoordinateTransformator()->fromX3factorX3;
- gridParameters->trafoParams[32] = grid->getCoordinateTransformator()->fromX3delta;
-
- gridParameters->active = grid->getCoordinateTransformator()->active;
- gridParameters->transformation = grid->getCoordinateTransformator()->transformation;
-
- gridParameters->deltaX = grid->getDeltaX(minInitLevel);
- UbTupleInt3 blocknx = grid->getBlockNX();
- gridParameters->blockNx1 = val<1>(blocknx);
- gridParameters->blockNx2 = val<2>(blocknx);
- gridParameters->blockNx3 = val<3>(blocknx);
- gridParameters->nx1 = grid->getNX1();
- gridParameters->nx2 = grid->getNX2();
- gridParameters->nx3 = grid->getNX3();
- gridParameters->periodicX1 = grid->isPeriodicX1();
- gridParameters->periodicX2 = grid->isPeriodicX2();
- gridParameters->periodicX3 = grid->isPeriodicX3();
-
- //----------------------------------------------------------------------
-
- Block3d* block3dArray = new Block3d[blocksCount];
- bool firstBlock = true;
- int ic = 0;
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // all the blocks of the current level
- {
- if (firstBlock && block->getKernel()) // when first (any) valid block...
- {
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > averageDensityArray = block->getKernel()->getDataSet()->getAverageDencity();
- if (averageDensityArray)
- {
- blockParamStr.nx[0][0] = static_cast<int>(averageDensityArray->getNX1());
- blockParamStr.nx[0][1] = static_cast<int>(averageDensityArray->getNX2());
- blockParamStr.nx[0][2] = static_cast<int>(averageDensityArray->getNX3());
- blockParamStr.nx[0][3] = static_cast<int>(averageDensityArray->getNX4());
- }
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageVelocityArray3DPtr = block->getKernel()->getDataSet()->getAverageVelocity();
- if (AverageVelocityArray3DPtr)
- {
- blockParamStr.nx[1][0] = static_cast<int>(AverageVelocityArray3DPtr->getNX1());
- blockParamStr.nx[1][1] = static_cast<int>(AverageVelocityArray3DPtr->getNX2());
- blockParamStr.nx[1][2] = static_cast<int>(AverageVelocityArray3DPtr->getNX3());
- blockParamStr.nx[1][3] = static_cast<int>(AverageVelocityArray3DPtr->getNX4());
- }
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageFluctArray3DPtr = block->getKernel()->getDataSet()->getAverageFluctuations();
- if (AverageFluctArray3DPtr)
- {
- blockParamStr.nx[2][0] = static_cast<int>(AverageFluctArray3DPtr->getNX1());
- blockParamStr.nx[2][1] = static_cast<int>(AverageFluctArray3DPtr->getNX2());
- blockParamStr.nx[2][2] = static_cast<int>(AverageFluctArray3DPtr->getNX3());
- blockParamStr.nx[2][3] = static_cast<int>(AverageFluctArray3DPtr->getNX4());
- }
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageTripleArray3DPtr = block->getKernel()->getDataSet()->getAverageTriplecorrelations();
- if (AverageTripleArray3DPtr)
- {
- blockParamStr.nx[3][0] = static_cast<int>(AverageTripleArray3DPtr->getNX1());
- blockParamStr.nx[3][1] = static_cast<int>(AverageTripleArray3DPtr->getNX2());
- blockParamStr.nx[3][2] = static_cast<int>(AverageTripleArray3DPtr->getNX3());
- blockParamStr.nx[3][3] = static_cast<int>(AverageTripleArray3DPtr->getNX4());
- }
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > ShearStressValArray3DPtr = block->getKernel()->getDataSet()->getShearStressValues();
- if (ShearStressValArray3DPtr)
- {
- blockParamStr.nx[4][0] = static_cast<int>(ShearStressValArray3DPtr->getNX1());
- blockParamStr.nx[4][1] = static_cast<int>(ShearStressValArray3DPtr->getNX2());
- blockParamStr.nx[4][2] = static_cast<int>(ShearStressValArray3DPtr->getNX3());
- blockParamStr.nx[4][3] = static_cast<int>(ShearStressValArray3DPtr->getNX4());
- }
-
- boost::shared_ptr< CbArray3D<LBMReal, IndexerX3X2X1> > relaxationFactor3DPtr = block->getKernel()->getDataSet()->getRelaxationFactor();
- if (relaxationFactor3DPtr)
- {
- blockParamStr.nx[5][0] = static_cast<int>(relaxationFactor3DPtr->getNX1());
- blockParamStr.nx[5][1] = static_cast<int>(relaxationFactor3DPtr->getNX2());
- blockParamStr.nx[5][2] = static_cast<int>(relaxationFactor3DPtr->getNX3());
- blockParamStr.nx[5][3] = 1;
- }
-
- boost::shared_ptr< D3Q27EsoTwist3DSplittedVector > D3Q27EsoTwist3DSplittedVectorPtr = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(block->getKernel()->getDataSet()->getFdistributions());
- CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr localDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getLocalDistributions();
- if (localDistributions)
- {
- blockParamStr.nx[6][0] = static_cast<int>(localDistributions->getNX1());
- blockParamStr.nx[6][1] = static_cast<int>(localDistributions->getNX2());
- blockParamStr.nx[6][2] = static_cast<int>(localDistributions->getNX3());
- blockParamStr.nx[6][3] = static_cast<int>(localDistributions->getNX4());
- }
-
- CbArray4D <LBMReal, IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getNonLocalDistributions();
- if (nonLocalDistributions)
- {
- blockParamStr.nx[7][0] = static_cast<int>(nonLocalDistributions->getNX1());
- blockParamStr.nx[7][1] = static_cast<int>(nonLocalDistributions->getNX2());
- blockParamStr.nx[7][2] = static_cast<int>(nonLocalDistributions->getNX3());
- blockParamStr.nx[7][3] = static_cast<int>(nonLocalDistributions->getNX4());
- }
-
- CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr zeroDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getZeroDistributions();
- if (zeroDistributions)
- {
- blockParamStr.nx[8][0] = static_cast<int>(zeroDistributions->getNX1());
- blockParamStr.nx[8][1] = static_cast<int>(zeroDistributions->getNX2());
- blockParamStr.nx[8][2] = static_cast<int>(zeroDistributions->getNX3());
- blockParamStr.nx[8][3] = 1;
- }
-
- // ... than save some parameters that are equal in all blocks
- blockParamStr.nx1 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX1());
- blockParamStr.nx2 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX2());
- blockParamStr.nx3 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX3());
-
- firstBlock = false;
-
- // how many elements are in all arrays of DataSet (equal in all blocks)
- int doubleCount = 0, temp;
- for (int i = 0; i<9; i++) // 9 arrays ( averageValues, averageVelocity, averageFluktuations,
- { // averageTriplecorrelations, shearStressValues, relaxationFactor, 3 * fdistributions
- temp = 1;
- for (int ii = 0; ii<4; ii++)
- temp *= blockParamStr.nx[i][ii];
- doubleCount += temp;
- }
- blockParamStr.doubleCountInBlock = doubleCount;
-
- // the quantity of elements in the bcindexmatrix array (CbArray3D<int, IndexerX3X2X1>) in bcArray(BCArray3D) is always equal,
- // this will be the size of the "write-read-block" in MPI_write_.../MPI_read-functions when writing/reading BoundConds
- BCArray3DPtr bcArr = block->getKernel()->getBCProcessor()->getBCArray();
- blockParamStr.bcindexmatrix_count = static_cast<int>(bcArr->bcindexmatrix.getDataVector().size());
- }
-
- // save data describing the block
- block3dArray[ic].x1 = block->getX1();
- block3dArray[ic].x2 = block->getX2();
- block3dArray[ic].x3 = block->getX3();
- block3dArray[ic].bundle = block->getBundle();
- block3dArray[ic].rank = block->getRank();
- block3dArray[ic].lrank = block->getLocalRank();
- block3dArray[ic].part = block->getPart();
- block3dArray[ic].globalID = block->getGlobalID();
- block3dArray[ic].localID = block->getLocalID();
- block3dArray[ic].level = block->getLevel();
- block3dArray[ic].interpolationFlagCF = block->getInterpolationFlagCF();
- block3dArray[ic].interpolationFlagFC = block->getInterpolationFlagFC();
- block3dArray[ic].counter = block->getMaxGlobalID();
- block3dArray[ic].active = block->isActive();
-
- ic++;
- }
- }
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeBlocks start MPI IO rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- MPI_File file_handler;
- MPI_Info info = MPI_INFO_NULL;
- //MPI_Info_create (&info);
- //MPI_Info_set(info,"romio_cb_write","enable");
- //MPI_Info_set(info,"cb_buffer_size","4194304");
- //MPI_Info_set(info,"striping_unit","4194304");
-
- // if (comm->isRoot())
- // {
- UbSystem::makeDirectory(path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step));
- std::string filename = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBlocks.bin";
- int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, MPI_INFO_NULL, &file_handler);
- if (rc != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename);
- // }
-
- double start, finish;
- MPI_Offset write_offset = (MPI_Offset)(size * sizeof(int));
-
- //MPI_Offset new_size = 0;
- //MPI_File_set_size(file_handler, new_size);
-
- if (comm->isRoot())
- {
- start = MPI_Wtime();
-
- // each process writes the quantity of it's blocks
- MPI_File_write_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
- // each process writes parameters of the grid
- MPI_File_write_at(file_handler, write_offset, gridParameters, 1, gridParamType, MPI_STATUS_IGNORE);
- // each process writes common parameters of a block
- MPI_File_write_at(file_handler, (MPI_Offset)(write_offset +sizeof(GridParam)), &blockParamStr, 1, blockParamType, MPI_STATUS_IGNORE);
- // each process writes it's blocks
- MPI_File_write_at(file_handler, (MPI_Offset)(write_offset +sizeof(GridParam)+sizeof(BlockParam)), &block3dArray[0], blocksCount, block3dType, MPI_STATUS_IGNORE);
- }
-
- MPI_File_sync(file_handler);
- MPI_File_close(&file_handler);
-
- if (comm->isRoot())
- {
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeBlocks time: "<<finish-start<<" s");
- }
-
- // register new MPI-types depending on the block-specific information
- MPI_Type_contiguous(blockParamStr.doubleCountInBlock, MPI_DOUBLE, &dataSetDoubleType);
- MPI_Type_commit(&dataSetDoubleType);
-
- MPI_Type_contiguous(blockParamStr.bcindexmatrix_count, MPI_INT, &bcindexmatrixType);
- MPI_Type_commit(&bcindexmatrixType);
-
- mpiTypeFreeFlag = true;
-
- delete[] block3dArray;
- delete gridParameters;
-}
-
-void MPIIORestartCoProcessor::writeDataSet(int step)
-{
- int rank, size;
- MPI_Comm_rank(MPI_COMM_WORLD, &rank);
- MPI_Comm_size(MPI_COMM_WORLD, &size);
-
- int blocksCount = 0; // quantity of blocks in the grid, max 2147483648 blocks!
-
- std::vector<Block3DPtr> blocksVector[25];
- int minInitLevel = this->grid->getCoarsestInitializedLevel();
- int maxInitLevel = this->grid->getFinestInitializedLevel();
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- grid->getBlocks(level, rank, blocksVector[level]);
- blocksCount += static_cast<int>(blocksVector[level].size());
- }
-
- DataSet* dataSetArray = new DataSet[blocksCount];
- std::vector<double> doubleValuesArray; // double-values (arrays of f's) in all blocks
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeDataSet start collect data rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- int ic = 0;
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
- {
- dataSetArray[ic].x1 = block->getX1(); // coordinates of the block needed to find it while regenerating the grid
- dataSetArray[ic].x2 = block->getX2();
- dataSetArray[ic].x3 = block->getX3();
- dataSetArray[ic].level = block->getLevel();
- if (block->getKernel())
- {
- dataSetArray[ic].ghostLayerWidth = block->getKernel()->getGhostLayerWidth();
- dataSetArray[ic].collFactor = block->getKernel()->getCollisionFactor();
- dataSetArray[ic].deltaT = block->getKernel()->getDeltaT();
- dataSetArray[ic].compressible = block->getKernel()->getCompressible();
- dataSetArray[ic].withForcing = block->getKernel()->getWithForcing();
- }
- else
- {
- dataSetArray[ic].ghostLayerWidth = 0;
- dataSetArray[ic].collFactor = 0.0;
- dataSetArray[ic].deltaT = 0.0;
- dataSetArray[ic].compressible = false;
- dataSetArray[ic].withForcing = false;
- }
- //dataSetArrayGW[ic].x1 = dataSetArray[ic].x1;
- //dataSetArrayGW[ic].x2 = dataSetArray[ic].x2;
- //dataSetArrayGW[ic].x3 = dataSetArray[ic].x3;
- //dataSetArrayGW[ic].level = dataSetArray[ic].level;
- //dataSetArrayGW[ic].ghostLayerWidth = dataSetArray[ic].ghostLayerWidth;
- //dataSetArrayGW[ic].collFactor = dataSetArray[ic].collFactor;
- //dataSetArrayGW[ic].deltaT = dataSetArray[ic].deltaT;
- //dataSetArrayGW[ic].compressible = dataSetArray[ic].compressible;
- //dataSetArrayGW[ic].withForcing = dataSetArray[ic].withForcing;
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageValuesArray3DPtr = block->getKernel()->getDataSet()->getAverageDencity();
- if (AverageValuesArray3DPtr&&(blockParamStr.nx[0][0]>0)&&(blockParamStr.nx[0][1]>0)&&(blockParamStr.nx[0][2]>0)&&(blockParamStr.nx[0][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), AverageValuesArray3DPtr->getDataVector().begin(), AverageValuesArray3DPtr->getDataVector().end());
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageVelocityArray3DPtr = block->getKernel()->getDataSet()->getAverageVelocity();
- if (AverageVelocityArray3DPtr&&(blockParamStr.nx[1][0]>0)&&(blockParamStr.nx[1][1]>0)&&(blockParamStr.nx[1][2]>0)&&(blockParamStr.nx[1][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), AverageVelocityArray3DPtr->getDataVector().begin(), AverageVelocityArray3DPtr->getDataVector().end());
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageFluctArray3DPtr = block->getKernel()->getDataSet()->getAverageFluctuations();
- if (AverageFluctArray3DPtr&&(blockParamStr.nx[2][0]>0)&&(blockParamStr.nx[2][1]>0)&&(blockParamStr.nx[2][2]>0)&&(blockParamStr.nx[2][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), AverageFluctArray3DPtr->getDataVector().begin(), AverageFluctArray3DPtr->getDataVector().end());
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageTripleArray3DPtr = block->getKernel()->getDataSet()->getAverageTriplecorrelations();
- if (AverageTripleArray3DPtr&&(blockParamStr.nx[3][0]>0)&&(blockParamStr.nx[3][1]>0)&&(blockParamStr.nx[3][2]>0)&&(blockParamStr.nx[3][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), AverageTripleArray3DPtr->getDataVector().begin(), AverageTripleArray3DPtr->getDataVector().end());
-
- boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > ShearStressValArray3DPtr = block->getKernel()->getDataSet()->getShearStressValues();
- if (ShearStressValArray3DPtr&&(blockParamStr.nx[4][0]>0)&&(blockParamStr.nx[4][1]>0)&&(blockParamStr.nx[4][2]>0)&&(blockParamStr.nx[4][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), ShearStressValArray3DPtr->getDataVector().begin(), ShearStressValArray3DPtr->getDataVector().end());
-
- boost::shared_ptr< CbArray3D<LBMReal, IndexerX3X2X1> > RelaxationFactor3DPtr = block->getKernel()->getDataSet()->getRelaxationFactor();
- if (RelaxationFactor3DPtr&&(blockParamStr.nx[5][0]>0)&&(blockParamStr.nx[5][1]>0)&&(blockParamStr.nx[5][2]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), RelaxationFactor3DPtr->getDataVector().begin(), RelaxationFactor3DPtr->getDataVector().end());
-
- boost::shared_ptr< D3Q27EsoTwist3DSplittedVector > D3Q27EsoTwist3DSplittedVectorPtr = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(block->getKernel()->getDataSet()->getFdistributions());
- CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr localDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getLocalDistributions();
- if (localDistributions&&(blockParamStr.nx[6][0]>0)&&(blockParamStr.nx[6][1]>0)&&(blockParamStr.nx[6][2]>0)&&(blockParamStr.nx[6][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), localDistributions->getDataVector().begin(), localDistributions->getDataVector().end());
-
- CbArray4D <LBMReal, IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getNonLocalDistributions();
- if (nonLocalDistributions&&(blockParamStr.nx[7][0]>0)&&(blockParamStr.nx[7][1]>0)&&(blockParamStr.nx[7][2]>0)&&(blockParamStr.nx[7][3]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), nonLocalDistributions->getDataVector().begin(), nonLocalDistributions->getDataVector().end());
-
- CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr zeroDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getZeroDistributions();
- if (zeroDistributions&&(blockParamStr.nx[8][0]>0)&&(blockParamStr.nx[8][1]>0)&&(blockParamStr.nx[8][2]>0))
- doubleValuesArray.insert(doubleValuesArray.end(), zeroDistributions->getDataVector().begin(), zeroDistributions->getDataVector().end());
-
- ic++;
- }
- }
-
- //doubleValuesArrayGW.assign(doubleValuesArray.begin(), doubleValuesArray.end());
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeDataSet start MPI IO rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- // write to the file
- // all processes calculate their offsets (quantity of bytes that the process is going to write)
- // and notify the next process (with the rank = rank + 1)
- MPI_Offset write_offset = (MPI_Offset)(size*sizeof(int));
- size_t next_write_offset = 0;
-
- if (size>1)
- {
- if (rank==0)
- {
- next_write_offset = write_offset + blocksCount * (sizeof(DataSet)+blockParamStr.doubleCountInBlock*sizeof(double));
- MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
- }
- else
- {
- MPI_Recv(&write_offset, 1, MPI_LONG_LONG_INT, rank-1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
- next_write_offset = write_offset + blocksCount * (sizeof(DataSet)+blockParamStr.doubleCountInBlock*sizeof(double));
- if (rank<size-1)
- MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, rank+1, 5, MPI_COMM_WORLD);
- }
- }
-
- double start, finish;
- if (comm->isRoot()) start = MPI_Wtime();
-
- MPI_Info info = MPI_INFO_NULL;
-
-#ifdef HLRN
- MPI_Info_create(&info);
- MPI_Info_set(info, "striping_factor", "40");
- MPI_Info_set(info, "striping_unit", "4M");
-#endif
-
- MPI_File file_handler;
- std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
- int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE| MPI_MODE_WRONLY, info, &file_handler);
- if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
-
- //MPI_Offset new_size = 0;
- //MPI_File_set_size(file_handler, new_size);
-
- //std::cout << "writeDataSet rank=" << rank << ",blocksCount=" << blocksCount;
- //std::cout << ", rank*sizeof(int)=" << (MPI_Offset)(rank * sizeof(int)) << ", write_offset=" << write_offset << std::endl;
-
- // each process writes the quantity of it's blocks
- MPI_File_write_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
- // each process writes data identifying blocks
- MPI_File_write_at(file_handler, write_offset, dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
- // each process writes the dataSet arrays
- MPI_File_write_at(file_handler, (MPI_Offset)(write_offset +blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
- MPI_File_sync(file_handler);
- //std::cout << "writeDataSet rank=" << rank << ", write_offset1=" << write_offset << ", write_offset2=" << write_offset + blocksCount * sizeof(DataSet) << std::endl;
-
- //int blockC;
- //MPI_File_read_at(file_handler, (MPI_Offset)(rank * sizeof(int)), &blockC, 1, MPI_INT, MPI_STATUS_IGNORE);
- //std::cout << "readDataSet rank=" << rank << ", blockC=" << blockC << std::endl;
-
- MPI_File_close(&file_handler);
-
- if (comm->isRoot())
- {
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeDataSet time: "<<finish-start<<" s");
- }
-
- delete[] dataSetArray;
-}
-
-void MPIIORestartCoProcessor::writeBoundaryConds(int step)
-{
- int rank, size;
- MPI_Comm_rank(MPI_COMM_WORLD, &rank);
- MPI_Comm_size(MPI_COMM_WORLD, &size);
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeBoundaryConds start collect data rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- int blocksCount = 0; // quantity of blocks in the grid, max 2147483648 blocks!
- size_t count_boundCond = 0; // how many BoundaryConditions in all blocks
- int count_indexContainer = 0; // how many indexContainer-values in all blocks
- size_t byteCount = 0; // how many bytes writes this process in the file
-
- std::vector<Block3DPtr> blocksVector[25];
- int minInitLevel = this->grid->getCoarsestInitializedLevel();
- int maxInitLevel = this->grid->getFinestInitializedLevel();
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- grid->getBlocks(level, rank, blocksVector[level]);
- blocksCount += static_cast<int>(blocksVector[level].size());
- }
-
- BCAdd* bcAddArray = new BCAdd[blocksCount];
- std::vector<BoundaryCondition> bcVector;
- std::vector<int> bcindexmatrixV;
- std::vector<int> indexContainerV;
-
- int ic = 0;
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // all the blocks of the current level
- {
- BCArray3DPtr bcArr = block->getKernel()->getBCProcessor()->getBCArray();
-
- bcAddArray[ic].x1 = block->getX1(); // coordinates of the block needed to find it while regenerating the grid
- bcAddArray[ic].x2 = block->getX2();
- bcAddArray[ic].x3 = block->getX3();
- bcAddArray[ic].level = block->getLevel();
- bcAddArray[ic].boundCond_count = 0; // how many BoundaryConditions in this block
- bcAddArray[ic].indexContainer_count = 0; // how many indexContainer-values in this block
-
- for (int bc = 0; bc<bcArr->getBCVectorSize(); bc++)
- {
- BoundaryCondition* bouCond = new BoundaryCondition();
- if (bcArr->bcvector[bc]==NULL)
- {
- memset(bouCond, 0, sizeof(BoundaryCondition));
- }
- else
- {
- bouCond->noslipBoundaryFlags = bcArr->bcvector[bc]->getNoSlipBoundary();
- bouCond->slipBoundaryFlags = bcArr->bcvector[bc]->getSlipBoundary();
- bouCond->velocityBoundaryFlags = bcArr->bcvector[bc]->getVelocityBoundary();
- bouCond->densityBoundaryFlags = bcArr->bcvector[bc]->getDensityBoundary();
- bouCond->wallModelBoundaryFlags = bcArr->bcvector[bc]->getWallModelBoundary();
- bouCond->bcVelocityX1 = bcArr->bcvector[bc]->getBoundaryVelocityX1();
- bouCond->bcVelocityX2 = bcArr->bcvector[bc]->getBoundaryVelocityX2();
- bouCond->bcVelocityX3 = bcArr->bcvector[bc]->getBoundaryVelocityX3();
- bouCond->bcDensity = bcArr->bcvector[bc]->getBoundaryDensity();
- bouCond->bcLodiDensity = bcArr->bcvector[bc]->getDensityLodiDensity();
- bouCond->bcLodiVelocityX1 = bcArr->bcvector[bc]->getDensityLodiVelocityX1();
- bouCond->bcLodiVelocityX2 = bcArr->bcvector[bc]->getDensityLodiVelocityX2();
- bouCond->bcLodiVelocityX3 = bcArr->bcvector[bc]->getDensityLodiVelocityX3();
- bouCond->bcLodiLentgh = bcArr->bcvector[bc]->getDensityLodiLength();
- bouCond->nx1 = bcArr->bcvector[bc]->nx1;
- bouCond->nx2 = bcArr->bcvector[bc]->nx2;
- bouCond->nx3 = bcArr->bcvector[bc]->nx3;
- for (int iq = 0; iq<26; iq++)
- bouCond->q[iq] = bcArr->bcvector[bc]->getQ(iq);
- bouCond->algorithmType = bcArr->bcvector[bc]->getBcAlgorithmType();
- }
-
- bcVector.push_back(*bouCond);
- //bcVectorGW.push_back(*bouCond);
- bcAddArray[ic].boundCond_count++;
- count_boundCond++;
- }
-
- bcindexmatrixV.insert(bcindexmatrixV.end(), bcArr->bcindexmatrix.getDataVector().begin(), bcArr->bcindexmatrix.getDataVector().end());
- //bcindexmatrixVGW.assign(bcindexmatrixV.begin(), bcindexmatrixV.end());
-
- indexContainerV.insert(indexContainerV.end(), bcArr->indexContainer.begin(), bcArr->indexContainer.end());
- //indexContainerVGW.assign(indexContainerV.begin(), indexContainerV.end());
-
- bcAddArray[ic].indexContainer_count = static_cast<int>(bcArr->indexContainer.size());
- count_indexContainer += bcAddArray[ic].indexContainer_count;
-
- ic++;
- }
- }
-
- //how many "big blocks" of BLOCK_SIZE size can by formed
- int bcBlockCount = (int)(count_boundCond/BLOCK_SIZE);
- if (bcBlockCount * BLOCK_SIZE<count_boundCond)
- bcBlockCount += 1;
- for (int i = (int)count_boundCond; i<bcBlockCount * BLOCK_SIZE; i++)
- {
- BoundaryCondition* bouCond = new BoundaryCondition();
- memset(bouCond, 0, sizeof(BoundaryCondition));
- bcVector.push_back(*bouCond);
- }
-
- byteCount = bcBlockCount * BLOCK_SIZE * sizeof(BoundaryCondition) + blocksCount * sizeof(BCAdd) + sizeof(int) * (blocksCount * blockParamStr.bcindexmatrix_count + count_indexContainer);
-
- // write to the file
- // all processes calculate their offsets (quantity of bytes that the process is going to write)
- // and notify the next process (with the rank = rank + 1)
- MPI_Offset write_offset = (MPI_Offset)(3*size*sizeof(int));
- size_t next_write_offset = 0;
-
- if (size>1)
- {
- if (rank==0)
- {
- next_write_offset = write_offset + byteCount;
- MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
- }
- else
- {
- MPI_Recv(&write_offset, 1, MPI_LONG_LONG_INT, rank-1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
- next_write_offset = write_offset + byteCount;
- if (rank<size-1)
- MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, rank+1, 5, MPI_COMM_WORLD);
- }
- }
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeBoundaryConds start MPI IO rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- double start, finish;
- if (comm->isRoot()) start = MPI_Wtime();
-
- MPI_Info info = MPI_INFO_NULL;
-
-#ifdef HLRN
- MPI_Info_create(&info);
- MPI_Info_set(info, "striping_factor", "40");
- MPI_Info_set(info, "striping_unit", "4M");
-#endif
-
- MPI_File file_handler;
- std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBC.bin";
- int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE|MPI_MODE_WRONLY, info, &file_handler);
- if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
-
- //MPI_Offset new_size = 0;
- //MPI_File_set_size(file_handler, new_size);
-
- // each process writes the quantity of it's blocks
- MPI_File_write_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE); // blocks quantity
- // each process writes the quantity of "big blocks" of BLOCK_SIZE of boundary conditions
- MPI_File_write_at(file_handler, (MPI_Offset)((rank+size)*sizeof(int)), &bcBlockCount, 1, MPI_INT, MPI_STATUS_IGNORE); // quantity of BoundConds / BLOCK_SIZE
- // each process writes the quantity of indexContainer elements in all blocks
- MPI_File_write_at(file_handler, (MPI_Offset)((rank+2*size)*sizeof(int)), &count_indexContainer, 1, MPI_INT, MPI_STATUS_IGNORE); // quantity of indexContainer
-
- // each process writes data identifying the blocks
- MPI_File_write_at(file_handler, write_offset, bcAddArray, blocksCount, boundCondTypeAdd, MPI_STATUS_IGNORE);
- // each process writes boundary conditions
- if (bcVector.size()>0)
- MPI_File_write_at(file_handler, (MPI_Offset)(write_offset +blocksCount*sizeof(BCAdd)), &bcVector[0], bcBlockCount, boundCondType1000, MPI_STATUS_IGNORE);
- // each process writes bcindexmatrix values
- if (bcindexmatrixV.size()>0)
- MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+blocksCount*sizeof(BCAdd)+bcBlockCount*BLOCK_SIZE*sizeof(BoundaryCondition)), &bcindexmatrixV[0], blocksCount, bcindexmatrixType, MPI_STATUS_IGNORE);
- // each process writes indexContainer values
- if (indexContainerV.size()>0)
- MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+blocksCount*sizeof(BCAdd)+bcBlockCount*BLOCK_SIZE*sizeof(BoundaryCondition)+blocksCount*blockParamStr.bcindexmatrix_count*sizeof(int)), &indexContainerV[0], count_indexContainer, MPI_INT, MPI_STATUS_IGNORE);
- MPI_File_sync(file_handler);
-
- MPI_File_close(&file_handler);
-
- if (comm->isRoot())
- {
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestartCoProcessor::writeBoundaryConds time: "<<finish-start<<" s");
- }
-
- delete[] bcAddArray;
-}
-
-//------------------------------------------- READ -----------------------------------------------
-void MPIIORestartCoProcessor::restart(int step)
-{
- if (comm->isRoot()) UBLOG(logINFO, "MPIIORestartCoProcessor restart step: "<<step);
- if (comm->isRoot()) UBLOG(logINFO, "Load check point - start");
- readBlocks(step);
- readDataSet(step);
- readBoundaryConds(step);
- if (comm->isRoot()) UBLOG(logINFO, "Load check point - end");
- this->reconnect(grid);
-}
-
-void MPIIORestartCoProcessor::readBlocks(int step)
-{
- int rank, size;
- MPI_Comm_rank(MPI_COMM_WORLD, &rank);
- //MPI_Comm_size(MPI_COMM_WORLD, &size);
- size = 1;
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBlocks start MPI IO rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- double start, finish;
- if (comm->isRoot()) start = MPI_Wtime();
-
- MPI_File file_handler;
- std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBlocks.bin";
- int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
- if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
-
- // read count of blocks
- int blocksCount = 0;
- //MPI_File_read_at(file_handler, rank*sizeof(int), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
- MPI_File_read_at(file_handler, 0, &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
- Block3d* block3dArray = new Block3d[blocksCount];
-
- // calculate the read offset
- MPI_Offset read_offset = (MPI_Offset)(size * sizeof(int));
-
- GridParam* gridParameters = new GridParam;
-
- // read parameters of the grid
- MPI_File_read_at(file_handler, read_offset, gridParameters, 1, gridParamType, MPI_STATUS_IGNORE);
- // read parameters of a block
- MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+sizeof(GridParam)), &blockParamStr, 1, blockParamType, MPI_STATUS_IGNORE);
- // read all the blocks
- MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+sizeof(GridParam)+sizeof(BlockParam)), &block3dArray[0], blocksCount, block3dType, MPI_STATUS_IGNORE);
-
- MPI_File_close(&file_handler);
-
- if (comm->isRoot())
- {
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBlocks time: "<<finish-start<<" s");
- }
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBlocks start of restore of data, rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- // clear the grid
- std::vector<Block3DPtr> blocksVector;
- grid->getBlocks(0, blocksVector);
- int del = 0;
- BOOST_FOREACH(Block3DPtr block, blocksVector)
- {
- grid->deleteBlock(block);
- del++;
- }
-
- // restore the grid
- CoordinateTransformation3DPtr trafo(new CoordinateTransformation3D());
- trafo->Tx1 = gridParameters->trafoParams[0];
- trafo->Tx2 = gridParameters->trafoParams[1];
- trafo->Tx3 = gridParameters->trafoParams[2];
- trafo->Sx1 = gridParameters->trafoParams[3];
- trafo->Sx2 = gridParameters->trafoParams[4];
- trafo->Sx3 = gridParameters->trafoParams[5];
- trafo->alpha = gridParameters->trafoParams[6];
- trafo->beta = gridParameters->trafoParams[7];
- trafo->gamma = gridParameters->trafoParams[8];
-
- trafo->toX1factorX1 = gridParameters->trafoParams[9];
- trafo->toX1factorX2 = gridParameters->trafoParams[10];
- trafo->toX1factorX3 = gridParameters->trafoParams[11];
- trafo->toX1delta = gridParameters->trafoParams[12];
- trafo->toX2factorX1 = gridParameters->trafoParams[13];
- trafo->toX2factorX2 = gridParameters->trafoParams[14];
- trafo->toX2factorX3 = gridParameters->trafoParams[15];
- trafo->toX2delta = gridParameters->trafoParams[16];
- trafo->toX3factorX1 = gridParameters->trafoParams[17];
- trafo->toX3factorX2 = gridParameters->trafoParams[18];
- trafo->toX3factorX3 = gridParameters->trafoParams[19];
- trafo->toX3delta = gridParameters->trafoParams[20];
-
- trafo->fromX1factorX1 = gridParameters->trafoParams[21];
- trafo->fromX1factorX2 = gridParameters->trafoParams[22];
- trafo->fromX1factorX3 = gridParameters->trafoParams[23];
- trafo->fromX1delta = gridParameters->trafoParams[24];
- trafo->fromX2factorX1 = gridParameters->trafoParams[25];
- trafo->fromX2factorX2 = gridParameters->trafoParams[26];
- trafo->fromX2factorX3 = gridParameters->trafoParams[27];
- trafo->fromX2delta = gridParameters->trafoParams[28];
- trafo->fromX3factorX1 = gridParameters->trafoParams[29];
- trafo->fromX3factorX2 = gridParameters->trafoParams[30];
- trafo->fromX3factorX3 = gridParameters->trafoParams[31];
- trafo->fromX3delta = gridParameters->trafoParams[32];
-
- trafo->active = gridParameters->active;
- trafo->transformation = gridParameters->transformation;
-
- grid->setCoordinateTransformator(trafo);
-
- grid->setDeltaX(gridParameters->deltaX);
- grid->setBlockNX(gridParameters->blockNx1, gridParameters->blockNx2, gridParameters->blockNx3);
- grid->setNX1(gridParameters->nx1);
- grid->setNX2(gridParameters->nx2);
- grid->setNX3(gridParameters->nx3);
- grid->setPeriodicX1(gridParameters->periodicX1);
- grid->setPeriodicX2(gridParameters->periodicX2);
- grid->setPeriodicX3(gridParameters->periodicX3);
-
- // regenerate blocks
- for (int n = 0; n<blocksCount; n++)
- {
- Block3DPtr block(new Block3D(block3dArray[n].x1, block3dArray[n].x2, block3dArray[n].x3, block3dArray[n].level));
- block->setActive(block3dArray[n].active);
- block->setBundle(block3dArray[n].bundle);
- block->setRank(block3dArray[n].rank);
- block->setLocalRank(block3dArray[n].lrank);
- block->setGlobalID(block3dArray[n].globalID);
- block->setLocalID(block3dArray[n].localID);
- block->setPart(block3dArray[n].part);
- block->setLevel(block3dArray[n].level);
- block->interpolationFlagCF = block3dArray[n].interpolationFlagCF;
- block->interpolationFlagFC = block3dArray[n].interpolationFlagFC;
-
- grid->addBlock(block);
- }
-
- // define MPI_types depending on the block-specific information
- MPI_Type_contiguous(blockParamStr.doubleCountInBlock, MPI_DOUBLE, &dataSetDoubleType);
- MPI_Type_commit(&dataSetDoubleType);
-
- MPI_Type_contiguous(blockParamStr.bcindexmatrix_count, MPI_INT, &bcindexmatrixType);
- MPI_Type_commit(&bcindexmatrixType);
-
- mpiTypeFreeFlag = true;
-
- delete gridParameters;
- delete[] block3dArray;
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBlocks end of restore of data, rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-}
-
-void MPIIORestartCoProcessor::readDataSet(int step)
-{
- int rank, size;
- MPI_Comm_rank(MPI_COMM_WORLD, &rank);
- MPI_Comm_size(MPI_COMM_WORLD, &size);
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readDataSet start MPI IO rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
- double start, finish;
- if (comm->isRoot()) start = MPI_Wtime();
-
- MPI_File file_handler;
- std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
- int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
- if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
-
- // read count of blocks
- int blocksCount = 0;
- MPI_File_read_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
-
- DataSet* dataSetArray = new DataSet[blocksCount];
- std::vector<double> doubleValuesArray(blocksCount * blockParamStr.doubleCountInBlock); // double-values in all blocks
-
- // calculate the read offset
- MPI_Offset read_offset = (MPI_Offset)(size*sizeof(int));
- size_t next_read_offset = 0;
-
- if(size > 1)
- {
- if(rank == 0)
- {
- next_read_offset = read_offset + blocksCount * (sizeof(DataSet) + blockParamStr.doubleCountInBlock * sizeof(double));
- MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
- }
- else
- {
- MPI_Recv(&read_offset, 1, MPI_LONG_LONG_INT, rank - 1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
- next_read_offset = read_offset + blocksCount * (sizeof(DataSet) + blockParamStr.doubleCountInBlock * sizeof(double));
- if(rank < size - 1)
- MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, rank + 1, 5, MPI_COMM_WORLD);
- }
- }
-
- int chunkFlag = 0;
-
- //if (rank == 0)
- //{
- // MPI_File_read_at(file_handler, read_offset, dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
- // MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
- //
- // for (int i=1; i<size; i+=chunk)
- // {
- // for (int j=i; j<i+chunk; j++)
- // {
- // if (j < size)
- // {
- // MPI_Send(&chunkFlag, 1, MPI_INT, j, 77, MPI_COMM_WORLD);
- // //UBLOG(logINFO, "j= "<<j);
- // }
- // }
- // for (int j=i; j<i+chunk; j++)
- // {
- // if (j < size)
- // {
- // MPI_Recv(&chunkFlag, 1, MPI_INT, j, 77, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
- // }
- // }
- // }
- //}
- //else
- //{
- // MPI_Recv(&chunkFlag, 1, MPI_INT, 0, 77, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
- // MPI_File_read_at(file_handler, read_offset, dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
- // MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
- // MPI_Send(&chunkFlag, 1, MPI_INT, 0, 77, MPI_COMM_WORLD);
- // //UBLOG(logINFO, "read rank= "<<rank);
- //}
-
- MPI_File_read_at(file_handler, read_offset, dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
- MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
- MPI_File_close(&file_handler);
-
- /*for (int ch = 0; ch < blocksCount; ch++)
- {
- if ((dataSetArrayGW[ch].x1 != dataSetArray[ch].x1) ||
- (dataSetArrayGW[ch].x2 != dataSetArray[ch].x2) ||
- (dataSetArrayGW[ch].x3 != dataSetArray[ch].x3) ||
- (dataSetArrayGW[ch].level != dataSetArray[ch].level) ||
- (dataSetArrayGW[ch].ghostLayerWidth != dataSetArray[ch].ghostLayerWidth) ||
- (dataSetArrayGW[ch].collFactor != dataSetArray[ch].collFactor) ||
- (dataSetArrayGW[ch].deltaT != dataSetArray[ch].deltaT) ||
- (dataSetArrayGW[ch].compressible != dataSetArray[ch].compressible) ||
- (dataSetArrayGW[ch].withForcing != dataSetArray[ch].withForcing))
- std::cout << "dataSetArrayGW != rank" << rank << ", !!!!!====="<< std::endl;
- }
- for (int vl = 0; vl < doubleValuesArrayGW.size(); vl++)
- if(doubleValuesArrayGW[vl] != doubleValuesArray[vl])
- std::cout << "doubleValuesArrayGW != rank" << rank << ", !!!!!====="<< std::endl;*/
-
- if (comm->isRoot())
- {
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestartCoProcessor::readDataSet time: "<<finish-start<<" s");
- UBLOG(logINFO, "MPIIORestartCoProcessor::readDataSet start of restore of data, rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- size_t index = 0, nextVectorSize = 0;
- std::vector<double> vectorsOfValues[9];
- for (int n = 0; n<blocksCount; n++)
- {
- for (int b = 0; b<9; b++) // assign approciate vectors for 9 dataSet arrays
- {
- nextVectorSize = blockParamStr.nx[b][0]*blockParamStr.nx[b][1]*blockParamStr.nx[b][2]*blockParamStr.nx[b][3];
- vectorsOfValues[b].assign(doubleValuesArray.data()+index, doubleValuesArray.data()+index+nextVectorSize);
- index += nextVectorSize;
- }
-
- // fill dataSet arrays
- AverageValuesArray3DPtr mAverageDensity;
- if ((blockParamStr.nx[0][0]==0)&&(blockParamStr.nx[0][1]==0)&&(blockParamStr.nx[0][2]==0)&&(blockParamStr.nx[0][3]==0))
- mAverageDensity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
- else
- mAverageDensity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[0], blockParamStr.nx[0][0], blockParamStr.nx[0][1], blockParamStr.nx[0][2], blockParamStr.nx[0][3]));
-
- AverageValuesArray3DPtr mAverageVelocity;
- if ((blockParamStr.nx[1][0]==0)&&(blockParamStr.nx[1][1]==0)&&(blockParamStr.nx[1][2]==0)&&(blockParamStr.nx[1][3]==0))
- mAverageVelocity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
- else
- mAverageVelocity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[1], blockParamStr.nx[1][0], blockParamStr.nx[1][1], blockParamStr.nx[1][2], blockParamStr.nx[1][3]));
-
- AverageValuesArray3DPtr mAverageFluktuations;
- if ((blockParamStr.nx[2][0]==0)&&(blockParamStr.nx[2][1]==0)&&(blockParamStr.nx[2][2]==0)&&(blockParamStr.nx[2][3]==0))
- mAverageFluktuations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
- else
- mAverageFluktuations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[2], blockParamStr.nx[2][0], blockParamStr.nx[2][1], blockParamStr.nx[2][2], blockParamStr.nx[2][3]));
-
- AverageValuesArray3DPtr mAverageTriplecorrelations;
- if ((blockParamStr.nx[3][0]==0)&&(blockParamStr.nx[3][1]==0)&&(blockParamStr.nx[3][2]==0)&&(blockParamStr.nx[3][3]==0))
- mAverageTriplecorrelations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
- else
- mAverageTriplecorrelations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[3], blockParamStr.nx[3][0], blockParamStr.nx[3][1], blockParamStr.nx[3][2], blockParamStr.nx[3][3]));
-
- ShearStressValuesArray3DPtr mShearStressValues;
- if ((blockParamStr.nx[4][0]==0)&&(blockParamStr.nx[4][1]==0)&&(blockParamStr.nx[4][2]==0)&&(blockParamStr.nx[4][3]==0))
- mShearStressValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
- else
- mShearStressValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[4], blockParamStr.nx[4][0], blockParamStr.nx[4][1], blockParamStr.nx[4][2], blockParamStr.nx[4][3]));
-
- RelaxationFactorArray3DPtr mRelaxationFactor;
- if ((blockParamStr.nx[5][0]==0)&&(blockParamStr.nx[5][1]==0)&&(blockParamStr.nx[5][2]==0))
- mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr();
- else
- mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[5], blockParamStr.nx[5][0], blockParamStr.nx[5][1], blockParamStr.nx[5][2]));
-
- DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector(blockParamStr.nx1, blockParamStr.nx2, blockParamStr.nx3, -999.0));
-
- boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[6], blockParamStr.nx[6][0], blockParamStr.nx[6][1], blockParamStr.nx[6][2], blockParamStr.nx[6][3])));
- boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNonLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[7], blockParamStr.nx[7][0], blockParamStr.nx[7][1], blockParamStr.nx[7][2], blockParamStr.nx[7][3])));
- boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setZeroDistributions(CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[8], blockParamStr.nx[8][0], blockParamStr.nx[8][1], blockParamStr.nx[8][2])));
-
- boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX1(blockParamStr.nx1);
- boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX2(blockParamStr.nx2);
- boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX3(blockParamStr.nx3);
-
- DataSet3DPtr dataSetPtr = DataSet3DPtr(new DataSet3D());
- dataSetPtr->setAverageDencity(mAverageDensity);
- dataSetPtr->setAverageVelocity(mAverageVelocity);
- dataSetPtr->setAverageFluctuations(mAverageFluktuations);
- dataSetPtr->setAverageTriplecorrelations(mAverageTriplecorrelations);
- dataSetPtr->setShearStressValues(mShearStressValues);
- dataSetPtr->setRelaxationFactor(mRelaxationFactor);
- dataSetPtr->setFdistributions(mFdistributions);
-
- // find the nesessary block and fill it
- Block3DPtr block = grid->getBlock(dataSetArray[n].x1, dataSetArray[n].x2, dataSetArray[n].x3, dataSetArray[n].level);
- //LBMKernelPtr kernel(new CompressibleCumulantLBMKernel());
- //LBMKernelPtr kernel(new IncompressibleCumulantLBMKernel());
- LBMKernelPtr kernel = this->lbmKernel->clone();
- kernel->setGhostLayerWidth(dataSetArray[n].ghostLayerWidth);
- kernel->setCollisionFactor(dataSetArray[n].collFactor);
- kernel->setDeltaT(dataSetArray[n].deltaT);
- kernel->setCompressible(dataSetArray[n].compressible);
- kernel->setWithForcing(dataSetArray[n].withForcing);
- kernel->setDataSet(dataSetPtr);
- block->setKernel(kernel);
- //block->getKernel()->setDataSet(dataSetPtr);
- }
-
- delete[] dataSetArray;
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readDataSet end of restore of data, rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-}
-
-void MPIIORestartCoProcessor::readBoundaryConds(int step)
-{
- int rank, size;
- MPI_Comm_rank(MPI_COMM_WORLD, &rank);
- MPI_Comm_size(MPI_COMM_WORLD, &size);
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBoundaryConds start MPI IO rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
- double start, finish;
- if (comm->isRoot()) start = MPI_Wtime();
-
- MPI_File file_handler;
- std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBC.bin";
- int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
- if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
-
- int blocksCount = 0;
- int dataCount1000 = 0;
- int dataCount2 = 0;
- // read count of blocks
- MPI_File_read_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
- // read count of big BoundaryCondition blocks
- MPI_File_read_at(file_handler, (MPI_Offset)((rank+size)*sizeof(int)), &dataCount1000, 1, MPI_INT, MPI_STATUS_IGNORE);
- // read count of indexContainer values in all blocks
- MPI_File_read_at(file_handler, (MPI_Offset)((rank+2*size)*sizeof(int)), &dataCount2, 1, MPI_INT, MPI_STATUS_IGNORE);
-
- size_t dataCount = dataCount1000 * BLOCK_SIZE;
- BCAdd* bcAddArray = new BCAdd[blocksCount];
- BoundaryCondition* bcArray = new BoundaryCondition[dataCount];
- BoundaryCondition* nullBouCond = new BoundaryCondition();
- memset(nullBouCond, 0, sizeof(BoundaryCondition));
- int* intArray1 = new int[blocksCount * blockParamStr.bcindexmatrix_count];
- int* intArray2 = new int[dataCount2];
-
- MPI_Offset read_offset = (MPI_Offset)(3*size*sizeof(int));
- size_t next_read_offset = 0;
-
- if (size>1)
- {
- if (rank==0)
- {
- next_read_offset = read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)+(blocksCount * blockParamStr.bcindexmatrix_count+dataCount2)*sizeof(int);
- MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
- }
- else
- {
- MPI_Recv(&read_offset, 1, MPI_LONG_LONG_INT, rank-1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
- next_read_offset = read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)+(blocksCount * blockParamStr.bcindexmatrix_count+dataCount2)*sizeof(int);
- if (rank<size-1)
- MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, rank+1, 5, MPI_COMM_WORLD);
- }
- }
-
- MPI_File_read_at(file_handler, read_offset, bcAddArray, blocksCount, boundCondTypeAdd, MPI_STATUS_IGNORE);
- MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(BCAdd)), &bcArray[0], dataCount1000, boundCondType1000, MPI_STATUS_IGNORE);
- MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)), &intArray1[0], blocksCount, bcindexmatrixType, MPI_STATUS_IGNORE);
- MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)+blocksCount * blockParamStr.bcindexmatrix_count*sizeof(int)), &intArray2[0], dataCount2, MPI_INT, MPI_STATUS_IGNORE);
- //MPI_File_sync(file_handler);
-
- MPI_File_close(&file_handler);
-
- if (comm->isRoot())
- {
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBoundaryConds time: "<<finish-start<<" s");
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBoundaryConds start of restore of data, rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-
- int index = 0, index1 = 0, index2 = 0;
- std::vector<BoundaryConditionsPtr> bcVector;
- std::vector<int> bcindexmatrixV;
- std::vector<int> indexContainerV;
-
- for (size_t n = 0; n<blocksCount; n++)
- {
- bcVector.resize(0);
- bcindexmatrixV.resize(0);
- indexContainerV.resize(0);
-
- for (size_t ibc = 0; ibc<bcAddArray[n].boundCond_count; ibc++)
- {
- BoundaryConditionsPtr bc;
- if (memcmp(&bcArray[index], nullBouCond, sizeof(BoundaryCondition))==0)
- bc = BoundaryConditionsPtr();
- else
- {
- bc = BoundaryConditionsPtr(new BoundaryConditions);
- bc->noslipBoundaryFlags = bcArray[index].noslipBoundaryFlags;
- bc->slipBoundaryFlags = bcArray[index].slipBoundaryFlags;
- bc->densityBoundaryFlags = bcArray[index].densityBoundaryFlags;
- bc->velocityBoundaryFlags = bcArray[index].velocityBoundaryFlags;
- bc->wallModelBoundaryFlags = bcArray[index].wallModelBoundaryFlags;
- bc->bcVelocityX1 = bcArray[index].bcVelocityX1;
- bc->bcVelocityX2 = bcArray[index].bcVelocityX2;
- bc->bcVelocityX3 = bcArray[index].bcVelocityX3;
- bc->bcDensity = bcArray[index].bcDensity;
- bc->bcLodiDensity = bcArray[index].bcLodiDensity;
- bc->bcLodiVelocityX1 = bcArray[index].bcLodiVelocityX1;
- bc->bcLodiVelocityX2 = bcArray[index].bcLodiVelocityX2;
- bc->bcLodiVelocityX3 = bcArray[index].bcLodiVelocityX3;
- bc->bcLodiLentgh = bcArray[index].bcLodiLentgh;
-
- /*if (bcVectorGW[n].noslipBoundaryFlags != bc->noslipBoundaryFlags ||
- bcVectorGW[n].slipBoundaryFlags != bc->slipBoundaryFlags ||
- bcVectorGW[n].densityBoundaryFlags != bc->densityBoundaryFlags ||
- bcVectorGW[n].velocityBoundaryFlags != bc->velocityBoundaryFlags ||
- bcVectorGW[n].wallModelBoundaryFlags != bc->wallModelBoundaryFlags)
- std::cout << "readBoundaryConds BoundaryConditionsPtr !!!!===" <<std::endl;*/
-
- bc->nx1 = bcArray[index].nx1;
- bc->nx2 = bcArray[index].nx2;
- bc->nx3 = bcArray[index].nx3;
- for (int iq = 0; iq<26; iq++)
- bc->setQ(bcArray[index].q[iq], iq);
- bc->setBcAlgorithmType(bcArray[index].algorithmType);
- }
-
- bcVector.push_back(bc);
- index++;
- }
-
- for (int b1 = 0; b1 < blockParamStr.bcindexmatrix_count; b1++)
- bcindexmatrixV.push_back(intArray1[index1++]);
-
- for (int b2 = 0; b2 < bcAddArray[n].indexContainer_count; b2++)
- indexContainerV.push_back(intArray2[index2++]);
-
- CbArray3D<int, IndexerX3X2X1> bcim(bcindexmatrixV, blockParamStr.nx1, blockParamStr.nx2, blockParamStr.nx3);
-
- Block3DPtr block = grid->getBlock(bcAddArray[n].x1, bcAddArray[n].x2, bcAddArray[n].x3, bcAddArray[n].level);
- BCProcessorPtr bcProc = bcProcessor->clone(block->getKernel());
- BCArray3DPtr bcArr(new BCArray3D());
- bcArr->bcindexmatrix = bcim;
- bcArr->bcvector = bcVector;
- bcArr->indexContainer = indexContainerV;
- bcProc->setBCArray(bcArr);
-
- block->getKernel()->setBCProcessor(bcProc);
- }
-
-/* for (int b1 = 0; b1 < bcindexmatrixVGW.size(); b1++)
- {
- if (bcindexmatrixVGW[b1] != bcindexmatrixV[b1])
- std::cout << "readBoundaryConds bcindexmatrixVGW !!!!===" << std::endl;
- }
- for (int b2 = 0; b2 < indexContainerVGW.size(); b2++)
- {
- if (indexContainerVGW[b2] != indexContainerV[b2])
- std::cout << "readBoundaryConds indexContainerVGW !!!!===" << std::endl;
- }
-*/
- delete nullBouCond;
- delete[] bcArray;
- delete[] bcAddArray;
- delete[] intArray1;
- delete[] intArray2;
-
- if (comm->isRoot())
- {
- UBLOG(logINFO, "MPIIORestartCoProcessor::readBoundaryConds end of restore of data, rank = "<<rank);
- UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
- }
-}
-//////////////////////////////////////////////////////////////////////////
-void MPIIORestartCoProcessor::setChunk(int val)
-{
- chunk = val;
-}
-//////////////////////////////////////////////////////////////////////////
-void MPIIORestartCoProcessor::setLBMKernel(LBMKernelPtr kernel)
-{
- this->lbmKernel = kernel;
-}
-//////////////////////////////////////////////////////////////////////////
-void MPIIORestartCoProcessor::setBCProcessor(BCProcessorPtr bcProcessor)
-{
- this->bcProcessor = bcProcessor;
-}
-
+#include "MPIIORestart11CoProcessor.h"
+#include <boost/foreach.hpp>
+#include "D3Q27System.h"
+//#include "LBMKernel.h"
+#include "CompressibleCumulantLBMKernel.h"
+#include "IncompressibleCumulantLBMKernel.h"
+#include "ThinWallBCProcessor.h"
+#include "D3Q27EsoTwist3DSplittedVector.h"
+#include <UbSystem.h>
+#include <MemoryUtil.h>
+
+//! BLOCK_SIZE defines the quantity of the BoundaryCondition-structures written as one block to the file
+//! To avoid overflow in the parameter \a count of the function MPI_File_write_at
+//! structures BoundaryCondition are being written in blocks containing each of them BLOCK_SIZE structures
+#define BLOCK_SIZE 1024
+
+MPIIORestart11CoProcessor::MPIIORestart11CoProcessor(Grid3DPtr grid, UbSchedulerPtr s,
+ const std::string& path,
+ CommunicatorPtr comm) :
+ CoProcessor(grid, s),
+ path(path),
+ comm(comm),
+ mpiTypeFreeFlag(false)
+{
+ UbSystem::makeDirectory(path+"/mpi_io_cp");
+
+ memset(&dataSetParamStr, 0, sizeof(dataSetParamStr));
+ memset(&boundCondParamStr, 0, sizeof(boundCondParamStr));
+
+ //------------------------- define MPI types ---------------------------------
+
+ MPI_Datatype typesGP[3] = { MPI_DOUBLE, MPI_INT, MPI_CHAR };
+ int blocksGP[3] = { 34, 6, 5 };
+ MPI_Aint offsetsGP[3], lbGP, extentGP;
+
+ offsetsGP[0] = 0;
+ MPI_Type_get_extent(MPI_DOUBLE, &lbGP, &extentGP);
+ offsetsGP[1] = blocksGP[0]*extentGP;
+
+ MPI_Type_get_extent(MPI_INT, &lbGP, &extentGP);
+ offsetsGP[2] = offsetsGP[1]+blocksGP[1]*extentGP;
+
+ MPI_Type_create_struct (3, blocksGP, offsetsGP, typesGP, &gridParamType);
+ MPI_Type_commit(&gridParamType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Datatype typesBlock[2] = { MPI_INT, MPI_CHAR };
+ int blocksBlock[2] = { 13, 1 };
+ MPI_Aint offsetsBlock[2], lbBlock, extentBlock;
+
+ offsetsBlock[0] = 0;
+ MPI_Type_get_extent(MPI_INT, &lbBlock, &extentBlock);
+ offsetsBlock[1] = blocksBlock[0]*extentBlock;
+
+ MPI_Type_create_struct(2, blocksBlock, offsetsBlock, typesBlock, &block3dType);
+ MPI_Type_commit(&block3dType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Type_contiguous(40, MPI_INT, &dataSetParamType);
+ MPI_Type_commit(&dataSetParamType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Datatype typesDataSet[3] = { MPI_DOUBLE, MPI_INT, MPI_CHAR };
+ int blocksDataSet[3] = { 2, 5, 2 };
+ MPI_Aint offsetsDatatSet[3], lbDataSet, extentDataSet;
+
+ offsetsDatatSet[0] = 0;
+ MPI_Type_get_extent(MPI_DOUBLE, &lbDataSet, &extentDataSet);
+ offsetsDatatSet[1] = blocksDataSet[0]*extentDataSet;
+
+ MPI_Type_get_extent(MPI_INT, &lbDataSet, &extentDataSet);
+ offsetsDatatSet[2] = offsetsDatatSet[1]+blocksDataSet[1]*extentDataSet;
+
+ MPI_Type_create_struct(3, blocksDataSet, offsetsDatatSet, typesDataSet, &dataSetType);
+ MPI_Type_commit(&dataSetType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Type_contiguous(4, MPI_INT, &boundCondParamType);
+ MPI_Type_commit(&boundCondParamType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Datatype typesBC[3] = { MPI_LONG_LONG_INT, MPI_FLOAT, MPI_CHAR };
+ int blocksBC[3] = { 5, 38, 1 };
+ MPI_Aint offsetsBC[3], lbBC, extentBC;
+
+ offsetsBC[0] = 0;
+ MPI_Type_get_extent(MPI_LONG_LONG_INT, &lbBC, &extentBC);
+ offsetsBC[1] = blocksBC[0]*extentBC;
+
+ MPI_Type_get_extent(MPI_FLOAT, &lbBC, &extentBC);
+ offsetsBC[2] = offsetsBC[1]+blocksBC[1]*extentBC;
+
+ MPI_Type_create_struct(3, blocksBC, offsetsBC, typesBC, &boundCondType);
+ MPI_Type_commit(&boundCondType);
+
+ //---------------------------------------
+
+ MPI_Type_contiguous(BLOCK_SIZE, boundCondType, &boundCondType1000);
+ MPI_Type_commit(&boundCondType1000);
+
+ //---------------------------------------
+
+ MPI_Type_contiguous(6, MPI_INT, &boundCondTypeAdd);
+ MPI_Type_commit(&boundCondTypeAdd);
+
+}
+//////////////////////////////////////////////////////////////////////////
+MPIIORestart11CoProcessor::~MPIIORestart11CoProcessor()
+{
+ MPI_Type_free(&gridParamType);
+ MPI_Type_free(&block3dType);
+ MPI_Type_free(&dataSetParamType);
+ MPI_Type_free(&dataSetType);
+ MPI_Type_free(&boundCondParamType);
+ MPI_Type_free(&boundCondType);
+ MPI_Type_free(&boundCondType1000);
+ MPI_Type_free(&boundCondTypeAdd);
+
+ if (mpiTypeFreeFlag)
+ {
+ MPI_Type_free(&dataSetDoubleType);
+ MPI_Type_free(&bcindexmatrixType);
+ }
+}
+
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart11CoProcessor::process(double step)
+{
+ if (scheduler->isDue(step))
+ {
+ if (comm->isRoot()) UBLOG(logINFO, "MPIIORestart11CoProcessor save step: "<<step);
+ if (comm->isRoot()) UBLOG(logINFO, "Save check point - start");
+ /*if (comm->isRoot())*/ clearAllFiles((int)step);
+ writeBlocks((int)step);
+ writeDataSet((int)step);
+ writeBoundaryConds((int)step);
+ if (comm->isRoot()) UBLOG(logINFO, "Save check point - end");
+
+ //readDataSet((int)step);
+ //readBoundaryConds((int)step);
+ }
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart11CoProcessor::clearAllFiles(int step)
+{
+ MPI_File file_handler1, file_handler2, file_handler3;
+ MPI_Info info = MPI_INFO_NULL;
+ MPI_Offset new_size = 0;
+
+ UbSystem::makeDirectory(path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step));
+ std::string filename1 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBlocks.bin";
+ //MPI_File_delete(filename1.c_str(), info);
+ int rc1 = MPI_File_open(MPI_COMM_WORLD, filename1.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, MPI_INFO_NULL, &file_handler1);
+ if (rc1 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename1);
+ MPI_File_set_size(file_handler1, new_size);
+ //MPI_File_sync(file_handler1);
+ MPI_File_close(&file_handler1);
+
+ std::string filename2 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpDataSet.bin";
+ //MPI_File_delete(filename2.c_str(), info);
+ int rc2 = MPI_File_open(MPI_COMM_WORLD, filename2.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, info, &file_handler2);
+ if (rc2 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename2);
+ MPI_File_set_size(file_handler2, new_size);
+ //MPI_File_sync(file_handler2);
+ MPI_File_close(&file_handler2);
+
+ std::string filename3 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBC.bin";
+ //MPI_File_delete(filename3.c_str(), info);
+ int rc3 = MPI_File_open(MPI_COMM_WORLD, filename3.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, info, &file_handler3);
+ if (rc3 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename3);
+ MPI_File_set_size(file_handler3, new_size);
+ //MPI_File_sync(file_handler3);
+ MPI_File_close(&file_handler3);
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart11CoProcessor::writeBlocks(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ //MPI_Comm_size(MPI_COMM_WORLD, &size);
+ size=1;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeBlocks start collect data rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ int blocksCount = 0; // quantity of blocks in the grid, max 2147483648 blocks!
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+
+ std::vector<Block3DPtr> blocksVector[25]; // max 25 levels
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ //grid->getBlocks(level, rank, blockVector[level]);
+ grid->getBlocks(level, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ GridParam* gridParameters = new GridParam;
+ gridParameters->trafoParams[0] = grid->getCoordinateTransformator()->Tx1;
+ gridParameters->trafoParams[1] = grid->getCoordinateTransformator()->Tx2;
+ gridParameters->trafoParams[2] = grid->getCoordinateTransformator()->Tx3;
+ gridParameters->trafoParams[3] = grid->getCoordinateTransformator()->Sx1;
+ gridParameters->trafoParams[4] = grid->getCoordinateTransformator()->Sx2;
+ gridParameters->trafoParams[5] = grid->getCoordinateTransformator()->Sx3;
+ gridParameters->trafoParams[6] = grid->getCoordinateTransformator()->alpha;
+ gridParameters->trafoParams[7] = grid->getCoordinateTransformator()->beta;
+ gridParameters->trafoParams[8] = grid->getCoordinateTransformator()->gamma;
+
+ gridParameters->trafoParams[9] = grid->getCoordinateTransformator()->toX1factorX1;
+ gridParameters->trafoParams[10] = grid->getCoordinateTransformator()->toX1factorX2;
+ gridParameters->trafoParams[11] = grid->getCoordinateTransformator()->toX1factorX3;
+ gridParameters->trafoParams[12] = grid->getCoordinateTransformator()->toX1delta;
+ gridParameters->trafoParams[13] = grid->getCoordinateTransformator()->toX2factorX1;
+ gridParameters->trafoParams[14] = grid->getCoordinateTransformator()->toX2factorX2;
+ gridParameters->trafoParams[15] = grid->getCoordinateTransformator()->toX2factorX3;
+ gridParameters->trafoParams[16] = grid->getCoordinateTransformator()->toX2delta;
+ gridParameters->trafoParams[17] = grid->getCoordinateTransformator()->toX3factorX1;
+ gridParameters->trafoParams[18] = grid->getCoordinateTransformator()->toX3factorX2;
+ gridParameters->trafoParams[19] = grid->getCoordinateTransformator()->toX3factorX3;
+ gridParameters->trafoParams[20] = grid->getCoordinateTransformator()->toX3delta;
+
+ gridParameters->trafoParams[21] = grid->getCoordinateTransformator()->fromX1factorX1;
+ gridParameters->trafoParams[22] = grid->getCoordinateTransformator()->fromX1factorX2;
+ gridParameters->trafoParams[23] = grid->getCoordinateTransformator()->fromX1factorX3;
+ gridParameters->trafoParams[24] = grid->getCoordinateTransformator()->fromX1delta;
+ gridParameters->trafoParams[25] = grid->getCoordinateTransformator()->fromX2factorX1;
+ gridParameters->trafoParams[26] = grid->getCoordinateTransformator()->fromX2factorX2;
+ gridParameters->trafoParams[27] = grid->getCoordinateTransformator()->fromX2factorX3;
+ gridParameters->trafoParams[28] = grid->getCoordinateTransformator()->fromX2delta;
+ gridParameters->trafoParams[29] = grid->getCoordinateTransformator()->fromX3factorX1;
+ gridParameters->trafoParams[30] = grid->getCoordinateTransformator()->fromX3factorX2;
+ gridParameters->trafoParams[31] = grid->getCoordinateTransformator()->fromX3factorX3;
+ gridParameters->trafoParams[32] = grid->getCoordinateTransformator()->fromX3delta;
+
+ gridParameters->active = grid->getCoordinateTransformator()->active;
+ gridParameters->transformation = grid->getCoordinateTransformator()->transformation;
+
+ gridParameters->deltaX = grid->getDeltaX(minInitLevel);
+ UbTupleInt3 blocknx = grid->getBlockNX();
+ gridParameters->blockNx1 = val<1>(blocknx);
+ gridParameters->blockNx2 = val<2>(blocknx);
+ gridParameters->blockNx3 = val<3>(blocknx);
+ gridParameters->nx1 = grid->getNX1();
+ gridParameters->nx2 = grid->getNX2();
+ gridParameters->nx3 = grid->getNX3();
+ gridParameters->periodicX1 = grid->isPeriodicX1();
+ gridParameters->periodicX2 = grid->isPeriodicX2();
+ gridParameters->periodicX3 = grid->isPeriodicX3();
+
+ //----------------------------------------------------------------------
+
+ Block3d* block3dArray = new Block3d[blocksCount];
+ int ic = 0;
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // all the blocks of the current level
+ {
+ // save data describing the block
+ block3dArray[ic].x1 = block->getX1();
+ block3dArray[ic].x2 = block->getX2();
+ block3dArray[ic].x3 = block->getX3();
+ block3dArray[ic].bundle = block->getBundle();
+ block3dArray[ic].rank = block->getRank();
+ block3dArray[ic].lrank = block->getLocalRank();
+ block3dArray[ic].part = block->getPart();
+ block3dArray[ic].globalID = block->getGlobalID();
+ block3dArray[ic].localID = block->getLocalID();
+ block3dArray[ic].level = block->getLevel();
+ block3dArray[ic].interpolationFlagCF = block->getInterpolationFlagCF();
+ block3dArray[ic].interpolationFlagFC = block->getInterpolationFlagFC();
+ block3dArray[ic].counter = block->getMaxGlobalID();
+ block3dArray[ic].active = block->isActive();
+
+ ic++;
+ }
+ }
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeBlocks start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ MPI_File file_handler;
+ MPI_Info info = MPI_INFO_NULL;
+ //MPI_Info_create (&info);
+ //MPI_Info_set(info,"romio_cb_write","enable");
+ //MPI_Info_set(info,"cb_buffer_size","4194304");
+ //MPI_Info_set(info,"striping_unit","4194304");
+
+ // if (comm->isRoot())
+ // {
+ UbSystem::makeDirectory(path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step));
+ std::string filename = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBlocks.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, MPI_INFO_NULL, &file_handler);
+ if (rc != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename);
+ // }
+
+ double start, finish;
+ MPI_Offset write_offset = (MPI_Offset)(size * sizeof(int));
+
+ if (comm->isRoot())
+ {
+ start = MPI_Wtime();
+
+ // each process writes the quantity of it's blocks
+ MPI_File_write_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // each process writes parameters of the grid
+ MPI_File_write_at(file_handler, write_offset, gridParameters, 1, gridParamType, MPI_STATUS_IGNORE);
+ // each process writes it's blocks
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset +sizeof(GridParam)), &block3dArray[0], blocksCount, block3dType, MPI_STATUS_IGNORE);
+ }
+
+ MPI_File_sync(file_handler);
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeBlocks time: "<<finish-start<<" s");
+ }
+
+ delete[] block3dArray;
+ delete gridParameters;
+}
+
+void MPIIORestart11CoProcessor::writeDataSet(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ int blocksCount = 0; // quantity of blocks in the grid, max 2147483648 blocks!
+
+ std::vector<Block3DPtr> blocksVector[25];
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ grid->getBlocks(level, rank, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ DataSet* dataSetArray = new DataSet[blocksCount];
+ std::vector<double> doubleValuesArray; // double-values (arrays of f's) in all blocks
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeDataSet start collect data rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ bool firstBlock = true;
+ int ic = 0;
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
+ {
+ dataSetArray[ic].x1 = block->getX1(); // coordinates of the block needed to find it while regenerating the grid
+ dataSetArray[ic].x2 = block->getX2();
+ dataSetArray[ic].x3 = block->getX3();
+ dataSetArray[ic].level = block->getLevel();
+ //if (block->getKernel())
+ //{
+ dataSetArray[ic].ghostLayerWidth = block->getKernel()->getGhostLayerWidth();
+ dataSetArray[ic].collFactor = block->getKernel()->getCollisionFactor();
+ dataSetArray[ic].deltaT = block->getKernel()->getDeltaT();
+ dataSetArray[ic].compressible = block->getKernel()->getCompressible();
+ dataSetArray[ic].withForcing = block->getKernel()->getWithForcing();
+ //}
+ //else
+ //{
+ // dataSetArray[ic].ghostLayerWidth = 0;
+ // dataSetArray[ic].collFactor = 0.0;
+ // dataSetArray[ic].deltaT = 0.0;
+ // dataSetArray[ic].compressible = false;
+ // dataSetArray[ic].withForcing = false;
+ //}
+ //std::cout << "ic="<<ic<<"-"<<dataSetArray[ic].x1 << "," << dataSetArray[ic].x2 << "," << dataSetArray[ic].x3 << "," << dataSetArray[ic].level << "," << dataSetArray[ic].ghostLayerWidth;
+ //std::cout << dataSetArray[ic].collFactor<<","<<dataSetArray[ic].deltaT<<","<<dataSetArray[ic].compressible<<","<<dataSetArray[ic].withForcing<<std::endl;
+ //dataSetArrayGW[ic].x1 = dataSetArray[ic].x1;
+ //dataSetArrayGW[ic].x2 = dataSetArray[ic].x2;
+ //dataSetArrayGW[ic].x3 = dataSetArray[ic].x3;
+ //dataSetArrayGW[ic].level = dataSetArray[ic].level;
+ //dataSetArrayGW[ic].ghostLayerWidth = dataSetArray[ic].ghostLayerWidth;
+ //dataSetArrayGW[ic].collFactor = dataSetArray[ic].collFactor;
+ //dataSetArrayGW[ic].deltaT = dataSetArray[ic].deltaT;
+ //dataSetArrayGW[ic].compressible = dataSetArray[ic].compressible;
+ //dataSetArrayGW[ic].withForcing = dataSetArray[ic].withForcing;
+
+ if (firstBlock /*&& block->getKernel()*/) // when first (any) valid block...
+ {
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > averageDensityArray = block->getKernel()->getDataSet()->getAverageDencity();
+ if (averageDensityArray)
+ {
+ dataSetParamStr.nx[0][0] = static_cast<int>(averageDensityArray->getNX1());
+ dataSetParamStr.nx[0][1] = static_cast<int>(averageDensityArray->getNX2());
+ dataSetParamStr.nx[0][2] = static_cast<int>(averageDensityArray->getNX3());
+ dataSetParamStr.nx[0][3] = static_cast<int>(averageDensityArray->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageVelocityArray3DPtr = block->getKernel()->getDataSet()->getAverageVelocity();
+ if (AverageVelocityArray3DPtr)
+ {
+ dataSetParamStr.nx[1][0] = static_cast<int>(AverageVelocityArray3DPtr->getNX1());
+ dataSetParamStr.nx[1][1] = static_cast<int>(AverageVelocityArray3DPtr->getNX2());
+ dataSetParamStr.nx[1][2] = static_cast<int>(AverageVelocityArray3DPtr->getNX3());
+ dataSetParamStr.nx[1][3] = static_cast<int>(AverageVelocityArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageFluctArray3DPtr = block->getKernel()->getDataSet()->getAverageFluctuations();
+ if (AverageFluctArray3DPtr)
+ {
+ dataSetParamStr.nx[2][0] = static_cast<int>(AverageFluctArray3DPtr->getNX1());
+ dataSetParamStr.nx[2][1] = static_cast<int>(AverageFluctArray3DPtr->getNX2());
+ dataSetParamStr.nx[2][2] = static_cast<int>(AverageFluctArray3DPtr->getNX3());
+ dataSetParamStr.nx[2][3] = static_cast<int>(AverageFluctArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageTripleArray3DPtr = block->getKernel()->getDataSet()->getAverageTriplecorrelations();
+ if (AverageTripleArray3DPtr)
+ {
+ dataSetParamStr.nx[3][0] = static_cast<int>(AverageTripleArray3DPtr->getNX1());
+ dataSetParamStr.nx[3][1] = static_cast<int>(AverageTripleArray3DPtr->getNX2());
+ dataSetParamStr.nx[3][2] = static_cast<int>(AverageTripleArray3DPtr->getNX3());
+ dataSetParamStr.nx[3][3] = static_cast<int>(AverageTripleArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > ShearStressValArray3DPtr = block->getKernel()->getDataSet()->getShearStressValues();
+ if (ShearStressValArray3DPtr)
+ {
+ dataSetParamStr.nx[4][0] = static_cast<int>(ShearStressValArray3DPtr->getNX1());
+ dataSetParamStr.nx[4][1] = static_cast<int>(ShearStressValArray3DPtr->getNX2());
+ dataSetParamStr.nx[4][2] = static_cast<int>(ShearStressValArray3DPtr->getNX3());
+ dataSetParamStr.nx[4][3] = static_cast<int>(ShearStressValArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray3D<LBMReal, IndexerX3X2X1> > relaxationFactor3DPtr = block->getKernel()->getDataSet()->getRelaxationFactor();
+ if (relaxationFactor3DPtr)
+ {
+ dataSetParamStr.nx[5][0] = static_cast<int>(relaxationFactor3DPtr->getNX1());
+ dataSetParamStr.nx[5][1] = static_cast<int>(relaxationFactor3DPtr->getNX2());
+ dataSetParamStr.nx[5][2] = static_cast<int>(relaxationFactor3DPtr->getNX3());
+ dataSetParamStr.nx[5][3] = 1;
+ }
+
+ boost::shared_ptr< D3Q27EsoTwist3DSplittedVector > D3Q27EsoTwist3DSplittedVectorPtr = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(block->getKernel()->getDataSet()->getFdistributions());
+ CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr localDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getLocalDistributions();
+ if (localDistributions)
+ {
+ dataSetParamStr.nx[6][0] = static_cast<int>(localDistributions->getNX1());
+ dataSetParamStr.nx[6][1] = static_cast<int>(localDistributions->getNX2());
+ dataSetParamStr.nx[6][2] = static_cast<int>(localDistributions->getNX3());
+ dataSetParamStr.nx[6][3] = static_cast<int>(localDistributions->getNX4());
+ }
+
+ CbArray4D <LBMReal, IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getNonLocalDistributions();
+ if (nonLocalDistributions)
+ {
+ dataSetParamStr.nx[7][0] = static_cast<int>(nonLocalDistributions->getNX1());
+ dataSetParamStr.nx[7][1] = static_cast<int>(nonLocalDistributions->getNX2());
+ dataSetParamStr.nx[7][2] = static_cast<int>(nonLocalDistributions->getNX3());
+ dataSetParamStr.nx[7][3] = static_cast<int>(nonLocalDistributions->getNX4());
+ }
+
+ CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr zeroDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getZeroDistributions();
+ if (zeroDistributions)
+ {
+ dataSetParamStr.nx[8][0] = static_cast<int>(zeroDistributions->getNX1());
+ dataSetParamStr.nx[8][1] = static_cast<int>(zeroDistributions->getNX2());
+ dataSetParamStr.nx[8][2] = static_cast<int>(zeroDistributions->getNX3());
+ dataSetParamStr.nx[8][3] = 1;
+ }
+
+ // ... than save some parameters that are equal in all dataSets
+ dataSetParamStr.nx1 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX1());
+ dataSetParamStr.nx2 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX2());
+ dataSetParamStr.nx3 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX3());
+
+ firstBlock = false;
+
+ // how many elements are in all arrays of DataSet (equal in all blocks)
+ int doubleCount = 0, temp;
+ for (int i = 0; i<9; i++) // 9 arrays ( averageValues, averageVelocity, averageFluktuations,
+ { // averageTriplecorrelations, shearStressValues, relaxationFactor, 3 * fdistributions
+ temp = 1;
+ for (int ii = 0; ii < 4; ii++)
+ {
+ temp *= dataSetParamStr.nx[i][ii];
+ //std::cout << ",dataSetParamStr.nx[" << i << "][" << ii << "]" << "=" << dataSetParamStr.nx[i][ii];
+ }
+ doubleCount += temp;
+ }
+ dataSetParamStr.doubleCountInBlock = doubleCount;
+ }
+ //std::cout << ",doubleCountInBlock="<<dataSetParamStr.doubleCountInBlock<< "," << dataSetParamStr.nx1 << "," << dataSetParamStr.nx2 << "," << dataSetParamStr.nx3 << std::endl;
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageValuesArray3DPtr = block->getKernel()->getDataSet()->getAverageDencity();
+ if (AverageValuesArray3DPtr&&(dataSetParamStr.nx[0][0]>0)&&(dataSetParamStr.nx[0][1]>0)&&(dataSetParamStr.nx[0][2]>0)&&(dataSetParamStr.nx[0][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageValuesArray3DPtr->getDataVector().begin(), AverageValuesArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageVelocityArray3DPtr = block->getKernel()->getDataSet()->getAverageVelocity();
+ if (AverageVelocityArray3DPtr&&(dataSetParamStr.nx[1][0]>0)&&(dataSetParamStr.nx[1][1]>0)&&(dataSetParamStr.nx[1][2]>0)&&(dataSetParamStr.nx[1][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageVelocityArray3DPtr->getDataVector().begin(), AverageVelocityArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageFluctArray3DPtr = block->getKernel()->getDataSet()->getAverageFluctuations();
+ if (AverageFluctArray3DPtr&&(dataSetParamStr.nx[2][0]>0)&&(dataSetParamStr.nx[2][1]>0)&&(dataSetParamStr.nx[2][2]>0)&&(dataSetParamStr.nx[2][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageFluctArray3DPtr->getDataVector().begin(), AverageFluctArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageTripleArray3DPtr = block->getKernel()->getDataSet()->getAverageTriplecorrelations();
+ if (AverageTripleArray3DPtr&&(dataSetParamStr.nx[3][0]>0)&&(dataSetParamStr.nx[3][1]>0)&&(dataSetParamStr.nx[3][2]>0)&&(dataSetParamStr.nx[3][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageTripleArray3DPtr->getDataVector().begin(), AverageTripleArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > ShearStressValArray3DPtr = block->getKernel()->getDataSet()->getShearStressValues();
+ if (ShearStressValArray3DPtr&&(dataSetParamStr.nx[4][0]>0)&&(dataSetParamStr.nx[4][1]>0)&&(dataSetParamStr.nx[4][2]>0)&&(dataSetParamStr.nx[4][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), ShearStressValArray3DPtr->getDataVector().begin(), ShearStressValArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray3D<LBMReal, IndexerX3X2X1> > RelaxationFactor3DPtr = block->getKernel()->getDataSet()->getRelaxationFactor();
+ if (RelaxationFactor3DPtr&&(dataSetParamStr.nx[5][0]>0)&&(dataSetParamStr.nx[5][1]>0)&&(dataSetParamStr.nx[5][2]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), RelaxationFactor3DPtr->getDataVector().begin(), RelaxationFactor3DPtr->getDataVector().end());
+
+ boost::shared_ptr< D3Q27EsoTwist3DSplittedVector > D3Q27EsoTwist3DSplittedVectorPtr = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(block->getKernel()->getDataSet()->getFdistributions());
+ CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr localDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getLocalDistributions();
+ if (localDistributions&&(dataSetParamStr.nx[6][0]>0)&&(dataSetParamStr.nx[6][1]>0)&&(dataSetParamStr.nx[6][2]>0)&&(dataSetParamStr.nx[6][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), localDistributions->getDataVector().begin(), localDistributions->getDataVector().end());
+
+ CbArray4D <LBMReal, IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getNonLocalDistributions();
+ if (nonLocalDistributions&&(dataSetParamStr.nx[7][0]>0)&&(dataSetParamStr.nx[7][1]>0)&&(dataSetParamStr.nx[7][2]>0)&&(dataSetParamStr.nx[7][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), nonLocalDistributions->getDataVector().begin(), nonLocalDistributions->getDataVector().end());
+
+ CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr zeroDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getZeroDistributions();
+ if (zeroDistributions&&(dataSetParamStr.nx[8][0]>0)&&(dataSetParamStr.nx[8][1]>0)&&(dataSetParamStr.nx[8][2]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), zeroDistributions->getDataVector().begin(), zeroDistributions->getDataVector().end());
+
+ ic++;
+ }
+ }
+
+ // register new MPI-types depending on the block-specific information
+ MPI_Type_contiguous(dataSetParamStr.doubleCountInBlock, MPI_DOUBLE, &dataSetDoubleType);
+ MPI_Type_commit(&dataSetDoubleType);
+ mpiTypeFreeFlag = true;
+
+ //doubleValuesArrayGW.assign(doubleValuesArray.begin(), doubleValuesArray.end());
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeDataSet start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ // write to the file
+ // all processes calculate their offsets (quantity of bytes that the process is going to write)
+ // and notify the next process (with the rank = rank + 1)
+ MPI_Offset write_offset = (MPI_Offset)(size * sizeof(int));
+ size_t next_write_offset = 0;
+
+ if (size>1)
+ {
+ if (rank==0)
+ {
+ next_write_offset = write_offset + sizeof(dataSetParam) + blocksCount * (sizeof(DataSet)+ dataSetParamStr.doubleCountInBlock*sizeof(double));
+ MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
+ }
+ else
+ {
+ MPI_Recv(&write_offset, 1, MPI_LONG_LONG_INT, rank-1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ next_write_offset = write_offset + sizeof(dataSetParam) + blocksCount * (sizeof(DataSet)+ dataSetParamStr.doubleCountInBlock*sizeof(double));
+ if (rank<size-1)
+ MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, rank+1, 5, MPI_COMM_WORLD);
+ }
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_Info info = MPI_INFO_NULL;
+
+#ifdef HLRN
+ MPI_Info_create(&info);
+ MPI_Info_set(info, "striping_factor", "40");
+ MPI_Info_set(info, "striping_unit", "4M");
+#endif
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE| MPI_MODE_WRONLY, info, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ //std::cout << "writeDataSet rank=" << rank << ",blocksCount=" << blocksCount;
+ //std::cout << ", rank*sizeof(int)=" << (MPI_Offset)(rank * sizeof(int)) << ", write_offset=" << write_offset << std::endl;
+
+ // each process writes the quantity of it's blocks
+ MPI_File_write_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // each process writes common parameters of a dataSet
+ MPI_File_write_at(file_handler, write_offset, &dataSetParamStr, 1, dataSetParamType, MPI_STATUS_IGNORE);
+ // each process writes data identifying blocks
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+sizeof(dataSetParam)), dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
+ // each process writes the dataSet arrays
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+sizeof(dataSetParam)+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
+ MPI_File_sync(file_handler);
+
+ //int blockC;
+ //MPI_File_read_at(file_handler, (MPI_Offset)(rank * sizeof(int)), &blockC, 1, MPI_INT, MPI_STATUS_IGNORE);
+ //std::cout << "readDataSet rank=" << rank << ", blockC=" << blockC << std::endl;
+
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeDataSet time: "<<finish-start<<" s");
+ }
+
+ delete[] dataSetArray;
+}
+
+void MPIIORestart11CoProcessor::writeBoundaryConds(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeBoundaryConds start collect data rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ int blocksCount = 0; // quantity of blocks in the grid, max 2147483648 blocks!
+ size_t count_boundCond = 0; // how many BoundaryConditions in all blocks
+ int count_indexContainer = 0; // how many indexContainer-values in all blocks
+ size_t byteCount = 0; // how many bytes writes this process in the file
+
+ std::vector<Block3DPtr> blocksVector[25];
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ grid->getBlocks(level, rank, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ BCAdd* bcAddArray = new BCAdd[blocksCount];
+ std::vector<BoundaryCondition> bcVector;
+ std::vector<int> bcindexmatrixV;
+ std::vector<int> indexContainerV;
+ bool bcindexmatrixCountNotInit = true;
+
+ int ic = 0;
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // all the blocks of the current level
+ {
+ BCArray3DPtr bcArr = block->getKernel()->getBCProcessor()->getBCArray();
+
+ bcAddArray[ic].x1 = block->getX1(); // coordinates of the block needed to find it while regenerating the grid
+ bcAddArray[ic].x2 = block->getX2();
+ bcAddArray[ic].x3 = block->getX3();
+ bcAddArray[ic].level = block->getLevel();
+ bcAddArray[ic].boundCond_count = 0; // how many BoundaryConditions in this block
+ bcAddArray[ic].indexContainer_count = 0; // how many indexContainer-values in this block
+
+ for (int bc = 0; bc<bcArr->getBCVectorSize(); bc++)
+ {
+ BoundaryCondition* bouCond = new BoundaryCondition();
+ if (bcArr->bcvector[bc]==NULL)
+ {
+ memset(bouCond, 0, sizeof(BoundaryCondition));
+ }
+ else
+ {
+ bouCond->noslipBoundaryFlags = bcArr->bcvector[bc]->getNoSlipBoundary();
+ bouCond->slipBoundaryFlags = bcArr->bcvector[bc]->getSlipBoundary();
+ bouCond->velocityBoundaryFlags = bcArr->bcvector[bc]->getVelocityBoundary();
+ bouCond->densityBoundaryFlags = bcArr->bcvector[bc]->getDensityBoundary();
+ bouCond->wallModelBoundaryFlags = bcArr->bcvector[bc]->getWallModelBoundary();
+ bouCond->bcVelocityX1 = bcArr->bcvector[bc]->getBoundaryVelocityX1();
+ bouCond->bcVelocityX2 = bcArr->bcvector[bc]->getBoundaryVelocityX2();
+ bouCond->bcVelocityX3 = bcArr->bcvector[bc]->getBoundaryVelocityX3();
+ bouCond->bcDensity = bcArr->bcvector[bc]->getBoundaryDensity();
+ bouCond->bcLodiDensity = bcArr->bcvector[bc]->getDensityLodiDensity();
+ bouCond->bcLodiVelocityX1 = bcArr->bcvector[bc]->getDensityLodiVelocityX1();
+ bouCond->bcLodiVelocityX2 = bcArr->bcvector[bc]->getDensityLodiVelocityX2();
+ bouCond->bcLodiVelocityX3 = bcArr->bcvector[bc]->getDensityLodiVelocityX3();
+ bouCond->bcLodiLentgh = bcArr->bcvector[bc]->getDensityLodiLength();
+ bouCond->nx1 = bcArr->bcvector[bc]->nx1;
+ bouCond->nx2 = bcArr->bcvector[bc]->nx2;
+ bouCond->nx3 = bcArr->bcvector[bc]->nx3;
+ for (int iq = 0; iq<26; iq++)
+ bouCond->q[iq] = bcArr->bcvector[bc]->getQ(iq);
+ bouCond->algorithmType = bcArr->bcvector[bc]->getBcAlgorithmType();
+ }
+ //std::cout << "writeBoundaryConds noslipBoundaryFlags="<< bouCond->noslipBoundaryFlags << std::endl;
+ bcVector.push_back(*bouCond);
+ //bcVectorGW.push_back(*bouCond);
+ //if (bcVector[count_boundCond].noslipBoundaryFlags != bcVectorGW[count_boundCond].noslipBoundaryFlags)
+ // std::cout << "bcVector[count_boundCond].noslipBoundaryFlags != bcVectorGW[count_boundCond].noslipBoundaryFlags!!!" << std::endl;
+ bcAddArray[ic].boundCond_count++;
+ count_boundCond++;
+ }
+
+ // the quantity of elements in the bcindexmatrix array (CbArray3D<int, IndexerX3X2X1>) in bcArray(BCArray3D) is always equal,
+ // this will be the size of the "write-read-block" in MPI_write_.../MPI_read-functions when writing/reading BoundConds
+ if (bcindexmatrixCountNotInit)
+ {
+ boundCondParamStr.nx1 = static_cast<int>(bcArr->bcindexmatrix.getNX1());
+ boundCondParamStr.nx2 = static_cast<int>(bcArr->bcindexmatrix.getNX2());
+ boundCondParamStr.nx3 = static_cast<int>(bcArr->bcindexmatrix.getNX3());
+ boundCondParamStr.bcindexmatrixCount = static_cast<int>(bcArr->bcindexmatrix.getDataVector().size());
+ bcindexmatrixCountNotInit = false;
+ }
+ bcindexmatrixV.insert(bcindexmatrixV.end(), bcArr->bcindexmatrix.getDataVector().begin(), bcArr->bcindexmatrix.getDataVector().end());
+
+ indexContainerV.insert(indexContainerV.end(), bcArr->indexContainer.begin(), bcArr->indexContainer.end());
+ bcAddArray[ic].indexContainer_count = static_cast<int>(bcArr->indexContainer.size());
+ count_indexContainer += bcAddArray[ic].indexContainer_count;
+
+ ic++;
+ }
+ }
+
+ //bcindexmatrixVGW.assign(bcindexmatrixV.begin(), bcindexmatrixV.end());
+ //indexContainerVGW.assign(indexContainerV.begin(), indexContainerV.end());
+
+ MPI_Type_contiguous(boundCondParamStr.bcindexmatrixCount, MPI_INT, &bcindexmatrixType);
+ MPI_Type_commit(&bcindexmatrixType);
+ mpiTypeFreeFlag = true;
+
+ //how many "big blocks" of BLOCK_SIZE size can by formed
+ int bcBlockCount = (int)(count_boundCond/BLOCK_SIZE);
+ if (bcBlockCount * BLOCK_SIZE<count_boundCond)
+ bcBlockCount += 1;
+ for (int i = (int)count_boundCond; i<bcBlockCount * BLOCK_SIZE; i++)
+ {
+ BoundaryCondition* bouCond = new BoundaryCondition();
+ memset(bouCond, 0, sizeof(BoundaryCondition));
+ bcVector.push_back(*bouCond);
+ }
+
+ byteCount = bcBlockCount * BLOCK_SIZE * sizeof(BoundaryCondition) + blocksCount * sizeof(BCAdd) + sizeof(int) * (blocksCount * boundCondParamStr.bcindexmatrixCount + count_indexContainer);
+
+ // write to the file
+ // all processes calculate their offsets (quantity of bytes that the process is going to write)
+ // and notify the next process (with the rank = rank + 1)
+ MPI_Offset write_offset = (MPI_Offset)(size * (3 * sizeof(int) + sizeof(boundCondParam)));
+ size_t next_write_offset = 0;
+
+ if (size>1)
+ {
+ if (rank==0)
+ {
+ next_write_offset = write_offset + byteCount;
+ MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
+ }
+ else
+ {
+ MPI_Recv(&write_offset, 1, MPI_LONG_LONG_INT, rank-1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ next_write_offset = write_offset + byteCount;
+ if (rank<size-1)
+ MPI_Send(&next_write_offset, 1, MPI_LONG_LONG_INT, rank+1, 5, MPI_COMM_WORLD);
+ }
+ }
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeBoundaryConds start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_Info info = MPI_INFO_NULL;
+
+#ifdef HLRN
+ MPI_Info_create(&info);
+ MPI_Info_set(info, "striping_factor", "40");
+ MPI_Info_set(info, "striping_unit", "4M");
+#endif
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBC.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE|MPI_MODE_WRONLY, info, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ MPI_Offset write_offset1 = (MPI_Offset)(rank * (3 * sizeof(int) + sizeof(boundCondParam)));
+
+ // each process writes the quantity of it's blocks
+ MPI_File_write_at(file_handler, write_offset1, &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // each process writes the quantity of "big blocks" of BLOCK_SIZE of boundary conditions
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset1+sizeof(int)), &bcBlockCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // each process writes the quantity of indexContainer elements in all blocks
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset1+2*sizeof(int)), &count_indexContainer, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // each process writes the quantity of bcindexmatrix elements in every block
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset1+3*sizeof(int)), &boundCondParamStr, 1, boundCondParamType, MPI_STATUS_IGNORE);
+
+ //std::cout << "rank=" << rank << ",(rank*write_offset1)=" << rank*write_offset1<< ",blocksCount=" << blocksCount ;
+ //std::cout << ", " << rank*write_offset1 + sizeof(int) << ",bcBlockCount=" << bcBlockCount;
+ //std::cout << ", " << rank*write_offset1 + 2 * sizeof(int) << ",count_indexContainer=" << count_indexContainer;
+ //std::cout << ", " << rank*write_offset1 + 3 * sizeof(int) << ",boundCondParamStr=" << boundCondParamStr.bcindexmatrixCount << std::endl;
+
+ // each process writes data identifying the blocks
+ MPI_File_write_at(file_handler, write_offset, bcAddArray, blocksCount, boundCondTypeAdd, MPI_STATUS_IGNORE);
+ // each process writes boundary conditions
+ if (bcVector.size()>0)
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+blocksCount*sizeof(BCAdd)), &bcVector[0], bcBlockCount, boundCondType1000, MPI_STATUS_IGNORE);
+ // each process writes bcindexmatrix values
+ if (bcindexmatrixV.size()>0)
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+blocksCount*sizeof(BCAdd)+bcBlockCount*BLOCK_SIZE*sizeof(BoundaryCondition)), &bcindexmatrixV[0], blocksCount, bcindexmatrixType, MPI_STATUS_IGNORE);
+ // each process writes indexContainer values
+ if (indexContainerV.size()>0)
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset+blocksCount*sizeof(BCAdd)+bcBlockCount*BLOCK_SIZE*sizeof(BoundaryCondition)+blocksCount*boundCondParamStr.bcindexmatrixCount*sizeof(int)), &indexContainerV[0], count_indexContainer, MPI_INT, MPI_STATUS_IGNORE);
+ MPI_File_sync(file_handler);
+
+ //std::cout <<"rank="<<rank<<",blocksCount="<< blocksCount<<", "<< bcBlockCount<<", "<< count_indexContainer<<", "<< bcindexmatrixCount << std::endl;
+ //std::cout <<"rank="<<rank<<",write_offset="<< write_offset <<", "<< write_offset + blocksCount * sizeof(BCAdd) <<", "<< write_offset + blocksCount * sizeof(BCAdd) + bcBlockCount*BLOCK_SIZE * sizeof(BoundaryCondition) <<", "<< write_offset + blocksCount * sizeof(BCAdd) + bcBlockCount*BLOCK_SIZE * sizeof(BoundaryCondition) + blocksCount*bcindexmatrixCount * sizeof(int)<< std::endl;
+
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::writeBoundaryConds time: "<<finish-start<<" s");
+ }
+
+ delete[] bcAddArray;
+}
+
+//------------------------------------------- READ -----------------------------------------------
+void MPIIORestart11CoProcessor::restart(int step)
+{
+ if (comm->isRoot()) UBLOG(logINFO, "MPIIORestart11CoProcessor restart step: "<<step);
+ if (comm->isRoot()) UBLOG(logINFO, "Load check point - start");
+ readBlocks(step);
+ readDataSet(step);
+ readBoundaryConds(step);
+ if (comm->isRoot()) UBLOG(logINFO, "Load check point - end");
+ this->reconnect(grid);
+}
+
+void MPIIORestart11CoProcessor::readBlocks(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ //MPI_Comm_size(MPI_COMM_WORLD, &size);
+ size = 1;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBlocks start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBlocks.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ // read count of blocks
+ int blocksCount = 0;
+ //MPI_File_read_at(file_handler, rank*sizeof(int), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, 0, &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ Block3d* block3dArray = new Block3d[blocksCount];
+
+ // calculate the read offset
+ MPI_Offset read_offset = (MPI_Offset)(size * sizeof(int));
+
+ GridParam* gridParameters = new GridParam;
+
+ // read parameters of the grid
+ MPI_File_read_at(file_handler, read_offset, gridParameters, 1, gridParamType, MPI_STATUS_IGNORE);
+ // read all the blocks
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+sizeof(GridParam)), &block3dArray[0], blocksCount, block3dType, MPI_STATUS_IGNORE);
+
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBlocks time: "<<finish-start<<" s");
+ }
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBlocks start of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ // clear the grid
+ std::vector<Block3DPtr> blocksVector;
+ grid->getBlocks(0, blocksVector);
+ int del = 0;
+ BOOST_FOREACH(Block3DPtr block, blocksVector)
+ {
+ grid->deleteBlock(block);
+ del++;
+ }
+
+ // restore the grid
+ CoordinateTransformation3DPtr trafo(new CoordinateTransformation3D());
+ trafo->Tx1 = gridParameters->trafoParams[0];
+ trafo->Tx2 = gridParameters->trafoParams[1];
+ trafo->Tx3 = gridParameters->trafoParams[2];
+ trafo->Sx1 = gridParameters->trafoParams[3];
+ trafo->Sx2 = gridParameters->trafoParams[4];
+ trafo->Sx3 = gridParameters->trafoParams[5];
+ trafo->alpha = gridParameters->trafoParams[6];
+ trafo->beta = gridParameters->trafoParams[7];
+ trafo->gamma = gridParameters->trafoParams[8];
+
+ trafo->toX1factorX1 = gridParameters->trafoParams[9];
+ trafo->toX1factorX2 = gridParameters->trafoParams[10];
+ trafo->toX1factorX3 = gridParameters->trafoParams[11];
+ trafo->toX1delta = gridParameters->trafoParams[12];
+ trafo->toX2factorX1 = gridParameters->trafoParams[13];
+ trafo->toX2factorX2 = gridParameters->trafoParams[14];
+ trafo->toX2factorX3 = gridParameters->trafoParams[15];
+ trafo->toX2delta = gridParameters->trafoParams[16];
+ trafo->toX3factorX1 = gridParameters->trafoParams[17];
+ trafo->toX3factorX2 = gridParameters->trafoParams[18];
+ trafo->toX3factorX3 = gridParameters->trafoParams[19];
+ trafo->toX3delta = gridParameters->trafoParams[20];
+
+ trafo->fromX1factorX1 = gridParameters->trafoParams[21];
+ trafo->fromX1factorX2 = gridParameters->trafoParams[22];
+ trafo->fromX1factorX3 = gridParameters->trafoParams[23];
+ trafo->fromX1delta = gridParameters->trafoParams[24];
+ trafo->fromX2factorX1 = gridParameters->trafoParams[25];
+ trafo->fromX2factorX2 = gridParameters->trafoParams[26];
+ trafo->fromX2factorX3 = gridParameters->trafoParams[27];
+ trafo->fromX2delta = gridParameters->trafoParams[28];
+ trafo->fromX3factorX1 = gridParameters->trafoParams[29];
+ trafo->fromX3factorX2 = gridParameters->trafoParams[30];
+ trafo->fromX3factorX3 = gridParameters->trafoParams[31];
+ trafo->fromX3delta = gridParameters->trafoParams[32];
+
+ trafo->active = gridParameters->active;
+ trafo->transformation = gridParameters->transformation;
+
+ grid->setCoordinateTransformator(trafo);
+
+ grid->setDeltaX(gridParameters->deltaX);
+ grid->setBlockNX(gridParameters->blockNx1, gridParameters->blockNx2, gridParameters->blockNx3);
+ grid->setNX1(gridParameters->nx1);
+ grid->setNX2(gridParameters->nx2);
+ grid->setNX3(gridParameters->nx3);
+ grid->setPeriodicX1(gridParameters->periodicX1);
+ grid->setPeriodicX2(gridParameters->periodicX2);
+ grid->setPeriodicX3(gridParameters->periodicX3);
+
+ // regenerate blocks
+ for (int n = 0; n<blocksCount; n++)
+ {
+ Block3DPtr block(new Block3D(block3dArray[n].x1, block3dArray[n].x2, block3dArray[n].x3, block3dArray[n].level));
+ block->setActive(block3dArray[n].active);
+ block->setBundle(block3dArray[n].bundle);
+ block->setRank(block3dArray[n].rank);
+ block->setLocalRank(block3dArray[n].lrank);
+ block->setGlobalID(block3dArray[n].globalID);
+ block->setLocalID(block3dArray[n].localID);
+ block->setPart(block3dArray[n].part);
+ block->setLevel(block3dArray[n].level);
+ block->interpolationFlagCF = block3dArray[n].interpolationFlagCF;
+ block->interpolationFlagFC = block3dArray[n].interpolationFlagFC;
+
+ grid->addBlock(block);
+ }
+
+ delete gridParameters;
+ delete[] block3dArray;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBlocks end of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+}
+
+void MPIIORestart11CoProcessor::readDataSet(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readDataSet start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ // read count of blocks
+ int blocksCount = 0;
+ MPI_File_read_at(file_handler, (MPI_Offset)(rank*sizeof(int)), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(size*sizeof(int)), &dataSetParamStr, 1, dataSetParamType, MPI_STATUS_IGNORE);
+ //std::cout <<"MPIIORestart11CoProcessor::readDataSet rank=" << rank <<", dataSetParamStr.doubleCountInBlock="<< dataSetParamStr.doubleCountInBlock << std::endl;
+ //std::cout << ",dataSetParamStr.nx[6][0]" << "=" << dataSetParamStr.nx[6][0] << "," << dataSetParamStr.nx[6][1] << "," << dataSetParamStr.nx[6][2] << "," << dataSetParamStr.nx[6][3];
+ //std::cout << ",doubleCountInBlock=" << dataSetParamStr.doubleCountInBlock << "," << dataSetParamStr.nx1 << "," << dataSetParamStr.nx2 << "," << dataSetParamStr.nx3 << std::endl;
+
+ DataSet* dataSetArray = new DataSet[blocksCount];
+ std::vector<double> doubleValuesArray(blocksCount * dataSetParamStr.doubleCountInBlock); // double-values in all blocks
+
+ // define MPI_types depending on the block-specific information
+ MPI_Type_contiguous(dataSetParamStr.doubleCountInBlock, MPI_DOUBLE, &dataSetDoubleType);
+ MPI_Type_commit(&dataSetDoubleType);
+ mpiTypeFreeFlag = true;
+ //std::cout << "MPIIORestart11CoProcessor::readDataSet rank=" << rank << " 123=" << dataSetParamStr.doubleCountInBlock << std::endl;
+
+ // calculate the read offset
+ MPI_Offset read_offset = (MPI_Offset)(size * sizeof(int));
+ size_t next_read_offset = 0;
+
+ if(size > 1)
+ {
+ if(rank == 0)
+ {
+ next_read_offset = read_offset + sizeof(dataSetParam) + blocksCount * (sizeof(DataSet) + dataSetParamStr.doubleCountInBlock * sizeof(double));
+ MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
+ }
+ else
+ {
+ MPI_Recv(&read_offset, 1, MPI_LONG_LONG_INT, rank - 1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ next_read_offset = read_offset + sizeof(dataSetParam) + blocksCount * (sizeof(DataSet) + dataSetParamStr.doubleCountInBlock * sizeof(double));
+ if(rank < size - 1)
+ MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, rank + 1, 5, MPI_COMM_WORLD);
+ }
+ }
+
+ /*int chunkFlag = 0;
+
+ if (rank == 0)
+ {
+ MPI_File_read_at(file_handler, read_offset, dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
+
+ for (int i=1; i<size; i+=chunk)
+ {
+ for (int j=i; j<i+chunk; j++)
+ {
+ if (j < size)
+ {
+ MPI_Send(&chunkFlag, 1, MPI_INT, j, 77, MPI_COMM_WORLD);
+ //UBLOG(logINFO, "j= "<<j);
+ }
+ }
+ for (int j=i; j<i+chunk; j++)
+ {
+ if (j < size)
+ {
+ MPI_Recv(&chunkFlag, 1, MPI_INT, j, 77, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ }
+ }
+ }
+ }
+ else
+ {
+ MPI_Recv(&chunkFlag, 1, MPI_INT, 0, 77, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, read_offset, dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
+ MPI_Send(&chunkFlag, 1, MPI_INT, 0, 77, MPI_COMM_WORLD);
+ //UBLOG(logINFO, "read rank= "<<rank);
+ }*/
+
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+sizeof(dataSetParam)), dataSetArray, blocksCount, dataSetType, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+sizeof(dataSetParam)+blocksCount*sizeof(DataSet)), &doubleValuesArray[0], blocksCount, dataSetDoubleType, MPI_STATUS_IGNORE);
+ MPI_File_close(&file_handler);
+
+ //for (int ch = 0; ch < blocksCount; ch++)
+ //{
+ // if ((dataSetArrayGW[ch].x1 != dataSetArray[ch].x1) ||
+ // (dataSetArrayGW[ch].x2 != dataSetArray[ch].x2) ||
+ // (dataSetArrayGW[ch].x3 != dataSetArray[ch].x3) ||
+ // (dataSetArrayGW[ch].level != dataSetArray[ch].level) ||
+ // (dataSetArrayGW[ch].ghostLayerWidth != dataSetArray[ch].ghostLayerWidth) ||
+ // (dataSetArrayGW[ch].collFactor != dataSetArray[ch].collFactor) ||
+ // (dataSetArrayGW[ch].deltaT != dataSetArray[ch].deltaT) ||
+ // (dataSetArrayGW[ch].compressible != dataSetArray[ch].compressible) ||
+ // (dataSetArrayGW[ch].withForcing != dataSetArray[ch].withForcing))
+ // std::cout << "dataSetArrayGW != rank" << rank << ", !!!!!====="<< std::endl;
+ //}
+ //std::cout << "doubleValuesArrayGW.size" << doubleValuesArrayGW.size() << ", " << doubleValuesArray.size() << std::endl;
+ //for (int vl = 0; vl < doubleValuesArrayGW.size(); vl++)
+ // if(doubleValuesArrayGW[vl] != doubleValuesArray[vl])
+ // std::cout << "doubleValuesArrayGW != rank" << rank << ", !!!!!====="<< std::endl;
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readDataSet time: "<<finish-start<<" s");
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readDataSet start of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ size_t index = 0, nextVectorSize = 0;
+ std::vector<double> vectorsOfValues[9];
+ for (int n = 0; n<blocksCount; n++)
+ {
+ for (int b = 0; b<9; b++) // assign approciate vectors for 9 dataSet arrays
+ {
+ nextVectorSize = dataSetParamStr.nx[b][0]* dataSetParamStr.nx[b][1]* dataSetParamStr.nx[b][2]* dataSetParamStr.nx[b][3];
+ vectorsOfValues[b].assign(doubleValuesArray.data()+index, doubleValuesArray.data()+index+nextVectorSize);
+ index += nextVectorSize;
+ }
+
+ // fill dataSet arrays
+ AverageValuesArray3DPtr mAverageDensity;
+ if ((dataSetParamStr.nx[0][0]==0)&&(dataSetParamStr.nx[0][1]==0)&&(dataSetParamStr.nx[0][2]==0)&&(dataSetParamStr.nx[0][3]==0))
+ mAverageDensity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageDensity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[0], dataSetParamStr.nx[0][0], dataSetParamStr.nx[0][1], dataSetParamStr.nx[0][2], dataSetParamStr.nx[0][3]));
+
+ AverageValuesArray3DPtr mAverageVelocity;
+ if ((dataSetParamStr.nx[1][0]==0)&&(dataSetParamStr.nx[1][1]==0)&&(dataSetParamStr.nx[1][2]==0)&&(dataSetParamStr.nx[1][3]==0))
+ mAverageVelocity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageVelocity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[1], dataSetParamStr.nx[1][0], dataSetParamStr.nx[1][1], dataSetParamStr.nx[1][2], dataSetParamStr.nx[1][3]));
+
+ AverageValuesArray3DPtr mAverageFluktuations;
+ if ((dataSetParamStr.nx[2][0]==0)&&(dataSetParamStr.nx[2][1]==0)&&(dataSetParamStr.nx[2][2]==0)&&(dataSetParamStr.nx[2][3]==0))
+ mAverageFluktuations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageFluktuations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[2], dataSetParamStr.nx[2][0], dataSetParamStr.nx[2][1], dataSetParamStr.nx[2][2], dataSetParamStr.nx[2][3]));
+
+ AverageValuesArray3DPtr mAverageTriplecorrelations;
+ if ((dataSetParamStr.nx[3][0]==0)&&(dataSetParamStr.nx[3][1]==0)&&(dataSetParamStr.nx[3][2]==0)&&(dataSetParamStr.nx[3][3]==0))
+ mAverageTriplecorrelations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageTriplecorrelations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[3], dataSetParamStr.nx[3][0], dataSetParamStr.nx[3][1], dataSetParamStr.nx[3][2], dataSetParamStr.nx[3][3]));
+
+ ShearStressValuesArray3DPtr mShearStressValues;
+ if ((dataSetParamStr.nx[4][0]==0)&&(dataSetParamStr.nx[4][1]==0)&&(dataSetParamStr.nx[4][2]==0)&&(dataSetParamStr.nx[4][3]==0))
+ mShearStressValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mShearStressValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[4], dataSetParamStr.nx[4][0], dataSetParamStr.nx[4][1], dataSetParamStr.nx[4][2], dataSetParamStr.nx[4][3]));
+
+ RelaxationFactorArray3DPtr mRelaxationFactor;
+ if ((dataSetParamStr.nx[5][0]==0)&&(dataSetParamStr.nx[5][1]==0)&&(dataSetParamStr.nx[5][2]==0))
+ mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr();
+ else
+ mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[5], dataSetParamStr.nx[5][0], dataSetParamStr.nx[5][1], dataSetParamStr.nx[5][2]));
+
+ //DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector(dataSetParamStr.nx1, dataSetParamStr.nx2, dataSetParamStr.nx3, -999.0));
+ DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector());
+
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[6], dataSetParamStr.nx[6][0], dataSetParamStr.nx[6][1], dataSetParamStr.nx[6][2], dataSetParamStr.nx[6][3])));
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNonLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[7], dataSetParamStr.nx[7][0], dataSetParamStr.nx[7][1], dataSetParamStr.nx[7][2], dataSetParamStr.nx[7][3])));
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setZeroDistributions(CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[8], dataSetParamStr.nx[8][0], dataSetParamStr.nx[8][1], dataSetParamStr.nx[8][2])));
+
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX1(dataSetParamStr.nx1);
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX2(dataSetParamStr.nx2);
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX3(dataSetParamStr.nx3);
+
+ DataSet3DPtr dataSetPtr = DataSet3DPtr(new DataSet3D());
+ dataSetPtr->setAverageDencity(mAverageDensity);
+ dataSetPtr->setAverageVelocity(mAverageVelocity);
+ dataSetPtr->setAverageFluctuations(mAverageFluktuations);
+ dataSetPtr->setAverageTriplecorrelations(mAverageTriplecorrelations);
+ dataSetPtr->setShearStressValues(mShearStressValues);
+ dataSetPtr->setRelaxationFactor(mRelaxationFactor);
+ dataSetPtr->setFdistributions(mFdistributions);
+
+ // find the nesessary block and fill it
+ Block3DPtr block = grid->getBlock(dataSetArray[n].x1, dataSetArray[n].x2, dataSetArray[n].x3, dataSetArray[n].level);
+ //LBMKernelPtr kernel(new CompressibleCumulantLBMKernel());
+ //LBMKernelPtr kernel(new IncompressibleCumulantLBMKernel());
+ LBMKernelPtr kernel = this->lbmKernel->clone();
+ kernel->setGhostLayerWidth(dataSetArray[n].ghostLayerWidth);
+ kernel->setCollisionFactor(dataSetArray[n].collFactor);
+ kernel->setDeltaT(dataSetArray[n].deltaT);
+ kernel->setCompressible(dataSetArray[n].compressible);
+ kernel->setWithForcing(dataSetArray[n].withForcing);
+ kernel->setDataSet(dataSetPtr);
+ block->setKernel(kernel);
+ //block->getKernel()->setDataSet(dataSetPtr);
+ }
+
+ delete[] dataSetArray;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestartCoProcessor::readDataSet end of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+}
+
+void MPIIORestart11CoProcessor::readBoundaryConds(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBoundaryConds start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBC.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ int blocksCount = 0;
+ int dataCount1000 = 0;
+ int dataCount2 = 0;
+ MPI_Offset read_offset1 = (MPI_Offset)(rank * (3 * sizeof(int) + sizeof(boundCondParam)));
+
+ // read count of blocks
+ MPI_File_read_at(file_handler, read_offset1, &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // read count of big BoundaryCondition blocks
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset1+sizeof(int)), &dataCount1000, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // read count of indexContainer values in all blocks
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset1+2*sizeof(int)), &dataCount2, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // read count of bcindexmatrix values in every block
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset1+3*sizeof(int)), &boundCondParamStr, 1, boundCondParamType, MPI_STATUS_IGNORE);
+
+ //std::cout << "rank=" << rank << ",(rank*read_offset1)=" << rank*read_offset1 << ",blocksCount=" << blocksCount;
+ //std::cout << ", " << rank*read_offset1 + sizeof(int) << ",bcBlockCount=" << dataCount1000;
+ //std::cout << ", " << rank*read_offset1 + 2 * sizeof(int) << ",count_indexContainer=" << dataCount2;
+ //std::cout << ", " << rank*read_offset1 + 3 * sizeof(int) << ",boundCondParamStr=" << boundCondParamStr.bcindexmatrixCount << std::endl;
+ //std::cout << "readrank=" << rank << ",blocksCount=" << blocksCount << ", " << dataCount1000 << ", " << dataCount2 << ", " << boundCondParamStr.bcindexmatrixCount << std::endl;
+
+ MPI_Type_contiguous(boundCondParamStr.bcindexmatrixCount, MPI_INT, &bcindexmatrixType);
+ MPI_Type_commit(&bcindexmatrixType);
+ mpiTypeFreeFlag = true;
+
+ size_t dataCount = dataCount1000 * BLOCK_SIZE;
+ BCAdd* bcAddArray = new BCAdd[blocksCount];
+ BoundaryCondition* bcArray = new BoundaryCondition[dataCount];
+ BoundaryCondition* nullBouCond = new BoundaryCondition();
+ memset(nullBouCond, 0, sizeof(BoundaryCondition));
+ int* intArray1 = new int[blocksCount * boundCondParamStr.bcindexmatrixCount];
+ int* intArray2 = new int[dataCount2];
+
+ MPI_Offset read_offset = (MPI_Offset)(size * (3 * sizeof(int) + sizeof(boundCondParam)));
+ size_t next_read_offset = 0;
+
+ if (size>1)
+ {
+ if (rank==0)
+ {
+ next_read_offset = read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)+(blocksCount * boundCondParamStr.bcindexmatrixCount + dataCount2)*sizeof(int);
+ MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
+ }
+ else
+ {
+ MPI_Recv(&read_offset, 1, MPI_LONG_LONG_INT, rank-1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ next_read_offset = read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)+(blocksCount * boundCondParamStr.bcindexmatrixCount + dataCount2)*sizeof(int);
+ if (rank<size-1)
+ MPI_Send(&next_read_offset, 1, MPI_LONG_LONG_INT, rank+1, 5, MPI_COMM_WORLD);
+ }
+ }
+ //std::cout << "readrank=" << rank << ",read_offset=" << read_offset << ", " << read_offset + blocksCount * sizeof(BCAdd) << ", " << read_offset + blocksCount * sizeof(BCAdd) + dataCount * sizeof(BoundaryCondition) << ", " << read_offset + blocksCount * sizeof(BCAdd) + dataCount * sizeof(BoundaryCondition) + blocksCount * bcindexmatrixCount * sizeof(int) << std::endl;
+
+ MPI_File_read_at(file_handler, read_offset, bcAddArray, blocksCount, boundCondTypeAdd, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(BCAdd)), &bcArray[0], dataCount1000, boundCondType1000, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)), &intArray1[0], blocksCount, bcindexmatrixType, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+blocksCount*sizeof(BCAdd)+dataCount*sizeof(BoundaryCondition)+blocksCount * boundCondParamStr.bcindexmatrixCount*sizeof(int)), &intArray2[0], dataCount2, MPI_INT, MPI_STATUS_IGNORE);
+ //MPI_File_sync(file_handler);
+
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBoundaryConds time: "<<finish-start<<" s");
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBoundaryConds start of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ int index = 0, index1 = 0, index2 = 0;
+ std::vector<BoundaryConditionsPtr> bcVector;
+ std::vector<int> bcindexmatrixV;
+ std::vector<int> indexContainerV;
+
+ for (size_t n = 0; n<blocksCount; n++)
+ {
+ bcVector.resize(0);
+ bcindexmatrixV.resize(0);
+ indexContainerV.resize(0);
+
+ for (size_t ibc = 0; ibc<bcAddArray[n].boundCond_count; ibc++)
+ {
+ BoundaryConditionsPtr bc;
+ if (memcmp(&bcArray[index], nullBouCond, sizeof(BoundaryCondition))==0)
+ bc = BoundaryConditionsPtr();
+ else
+ {
+ bc = BoundaryConditionsPtr(new BoundaryConditions);
+ bc->noslipBoundaryFlags = bcArray[index].noslipBoundaryFlags;
+ bc->slipBoundaryFlags = bcArray[index].slipBoundaryFlags;
+ bc->densityBoundaryFlags = bcArray[index].densityBoundaryFlags;
+ bc->velocityBoundaryFlags = bcArray[index].velocityBoundaryFlags;
+ bc->wallModelBoundaryFlags = bcArray[index].wallModelBoundaryFlags;
+ bc->bcVelocityX1 = bcArray[index].bcVelocityX1;
+ bc->bcVelocityX2 = bcArray[index].bcVelocityX2;
+ bc->bcVelocityX3 = bcArray[index].bcVelocityX3;
+ bc->bcDensity = bcArray[index].bcDensity;
+ bc->bcLodiDensity = bcArray[index].bcLodiDensity;
+ bc->bcLodiVelocityX1 = bcArray[index].bcLodiVelocityX1;
+ bc->bcLodiVelocityX2 = bcArray[index].bcLodiVelocityX2;
+ bc->bcLodiVelocityX3 = bcArray[index].bcLodiVelocityX3;
+ bc->bcLodiLentgh = bcArray[index].bcLodiLentgh;
+
+ bc->nx1 = bcArray[index].nx1;
+ bc->nx2 = bcArray[index].nx2;
+ bc->nx3 = bcArray[index].nx3;
+ for (int iq = 0; iq<26; iq++)
+ bc->setQ(bcArray[index].q[iq], iq);
+ bc->setBcAlgorithmType(bcArray[index].algorithmType);
+
+ //if (bcVectorGW[index].nx1 != bc->nx1)
+ // std::cout << "readBoundaryConds nx1 !!!!===" << bcVectorGW[index].nx1 << " ---- " << bc->nx1 << std::endl;
+ //if (bcVectorGW[index].nx2 != bc->nx2)
+ // std::cout << "readBoundaryConds nx2 !!!!===" << bcVectorGW[index].nx2 << " ---- " << bc->nx2 << std::endl;
+ //if (bcVectorGW[index].nx3 != bc->nx3)
+ // std::cout << "readBoundaryConds nx3 !!!!===" << bcVectorGW[index].nx3 << " ---- " << bc->nx3 << std::endl;
+ //if (bcVectorGW[index].algorithmType != bc->algorithmType)
+ // std::cout << "readBoundaryConds algorithmType !!!!===" << bcVectorGW[index].algorithmType << " ---- " << bc->algorithmType << std::endl;
+ //for (int iq = 0; iq<26; iq++)
+ // if (bcVectorGW[index].q[iq] != bc->q[iq])
+ // std::cout << "readBoundaryConds q !!!!===" /*<< bcVectorGW[index].q << " ---- " << bc->q*/ << std::endl;
+ //std::cout << "readBoundaryConds BoundaryConditionsPtr !!!!===" <<std::endl;
+
+ }
+
+ bcVector.push_back(bc);
+ index++;
+ }
+
+ for (int b1 = 0; b1 < boundCondParamStr.bcindexmatrixCount; b1++)
+ {
+ //if (bcindexmatrixVGW[index1] != intArray1[index1])
+ // std::cout << "readBoundaryConds bcindexmatrixVGW !!!!===" << std::endl;
+ bcindexmatrixV.push_back(intArray1[index1++]);
+ }
+ for (int b2 = 0; b2 < bcAddArray[n].indexContainer_count; b2++)
+ {
+ //if (indexContainerVGW[index2] != intArray2[index2])
+ // std::cout << "readBoundaryConds indexContainerVGW !!!!===" << std::endl;
+ indexContainerV.push_back(intArray2[index2++]);
+ }
+
+ CbArray3D<int, IndexerX3X2X1> bcim(bcindexmatrixV, boundCondParamStr.nx1, boundCondParamStr.nx2, boundCondParamStr.nx3);
+
+ Block3DPtr block = grid->getBlock(bcAddArray[n].x1, bcAddArray[n].x2, bcAddArray[n].x3, bcAddArray[n].level);
+ //if(!block) std::cout << "readBoundaryConds can't find the block!!!" << std::endl;
+ BCProcessorPtr bcProc = bcProcessor->clone(block->getKernel());
+ //if(!bcProc) std::cout << "readBoundaryConds can't find the bcProc!!!" << std::endl;
+ BCArray3DPtr bcArr(new BCArray3D());
+ bcArr->bcindexmatrix = bcim;
+ bcArr->bcvector = bcVector;
+ bcArr->indexContainer = indexContainerV;
+ bcProc->setBCArray(bcArr);
+
+ //if (!(block->getKernel()))
+ // std::cout << "readBoundaryConds kernel=" << block->getKernel() <<" "<< bcAddArray[n].x1 << " " << bcAddArray[n].x2 << " " << bcAddArray[n].x3 << std::endl;
+ block->getKernel()->setBCProcessor(bcProc);
+ }
+
+ delete nullBouCond;
+ delete[] bcArray;
+ delete[] bcAddArray;
+ delete[] intArray1;
+ delete[] intArray2;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart11CoProcessor::readBoundaryConds end of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart11CoProcessor::setChunk(int val)
+{
+ chunk = val;
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart11CoProcessor::setLBMKernel(LBMKernelPtr kernel)
+{
+ this->lbmKernel = kernel;
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart11CoProcessor::setBCProcessor(BCProcessorPtr bcProcessor)
+{
+ this->bcProcessor = bcProcessor;
+}
+
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestartCoProcessor.h b/source/VirtualFluidsCore/CoProcessors/MPIIORestart11CoProcessor.h
similarity index 73%
rename from source/VirtualFluidsCore/CoProcessors/MPIIORestartCoProcessor.h
rename to source/VirtualFluidsCore/CoProcessors/MPIIORestart11CoProcessor.h
index c9c9e28e9..56ea4d9a5 100644
--- a/source/VirtualFluidsCore/CoProcessors/MPIIORestartCoProcessor.h
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart11CoProcessor.h
@@ -1,187 +1,193 @@
-#ifndef _MPIIORestartCoProcessor_H_
-#define _MPIIORestartCoProcessor_H_
-
-#include "mpi.h"
-
-#include "CoProcessor.h"
-#include "Communicator.h"
-#include "WbWriter.h"
-
-#include <boost/shared_ptr.hpp>
-
-class MPIIORestartCoProcessor;
-typedef boost::shared_ptr<MPIIORestartCoProcessor> MPIIORestartCoProcessorPtr;
-
-//! \class MPIWriteBlocksCoProcessor
-//! \brief Writes the grid each timestep into the files and reads the grip from the files before regenerating
-class MPIIORestartCoProcessor: public CoProcessor
-{
- //! \struct GridParam
- //! \brief Structure describes parameters of the grid
- //! \details The structure is nessasary to restore the grid correctly
- struct GridParam
- {
- double trafoParams[33];
- double deltaX;
- int blockNx1;
- int blockNx2;
- int blockNx3;
- int nx1;
- int nx2;
- int nx3;
- bool periodicX1;
- bool periodicX2;
- bool periodicX3;
- bool active;
- bool transformation;
- };
-
- //! \struct blockParam
- //! \brief Structure describes parameters of the block that are equal in all blocks
- //! \details The structure used to store some parameters needed to restore dataSet arrays
- struct BlockParam
- {
- int nx1; // to find the right block
- int nx2;
- int nx3;
- int nx[9][4]; // 9 arrays x (nx1, nx2, nx3, nx4)
- int doubleCountInBlock; // how many double-values are in all arrays dataSet in one (any) block
- int bcindexmatrix_count; // how many bcindexmatrix-values are in one (any) block
- };
-
- //! \struct Block3d
- //! \brief Structure contains information of the block
- //! \details The structure is used to write the data describing the block in the grid when saving the grid
- //! and to read it when restoring the grid
- struct Block3d
- {
- //double collFactor;
- //double deltaT;
- int x1;
- int x2;
- int x3;
- int bundle;
- int rank;
- int lrank;
- int part;
- int globalID;
- int localID;
- int level;
- int interpolationFlagCF;
- int interpolationFlagFC;
- int counter;
- //int ghostLayerWidth;
- bool active;
- //bool compressible;
- //bool withForcing;
- };
-
- //! \struct dataSet
- //! \brief Structure containes information identifying the block
- //! \details The structure is used to find the needed block in the grid when restoring a dataSet
- struct DataSet
- {
- double collFactor;
- double deltaT;
- int x1;
- int x2;
- int x3;
- int level;
- int ghostLayerWidth;
- bool compressible;
- bool withForcing;
- };
-
- //! \struct BoundaryCondition
- //! \brief Structure containes information about boundary conditions of the block
- //! \details The structure is used to write data describing boundary conditions of the blocks when saving the grid
- //! and to read it when restoring the grid
- struct BoundaryCondition
- {
- long long noslipBoundaryFlags; // MPI_LONG_LONG
- long long slipBoundaryFlags;
- long long velocityBoundaryFlags;
- long long densityBoundaryFlags;
- long long wallModelBoundaryFlags;
-
- float bcVelocityX1;
- float bcVelocityX2;
- float bcVelocityX3;
- float bcDensity;
-
- float bcLodiDensity;
- float bcLodiVelocityX1;
- float bcLodiVelocityX2;
- float bcLodiVelocityX3;
- float bcLodiLentgh;
-
- float nx1,nx2,nx3;
- float q[26]; // MPI_FLOAT
-
- char algorithmType;
- };
-
- //! \struct BCAdd
- //! \brief Structure containes information identifying the block
- //! and some parameters of the arrays of boundary conditions that are equal in all blocks
- //! \details The structure is used to find the needed block in the grid when restoring a dataSet
- //! and to set common parameters
- struct BCAdd
- {
- int x1; // to find the right block
- int x2;
- int x3;
- int level;
- int boundCond_count; // how many BoundaryCondition-structures are in this block
- int indexContainer_count; // how many indexContainer-values are in this block
- };
-
-public:
- MPIIORestartCoProcessor(Grid3DPtr grid, UbSchedulerPtr s, const std::string& path, CommunicatorPtr comm);
- virtual ~MPIIORestartCoProcessor();
- //! Each timestep writes the grid into the files
- void process(double step);
- //! Reads the grid from the files before grid reconstruction
- void restart(int step);
- //! Writes the blocks of the grid into the file outputBlocks.bin
- void writeBlocks(int step);
- //! Writes the datasets of the blocks into the file outputDataSet.bin
- void writeDataSet(int step);
- //! Writes the boundary conditions of the blocks into the file outputBoundCond.bin
- void writeBoundaryConds(int step);
- //! Reads the blocks of the grid from the file outputBlocks.bin
- void readBlocks(int step);
- //! Reads the datasets of the blocks from the file outputDataSet.bin
- void readDataSet(int step);
- //! Reads the boundary conditions of the blocks from the file outputBoundCond.bin
- void readBoundaryConds(int step);
- //! The function sets number of ranks that read simultaneously
- void setChunk(int val);
- //! The function sets LBMKernel
- void setLBMKernel(LBMKernelPtr kernel);
- //!The function sets BCProcessor
- void setBCProcessor(BCProcessorPtr bcProcessor);
- //!The function truncates the data files
- void clearAllFiles(int step);
-
-protected:
- std::string path;
- CommunicatorPtr comm;
- bool mpiTypeFreeFlag;
-
-private:
- MPI_Datatype gridParamType, blockParamType, block3dType, dataSetType, dataSetDoubleType, boundCondType, boundCondType1000, boundCondTypeAdd, bcindexmatrixType;
- BlockParam blockParamStr;
- int chunk;
- LBMKernelPtr lbmKernel;
- BCProcessorPtr bcProcessor;
-
- //DataSet dataSetArrayGW[32];
- //std::vector<double> doubleValuesArrayGW;
- //std::vector<BoundaryCondition> bcVectorGW;
- //std::vector<int> bcindexmatrixVGW;
- //std::vector<int> indexContainerVGW;
-
-};
-
-#endif
+#ifndef _MPIIORestart11CoProcessor_H_
+#define _MPIIORestart11CoProcessor_H_
+
+#include "mpi.h"
+
+#include "CoProcessor.h"
+#include "Communicator.h"
+#include "WbWriter.h"
+
+#include <boost/shared_ptr.hpp>
+
+class MPIIORestart11CoProcessor;
+typedef boost::shared_ptr<MPIIORestart11CoProcessor> MPIIORestart11CoProcessorPtr;
+
+//! \class MPIWriteBlocksCoProcessor
+//! \brief Writes the grid each timestep into the files and reads the grip from the files before regenerating
+class MPIIORestart11CoProcessor: public CoProcessor
+{
+ //! \struct GridParam
+ //! \brief Structure describes parameters of the grid
+ //! \details The structure is nessasary to restore the grid correctly
+ struct GridParam
+ {
+ double trafoParams[33];
+ double deltaX;
+ int blockNx1;
+ int blockNx2;
+ int blockNx3;
+ int nx1;
+ int nx2;
+ int nx3;
+ bool periodicX1;
+ bool periodicX2;
+ bool periodicX3;
+ bool active;
+ bool transformation;
+ };
+
+ //! \struct Block3d
+ //! \brief Structure contains information of the block
+ //! \details The structure is used to write the data describing the block in the grid when saving the grid
+ //! and to read it when restoring the grid
+ struct Block3d
+ {
+ int x1;
+ int x2;
+ int x3;
+ int bundle;
+ int rank;
+ int lrank;
+ int part;
+ int globalID;
+ int localID;
+ int level;
+ int interpolationFlagCF;
+ int interpolationFlagFC;
+ int counter;
+ bool active;
+ };
+
+ //! \struct dataSetParam
+ //! \brief Structure describes parameters of the dataSet that are equal in all blocks
+ //! \details The structure used to store some parameters needed to restore dataSet arrays
+ struct dataSetParam
+ {
+ int nx1; // to find the right block
+ int nx2;
+ int nx3;
+ int nx[9][4]; // 9 arrays x (nx1, nx2, nx3, nx4)
+ int doubleCountInBlock; // how many double-values are in all arrays dataSet in one (any) block
+ };
+
+ //! \struct dataSet
+ //! \brief Structure containes information identifying the block
+ //! \details The structure is used to find the needed block in the grid when restoring a dataSet
+ struct DataSet
+ {
+ double collFactor;
+ double deltaT;
+ int x1;
+ int x2;
+ int x3;
+ int level;
+ int ghostLayerWidth;
+ bool compressible;
+ bool withForcing;
+ };
+
+ //! \struct BoundaryCondition
+ //! \brief Structure containes information about boundary conditions of the block
+ //! \details The structure is used to write data describing boundary conditions of the blocks when saving the grid
+ //! and to read it when restoring the grid
+ struct BoundaryCondition
+ {
+ long long noslipBoundaryFlags; // MPI_LONG_LONG
+ long long slipBoundaryFlags;
+ long long velocityBoundaryFlags;
+ long long densityBoundaryFlags;
+ long long wallModelBoundaryFlags;
+
+ float bcVelocityX1;
+ float bcVelocityX2;
+ float bcVelocityX3;
+ float bcDensity;
+
+ float bcLodiDensity;
+ float bcLodiVelocityX1;
+ float bcLodiVelocityX2;
+ float bcLodiVelocityX3;
+ float bcLodiLentgh;
+
+ float nx1,nx2,nx3;
+ float q[26]; // MPI_FLOAT
+
+ char algorithmType;
+ };
+
+ //! \struct boundCondParam
+ //! \brief Structure describes parameters of the boundaryConditions that are equal in all blocks
+ //! \details The structure used to store some parameters needed to restore boundaryConditions arrays
+ struct boundCondParam
+ {
+ int nx1;
+ int nx2;
+ int nx3;
+ int bcindexmatrixCount; // how many bcindexmatrix-values in one (any) block
+ };
+
+ //! \struct BCAdd
+ //! \brief Structure containes information identifying the block
+ //! and some parameters of the arrays of boundary conditions that are equal in all blocks
+ //! \details The structure is used to find the needed block in the grid when restoring a dataSet
+ //! and to set common parameters
+ struct BCAdd
+ {
+ int x1; // to find the right block
+ int x2;
+ int x3;
+ int level;
+ int boundCond_count; // how many BoundaryCondition-structures are in this block
+ int indexContainer_count; // how many indexContainer-values are in this block
+ };
+
+public:
+ MPIIORestart11CoProcessor(Grid3DPtr grid, UbSchedulerPtr s, const std::string& path, CommunicatorPtr comm);
+ virtual ~MPIIORestart11CoProcessor();
+ //! Each timestep writes the grid into the files
+ void process(double step);
+ //! Reads the grid from the files before grid reconstruction
+ void restart(int step);
+ //! Writes the blocks of the grid into the file outputBlocks.bin
+ void writeBlocks(int step);
+ //! Writes the datasets of the blocks into the file outputDataSet.bin
+ void writeDataSet(int step);
+ //! Writes the boundary conditions of the blocks into the file outputBoundCond.bin
+ void writeBoundaryConds(int step);
+ //! Reads the blocks of the grid from the file outputBlocks.bin
+ void readBlocks(int step);
+ //! Reads the datasets of the blocks from the file outputDataSet.bin
+ void readDataSet(int step);
+ //! Reads the boundary conditions of the blocks from the file outputBoundCond.bin
+ void readBoundaryConds(int step);
+ //! The function sets number of ranks that read simultaneously
+ void setChunk(int val);
+ //! The function sets LBMKernel
+ void setLBMKernel(LBMKernelPtr kernel);
+ //!The function sets BCProcessor
+ void setBCProcessor(BCProcessorPtr bcProcessor);
+ //!The function truncates the data files
+ void clearAllFiles(int step);
+
+protected:
+ std::string path;
+ CommunicatorPtr comm;
+ bool mpiTypeFreeFlag;
+
+private:
+ MPI_Datatype gridParamType, block3dType, dataSetParamType, dataSetType, dataSetDoubleType, boundCondParamType, boundCondType, boundCondType1000, boundCondTypeAdd, bcindexmatrixType;
+ dataSetParam dataSetParamStr;
+ boundCondParam boundCondParamStr;
+ int chunk;
+ LBMKernelPtr lbmKernel;
+ BCProcessorPtr bcProcessor;
+
+ /*DataSet dataSetArrayGW[128];
+ std::vector<double> doubleValuesArrayGW;
+ std::vector<BoundaryCondition> bcVectorGW;
+ std::vector<int> bcindexmatrixVGW;
+ std::vector<int> indexContainerVGW;*/
+
+};
+
+#endif
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestart3CoProcessor.cpp b/source/VirtualFluidsCore/CoProcessors/MPIIORestart1CoProcessor.cpp
similarity index 97%
rename from source/VirtualFluidsCore/CoProcessors/MPIIORestart3CoProcessor.cpp
rename to source/VirtualFluidsCore/CoProcessors/MPIIORestart1CoProcessor.cpp
index 3c71c83fe..dfdfeaa68 100644
--- a/source/VirtualFluidsCore/CoProcessors/MPIIORestart3CoProcessor.cpp
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart1CoProcessor.cpp
@@ -1,4 +1,4 @@
-#include "MPIIORestart3CoProcessor.h"
+#include "MPIIORestart1CoProcessor.h"
#include <boost/foreach.hpp>
#include "D3Q27System.h"
//#include "LBMKernel.h"
@@ -14,7 +14,7 @@
//! structures BoundaryCondition are being written in blocks containing each of them BLOCK_SIZE structures
#define BLOCK_SIZE 1024
-MPIIORestart3CoProcessor::MPIIORestart3CoProcessor(Grid3DPtr grid, UbSchedulerPtr s,
+MPIIORestart1CoProcessor::MPIIORestart1CoProcessor(Grid3DPtr grid, UbSchedulerPtr s,
const std::string& path,
CommunicatorPtr comm) :
CoProcessor(grid, s),
@@ -103,7 +103,7 @@ MPIIORestart3CoProcessor::MPIIORestart3CoProcessor(Grid3DPtr grid, UbSchedulerPt
}
//////////////////////////////////////////////////////////////////////////
-MPIIORestart3CoProcessor::~MPIIORestart3CoProcessor()
+MPIIORestart1CoProcessor::~MPIIORestart1CoProcessor()
{
MPI_Type_free(&gridParamType);
MPI_Type_free(&blockParamType);
@@ -121,7 +121,7 @@ MPIIORestart3CoProcessor::~MPIIORestart3CoProcessor()
}
//////////////////////////////////////////////////////////////////////////
-void MPIIORestart3CoProcessor::process(double step)
+void MPIIORestart1CoProcessor::process(double step)
{
if (scheduler->isDue(step))
{
@@ -137,7 +137,7 @@ void MPIIORestart3CoProcessor::process(double step)
}
}
//////////////////////////////////////////////////////////////////////////
-void MPIIORestart3CoProcessor::clearAllFiles(int step)
+void MPIIORestart1CoProcessor::clearAllFiles(int step)
{
MPI_File file_handler1, file_handler2, file_handler3;
MPI_Info info = MPI_INFO_NULL;
@@ -169,7 +169,7 @@ void MPIIORestart3CoProcessor::clearAllFiles(int step)
MPI_File_close(&file_handler3);
}
//////////////////////////////////////////////////////////////////////////
-void MPIIORestart3CoProcessor::writeBlocks(int step)
+void MPIIORestart1CoProcessor::writeBlocks(int step)
{
int rank, size;
MPI_Comm_rank(MPI_COMM_WORLD, &rank);
@@ -446,7 +446,7 @@ void MPIIORestart3CoProcessor::writeBlocks(int step)
delete gridParameters;
}
-void MPIIORestart3CoProcessor::writeDataSet(int step)
+void MPIIORestart1CoProcessor::writeDataSet(int step)
{
int rank, size;
MPI_Comm_rank(MPI_COMM_WORLD, &rank);
@@ -624,7 +624,7 @@ void MPIIORestart3CoProcessor::writeDataSet(int step)
delete[] dataSetArray;
}
-void MPIIORestart3CoProcessor::writeBoundaryConds(int step)
+void MPIIORestart1CoProcessor::writeBoundaryConds(int step)
{
int rank, size;
MPI_Comm_rank(MPI_COMM_WORLD, &rank);
@@ -811,7 +811,7 @@ void MPIIORestart3CoProcessor::writeBoundaryConds(int step)
}
//------------------------------------------- READ -----------------------------------------------
-void MPIIORestart3CoProcessor::restart(int step)
+void MPIIORestart1CoProcessor::restart(int step)
{
if (comm->isRoot()) UBLOG(logINFO, "MPIIORestart3CoProcessor restart step: "<<step);
if (comm->isRoot()) UBLOG(logINFO, "Load check point - start");
@@ -822,7 +822,7 @@ void MPIIORestart3CoProcessor::restart(int step)
this->reconnect(grid);
}
-void MPIIORestart3CoProcessor::readBlocks(int step)
+void MPIIORestart1CoProcessor::readBlocks(int step)
{
int rank, size;
MPI_Comm_rank(MPI_COMM_WORLD, &rank);
@@ -974,7 +974,7 @@ void MPIIORestart3CoProcessor::readBlocks(int step)
}
}
-void MPIIORestart3CoProcessor::readDataSet(int step)
+void MPIIORestart1CoProcessor::readDataSet(int step)
{
int rank, size;
MPI_Comm_rank(MPI_COMM_WORLD, &rank);
@@ -1132,7 +1132,8 @@ void MPIIORestart3CoProcessor::readDataSet(int step)
else
mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[5], blockParamStr.nx[5][0], blockParamStr.nx[5][1], blockParamStr.nx[5][2]));
- DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector(blockParamStr.nx1, blockParamStr.nx2, blockParamStr.nx3, -999.0));
+ //DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector(blockParamStr.nx1, blockParamStr.nx2, blockParamStr.nx3, -999.0));
+ DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector());
boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[6], blockParamStr.nx[6][0], blockParamStr.nx[6][1], blockParamStr.nx[6][2], blockParamStr.nx[6][3])));
boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNonLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[7], blockParamStr.nx[7][0], blockParamStr.nx[7][1], blockParamStr.nx[7][2], blockParamStr.nx[7][3])));
@@ -1175,7 +1176,7 @@ void MPIIORestart3CoProcessor::readDataSet(int step)
}
}
-void MPIIORestart3CoProcessor::readBoundaryConds(int step)
+void MPIIORestart1CoProcessor::readBoundaryConds(int step)
{
int rank, size;
MPI_Comm_rank(MPI_COMM_WORLD, &rank);
@@ -1309,14 +1310,26 @@ void MPIIORestart3CoProcessor::readBoundaryConds(int step)
CbArray3D<int, IndexerX3X2X1> bcim(bcindexmatrixV, blockParamStr.nx1, blockParamStr.nx2, blockParamStr.nx3);
Block3DPtr block = grid->getBlock(bcAddArray[n].x1, bcAddArray[n].x2, bcAddArray[n].x3, bcAddArray[n].level);
- BCProcessorPtr bcProc = bcProcessor->clone(block->getKernel());
+
+ LBMKernelPtr kernel = block->getKernel();
+
+ if (!kernel)
+ {
+ throw UbException(UB_EXARGS, "LBMKernel in " + block->toString() + "is not exist!");
+ }
+
+ //BCProcessorPtr bcProc = bcProcessor->clone(block->getKernel());
+ BCProcessorPtr bcProc = bcProcessor->clone(kernel);
+
BCArray3DPtr bcArr(new BCArray3D());
bcArr->bcindexmatrix = bcim;
bcArr->bcvector = bcVector;
bcArr->indexContainer = indexContainerV;
bcProc->setBCArray(bcArr);
- block->getKernel()->setBCProcessor(bcProc);
+
+ //block->getKernel()->setBCProcessor(bcProc);
+ kernel->setBCProcessor(bcProc);
}
/* for (int b1 = 0; b1 < bcindexmatrixVGW.size(); b1++)
@@ -1343,17 +1356,17 @@ void MPIIORestart3CoProcessor::readBoundaryConds(int step)
}
}
//////////////////////////////////////////////////////////////////////////
-void MPIIORestart3CoProcessor::setChunk(int val)
+void MPIIORestart1CoProcessor::setChunk(int val)
{
chunk = val;
}
//////////////////////////////////////////////////////////////////////////
-void MPIIORestart3CoProcessor::setLBMKernel(LBMKernelPtr kernel)
+void MPIIORestart1CoProcessor::setLBMKernel(LBMKernelPtr kernel)
{
this->lbmKernel = kernel;
}
//////////////////////////////////////////////////////////////////////////
-void MPIIORestart3CoProcessor::setBCProcessor(BCProcessorPtr bcProcessor)
+void MPIIORestart1CoProcessor::setBCProcessor(BCProcessorPtr bcProcessor)
{
this->bcProcessor = bcProcessor;
}
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestart3CoProcessor.h b/source/VirtualFluidsCore/CoProcessors/MPIIORestart1CoProcessor.h
similarity index 95%
rename from source/VirtualFluidsCore/CoProcessors/MPIIORestart3CoProcessor.h
rename to source/VirtualFluidsCore/CoProcessors/MPIIORestart1CoProcessor.h
index 7653fc0c8..5dcd74214 100644
--- a/source/VirtualFluidsCore/CoProcessors/MPIIORestart3CoProcessor.h
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart1CoProcessor.h
@@ -9,12 +9,12 @@
#include <boost/shared_ptr.hpp>
-class MPIIORestart3CoProcessor;
-typedef boost::shared_ptr<MPIIORestart3CoProcessor> MPIIORestart3CoProcessorPtr;
+class MPIIORestart1CoProcessor;
+typedef boost::shared_ptr<MPIIORestart1CoProcessor> MPIIORestart1CoProcessorPtr;
//! \class MPIWriteBlocksCoProcessor
//! \brief Writes the grid each timestep into the files and reads the grip from the files before regenerating
-class MPIIORestart3CoProcessor: public CoProcessor
+class MPIIORestart1CoProcessor: public CoProcessor
{
//! \struct GridParam
//! \brief Structure describes parameters of the grid
@@ -137,8 +137,8 @@ class MPIIORestart3CoProcessor: public CoProcessor
};
public:
- MPIIORestart3CoProcessor(Grid3DPtr grid, UbSchedulerPtr s, const std::string& path, CommunicatorPtr comm);
- virtual ~MPIIORestart3CoProcessor();
+ MPIIORestart1CoProcessor(Grid3DPtr grid, UbSchedulerPtr s, const std::string& path, CommunicatorPtr comm);
+ virtual ~MPIIORestart1CoProcessor();
//! Each timestep writes the grid into the files
void process(double step);
//! Reads the grid from the files before grid reconstruction
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.cpp b/source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.cpp
new file mode 100644
index 000000000..4ecd193eb
--- /dev/null
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.cpp
@@ -0,0 +1,1225 @@
+#include "MPIIORestart21CoProcessor.h"
+#include <boost/foreach.hpp>
+#include "D3Q27System.h"
+#include "CompressibleCumulantLBMKernel.h"
+#include "D3Q27EsoTwist3DSplittedVector.h"
+#include <UbSystem.h>
+#include <MemoryUtil.h>
+#include "RenumberBlockVisitor.h"
+
+MPIIORestart21CoProcessor::MPIIORestart21CoProcessor(Grid3DPtr grid, UbSchedulerPtr s,
+ const std::string& path,
+ CommunicatorPtr comm) :
+ CoProcessor(grid, s),
+ path(path),
+ comm(comm),
+ mpiTypeFreeFlag(false)
+{
+ UbSystem::makeDirectory(path+"/mpi_io_cp");
+
+ memset(&dataSetParamStr, 0, sizeof(dataSetParamStr));
+ memset(&boundCondParamStr, 0, sizeof(boundCondParamStr));
+
+ //------------------------- define MPI types ---------------------------------
+
+ MPI_Datatype typesGP[3] = { MPI_DOUBLE, MPI_INT, MPI_CHAR };
+ int blocksGP[3] = { 34, 6, 5 };
+ MPI_Aint offsetsGP[3], lbGP, extentGP;
+
+ offsetsGP[0] = 0;
+ MPI_Type_get_extent(MPI_DOUBLE, &lbGP, &extentGP);
+ offsetsGP[1] = blocksGP[0]*extentGP;
+
+ MPI_Type_get_extent(MPI_INT, &lbGP, &extentGP);
+ offsetsGP[2] = offsetsGP[1]+blocksGP[1]*extentGP;
+
+ MPI_Type_create_struct(3, blocksGP, offsetsGP, typesGP, &gridParamType);
+ MPI_Type_commit(&gridParamType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Type_contiguous(40, MPI_INT, &dataSetParamType);
+ MPI_Type_commit(&dataSetParamType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Datatype typesBlock[2] = { MPI_INT, MPI_CHAR };
+ int blocksBlock[2] = { 13, 1 };
+ MPI_Aint offsetsBlock[2], lbBlock, extentBlock;
+
+ offsetsBlock[0] = 0;
+ MPI_Type_get_extent(MPI_INT, &lbBlock, &extentBlock);
+ offsetsBlock[1] = blocksBlock[0]*extentBlock;
+
+ MPI_Type_create_struct(2, blocksBlock, offsetsBlock, typesBlock, &block3dType);
+ MPI_Type_commit(&block3dType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Datatype typesDataSet[3] = { MPI_DOUBLE, MPI_INT, MPI_CHAR };
+ int blocksDataSet[3] = { 2, 2, 2 };
+ MPI_Aint offsetsDatatSet[3], lbDataSet, extentDataSet;
+
+ offsetsDatatSet[0] = 0;
+ MPI_Type_get_extent(MPI_DOUBLE, &lbDataSet, &extentDataSet);
+ offsetsDatatSet[1] = blocksDataSet[0]*extentDataSet;
+
+ MPI_Type_get_extent(MPI_INT, &lbDataSet, &extentDataSet);
+ offsetsDatatSet[2] = offsetsDatatSet[1]+blocksDataSet[1]*extentDataSet;
+
+ MPI_Type_create_struct(3, blocksDataSet, offsetsDatatSet, typesDataSet, &dataSetType);
+ MPI_Type_commit(&dataSetType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Type_contiguous(4, MPI_INT, &boundCondParamType);
+ MPI_Type_commit(&boundCondParamType);
+
+ //-----------------------------------------------------------------------
+
+ MPI_Datatype typesBC[3] = { MPI_LONG_LONG_INT, MPI_FLOAT, MPI_CHAR };
+ int blocksBC[3] = { 5, 39, 1 };
+ MPI_Aint offsetsBC[3], lbBC, extentBC;
+
+ offsetsBC[0] = 0;
+ MPI_Type_get_extent(MPI_LONG_LONG_INT, &lbBC, &extentBC);
+ offsetsBC[1] = blocksBC[0]*extentBC;
+
+ MPI_Type_get_extent(MPI_FLOAT, &lbBC, &extentBC);
+ offsetsBC[2] = offsetsBC[1]+blocksBC[1]*extentBC;
+
+ MPI_Type_create_struct(3, blocksBC, offsetsBC, typesBC, &boundCondType);
+ MPI_Type_commit(&boundCondType);
+
+ //---------------------------------------
+
+ MPI_Type_contiguous(3, MPI_INT, &boundCondTypeAdd);
+ MPI_Type_commit(&boundCondTypeAdd);
+
+}
+//////////////////////////////////////////////////////////////////////////
+MPIIORestart21CoProcessor::~MPIIORestart21CoProcessor()
+{
+ MPI_Type_free(&gridParamType);
+ MPI_Type_free(&dataSetParamType);
+ MPI_Type_free(&block3dType);
+ MPI_Type_free(&dataSetType);
+ MPI_Type_free(&boundCondParamType);
+ MPI_Type_free(&boundCondType);
+ MPI_Type_free(&boundCondTypeAdd);
+
+ if (mpiTypeFreeFlag)
+ {
+ MPI_Type_free(&dataSetDoubleType);
+ MPI_Type_free(&bcindexmatrixType);
+ }
+}
+
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart21CoProcessor::process(double step)
+{
+ if (scheduler->isDue(step))
+ {
+ if (comm->isRoot()) UBLOG(logINFO, "MPIIORestart2CoProcessor save step: "<<step);
+ if (comm->isRoot()) UBLOG(logINFO, "Save check point - start");
+ /*if (comm->isRoot())*/ clearAllFiles((int)step);
+ writeBlocks((int)step);
+ writeDataSet((int)step);
+ writeBoundaryConds((int)step);
+ if (comm->isRoot()) UBLOG(logINFO, "Save check point - end");
+ }
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart21CoProcessor::clearAllFiles(int step)
+{
+ MPI_File file_handler1, file_handler2, file_handler3;
+ MPI_Info info = MPI_INFO_NULL;
+ MPI_Offset new_size = 0;
+
+ UbSystem::makeDirectory(path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step));
+ std::string filename1 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBlocks.bin";
+ //MPI_File_delete(filename1.c_str(), info);
+ int rc1 = MPI_File_open(MPI_COMM_WORLD, filename1.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, MPI_INFO_NULL, &file_handler1);
+ if (rc1 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename1);
+ MPI_File_set_size(file_handler1, new_size);
+ //MPI_File_sync(file_handler1);
+ MPI_File_close(&file_handler1);
+
+ std::string filename2 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpDataSet.bin";
+ //MPI_File_delete(filename2.c_str(), info);
+ int rc2 = MPI_File_open(MPI_COMM_WORLD, filename2.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, info, &file_handler2);
+ if (rc2 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename2);
+ MPI_File_set_size(file_handler2, new_size);
+ //MPI_File_sync(file_handler2);
+ MPI_File_close(&file_handler2);
+
+ std::string filename3 = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBC.bin";
+ //MPI_File_delete(filename3.c_str(), info);
+ int rc3 = MPI_File_open(MPI_COMM_WORLD, filename3.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, info, &file_handler3);
+ if (rc3 != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename3);
+ MPI_File_set_size(file_handler3, new_size);
+ //MPI_File_sync(file_handler3);
+ MPI_File_close(&file_handler3);
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart21CoProcessor::writeBlocks(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ //MPI_Comm_size(MPI_COMM_WORLD, &size);
+ size=1;
+
+ grid->deleteBlockIDs();
+ RenumberBlockVisitor renumber;
+ grid->accept(renumber);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeBlocks start collect data rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ int blocksCount = 0; // quantity of all the blocks in the grid, max 2147483648 blocks!
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+
+ std::vector<Block3DPtr> blocksVector[25]; // max 25 levels
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ //grid->getBlocks(level, rank, blockVector[level]);
+ grid->getBlocks(level, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ GridParam* gridParameters = new GridParam;
+ gridParameters->trafoParams[0] = grid->getCoordinateTransformator()->Tx1;
+ gridParameters->trafoParams[1] = grid->getCoordinateTransformator()->Tx2;
+ gridParameters->trafoParams[2] = grid->getCoordinateTransformator()->Tx3;
+ gridParameters->trafoParams[3] = grid->getCoordinateTransformator()->Sx1;
+ gridParameters->trafoParams[4] = grid->getCoordinateTransformator()->Sx2;
+ gridParameters->trafoParams[5] = grid->getCoordinateTransformator()->Sx3;
+ gridParameters->trafoParams[6] = grid->getCoordinateTransformator()->alpha;
+ gridParameters->trafoParams[7] = grid->getCoordinateTransformator()->beta;
+ gridParameters->trafoParams[8] = grid->getCoordinateTransformator()->gamma;
+
+ gridParameters->trafoParams[9] = grid->getCoordinateTransformator()->toX1factorX1;
+ gridParameters->trafoParams[10] = grid->getCoordinateTransformator()->toX1factorX2;
+ gridParameters->trafoParams[11] = grid->getCoordinateTransformator()->toX1factorX3;
+ gridParameters->trafoParams[12] = grid->getCoordinateTransformator()->toX1delta;
+ gridParameters->trafoParams[13] = grid->getCoordinateTransformator()->toX2factorX1;
+ gridParameters->trafoParams[14] = grid->getCoordinateTransformator()->toX2factorX2;
+ gridParameters->trafoParams[15] = grid->getCoordinateTransformator()->toX2factorX3;
+ gridParameters->trafoParams[16] = grid->getCoordinateTransformator()->toX2delta;
+ gridParameters->trafoParams[17] = grid->getCoordinateTransformator()->toX3factorX1;
+ gridParameters->trafoParams[18] = grid->getCoordinateTransformator()->toX3factorX2;
+ gridParameters->trafoParams[19] = grid->getCoordinateTransformator()->toX3factorX3;
+ gridParameters->trafoParams[20] = grid->getCoordinateTransformator()->toX3delta;
+
+ gridParameters->trafoParams[21] = grid->getCoordinateTransformator()->fromX1factorX1;
+ gridParameters->trafoParams[22] = grid->getCoordinateTransformator()->fromX1factorX2;
+ gridParameters->trafoParams[23] = grid->getCoordinateTransformator()->fromX1factorX3;
+ gridParameters->trafoParams[24] = grid->getCoordinateTransformator()->fromX1delta;
+ gridParameters->trafoParams[25] = grid->getCoordinateTransformator()->fromX2factorX1;
+ gridParameters->trafoParams[26] = grid->getCoordinateTransformator()->fromX2factorX2;
+ gridParameters->trafoParams[27] = grid->getCoordinateTransformator()->fromX2factorX3;
+ gridParameters->trafoParams[28] = grid->getCoordinateTransformator()->fromX2delta;
+ gridParameters->trafoParams[29] = grid->getCoordinateTransformator()->fromX3factorX1;
+ gridParameters->trafoParams[30] = grid->getCoordinateTransformator()->fromX3factorX2;
+ gridParameters->trafoParams[31] = grid->getCoordinateTransformator()->fromX3factorX3;
+ gridParameters->trafoParams[32] = grid->getCoordinateTransformator()->fromX3delta;
+
+ gridParameters->active = grid->getCoordinateTransformator()->active;
+ gridParameters->transformation = grid->getCoordinateTransformator()->transformation;
+
+ gridParameters->deltaX = grid->getDeltaX(minInitLevel);
+ UbTupleInt3 blocknx = grid->getBlockNX();
+ gridParameters->blockNx1 = val<1>(blocknx);
+ gridParameters->blockNx2 = val<2>(blocknx);
+ gridParameters->blockNx3 = val<3>(blocknx);
+ gridParameters->nx1 = grid->getNX1();
+ gridParameters->nx2 = grid->getNX2();
+ gridParameters->nx3 = grid->getNX3();
+ gridParameters->periodicX1 = grid->isPeriodicX1();
+ gridParameters->periodicX2 = grid->isPeriodicX2();
+ gridParameters->periodicX3 = grid->isPeriodicX3();
+
+ //----------------------------------------------------------------------
+
+ Block3d* block3dArray = new Block3d[blocksCount];
+ int ic = 0;
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // all the blocks of the current level
+ {
+ // save data describing the block
+ block3dArray[ic].x1 = block->getX1();
+ block3dArray[ic].x2 = block->getX2();
+ block3dArray[ic].x3 = block->getX3();
+ block3dArray[ic].bundle = block->getBundle();
+ block3dArray[ic].rank = block->getRank();
+ block3dArray[ic].lrank = block->getLocalRank();
+ block3dArray[ic].part = block->getPart();
+ block3dArray[ic].globalID = block->getGlobalID();
+ block3dArray[ic].localID = block->getLocalID();
+ block3dArray[ic].level = block->getLevel();
+ block3dArray[ic].interpolationFlagCF = block->getInterpolationFlagCF();
+ block3dArray[ic].interpolationFlagFC = block->getInterpolationFlagFC();
+ block3dArray[ic].counter = block->getMaxGlobalID();
+ block3dArray[ic].active = block->isActive();
+
+ ic++;
+ }
+ }
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeBlocks start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ // write to the file
+ MPI_File file_handler;
+ MPI_Info info = MPI_INFO_NULL;
+ //MPI_Info_create (&info);
+ //MPI_Info_set(info,"romio_cb_write","enable");
+ //MPI_Info_set(info,"cb_buffer_size","4194304");
+ //MPI_Info_set(info,"striping_unit","4194304");
+
+ // if (comm->isRoot())
+ // {
+ UbSystem::makeDirectory(path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step));
+ std::string filename = path + "/mpi_io_cp/mpi_io_cp_" + UbSystem::toString(step) + "/cpBlocks.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE | MPI_MODE_WRONLY, MPI_INFO_NULL, &file_handler);
+ if (rc != MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file " + filename);
+ // }
+
+ double start, finish;
+ MPI_Offset write_offset = (MPI_Offset)(size*sizeof(int));
+
+ if (comm->isRoot())
+ {
+ start = MPI_Wtime();
+
+ // each process writes the quantity of it's blocks
+ MPI_File_write_at(file_handler, 0/*rank*sizeof(int)*/, &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ // each process writes parameters of the grid
+ MPI_File_write_at(file_handler, write_offset, gridParameters, 1, gridParamType, MPI_STATUS_IGNORE);
+ // each process writes it's blocks
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset +sizeof(GridParam)), &block3dArray[0], blocksCount, block3dType, MPI_STATUS_IGNORE);
+ //MPI_File_sync(file_handler);
+ }
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeBlocks time: "<<finish-start<<" s");
+ }
+
+ delete[] block3dArray;
+ delete gridParameters;
+}
+
+void MPIIORestart21CoProcessor::writeDataSet(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ int blocksCount = 0; // quantity of blocks, that belong to this process
+
+ std::vector<Block3DPtr> blocksVector[25];
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ grid->getBlocks(level, rank, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ DataSet* dataSetArray = new DataSet[blocksCount];
+ std::vector<double> doubleValuesArray; // double-values (arrays of f's) in all blocks
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeDataSet start collect data rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ bool firstBlock = true;
+ int ic = 0;
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
+ {
+ dataSetArray[ic].globalID = block->getGlobalID(); // id of the block needed to find it while regenerating the grid
+ dataSetArray[ic].ghostLayerWidth = block->getKernel()->getGhostLayerWidth();
+ dataSetArray[ic].collFactor = block->getKernel()->getCollisionFactor();
+ dataSetArray[ic].deltaT = block->getKernel()->getDeltaT();
+ dataSetArray[ic].compressible = block->getKernel()->getCompressible();
+ dataSetArray[ic].withForcing = block->getKernel()->getWithForcing();
+
+ if (firstBlock)// && block->getKernel()) // when first (any) valid block...
+ {
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageValuesArray3DPtr = block->getKernel()->getDataSet()->getAverageValues();
+ if (AverageValuesArray3DPtr)
+ {
+ dataSetParamStr.nx[0][0] = static_cast<int>(AverageValuesArray3DPtr->getNX1());
+ dataSetParamStr.nx[0][1] = static_cast<int>(AverageValuesArray3DPtr->getNX2());
+ dataSetParamStr.nx[0][2] = static_cast<int>(AverageValuesArray3DPtr->getNX3());
+ dataSetParamStr.nx[0][3] = static_cast<int>(AverageValuesArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageVelocityArray3DPtr = block->getKernel()->getDataSet()->getAverageVelocity();
+ if (AverageVelocityArray3DPtr)
+ {
+ dataSetParamStr.nx[1][0] = static_cast<int>(AverageVelocityArray3DPtr->getNX1());
+ dataSetParamStr.nx[1][1] = static_cast<int>(AverageVelocityArray3DPtr->getNX2());
+ dataSetParamStr.nx[1][2] = static_cast<int>(AverageVelocityArray3DPtr->getNX3());
+ dataSetParamStr.nx[1][3] = static_cast<int>(AverageVelocityArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageFluctArray3DPtr = block->getKernel()->getDataSet()->getAverageFluctuations();
+ if (AverageFluctArray3DPtr)
+ {
+ dataSetParamStr.nx[2][0] = static_cast<int>(AverageFluctArray3DPtr->getNX1());
+ dataSetParamStr.nx[2][1] = static_cast<int>(AverageFluctArray3DPtr->getNX2());
+ dataSetParamStr.nx[2][2] = static_cast<int>(AverageFluctArray3DPtr->getNX3());
+ dataSetParamStr.nx[2][3] = static_cast<int>(AverageFluctArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageTripleArray3DPtr = block->getKernel()->getDataSet()->getAverageTriplecorrelations();
+ if (AverageTripleArray3DPtr)
+ {
+ dataSetParamStr.nx[3][0] = static_cast<int>(AverageTripleArray3DPtr->getNX1());
+ dataSetParamStr.nx[3][1] = static_cast<int>(AverageTripleArray3DPtr->getNX2());
+ dataSetParamStr.nx[3][2] = static_cast<int>(AverageTripleArray3DPtr->getNX3());
+ dataSetParamStr.nx[3][3] = static_cast<int>(AverageTripleArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > ShearStressValArray3DPtr = block->getKernel()->getDataSet()->getShearStressValues();
+ if (ShearStressValArray3DPtr)
+ {
+ dataSetParamStr.nx[4][0] = static_cast<int>(ShearStressValArray3DPtr->getNX1());
+ dataSetParamStr.nx[4][1] = static_cast<int>(ShearStressValArray3DPtr->getNX2());
+ dataSetParamStr.nx[4][2] = static_cast<int>(ShearStressValArray3DPtr->getNX3());
+ dataSetParamStr.nx[4][3] = static_cast<int>(ShearStressValArray3DPtr->getNX4());
+ }
+
+ boost::shared_ptr< CbArray3D<LBMReal, IndexerX3X2X1> > relaxationFactor3DPtr = block->getKernel()->getDataSet()->getRelaxationFactor();
+ if (relaxationFactor3DPtr)
+ {
+ dataSetParamStr.nx[5][0] = static_cast<int>(relaxationFactor3DPtr->getNX1());
+ dataSetParamStr.nx[5][1] = static_cast<int>(relaxationFactor3DPtr->getNX2());
+ dataSetParamStr.nx[5][2] = static_cast<int>(relaxationFactor3DPtr->getNX3());
+ dataSetParamStr.nx[5][3] = 1;
+ }
+
+ boost::shared_ptr< D3Q27EsoTwist3DSplittedVector > D3Q27EsoTwist3DSplittedVectorPtr = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(block->getKernel()->getDataSet()->getFdistributions());
+ CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr localDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getLocalDistributions();
+ if (localDistributions)
+ {
+ dataSetParamStr.nx[6][0] = static_cast<int>(localDistributions->getNX1());
+ dataSetParamStr.nx[6][1] = static_cast<int>(localDistributions->getNX2());
+ dataSetParamStr.nx[6][2] = static_cast<int>(localDistributions->getNX3());
+ dataSetParamStr.nx[6][3] = static_cast<int>(localDistributions->getNX4());
+ }
+
+ CbArray4D <LBMReal, IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getNonLocalDistributions();
+ if (nonLocalDistributions)
+ {
+ dataSetParamStr.nx[7][0] = static_cast<int>(nonLocalDistributions->getNX1());
+ dataSetParamStr.nx[7][1] = static_cast<int>(nonLocalDistributions->getNX2());
+ dataSetParamStr.nx[7][2] = static_cast<int>(nonLocalDistributions->getNX3());
+ dataSetParamStr.nx[7][3] = static_cast<int>(nonLocalDistributions->getNX4());
+ }
+
+ CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr zeroDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getZeroDistributions();
+ if (zeroDistributions)
+ {
+ dataSetParamStr.nx[8][0] = static_cast<int>(zeroDistributions->getNX1());
+ dataSetParamStr.nx[8][1] = static_cast<int>(zeroDistributions->getNX2());
+ dataSetParamStr.nx[8][2] = static_cast<int>(zeroDistributions->getNX3());
+ dataSetParamStr.nx[8][3] = 1;
+ }
+
+ // ... than save some parameters that are equal in all blocks
+ dataSetParamStr.nx1 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX1());
+ dataSetParamStr.nx2 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX2());
+ dataSetParamStr.nx3 = static_cast<int>(block->getKernel()->getDataSet()->getFdistributions()->getNX3());
+
+ firstBlock = false;
+
+ // how many elements are in all arrays of DataSet (equal in all blocks)
+ int doubleCount = 0, temp;
+ for (int i = 0; i < 9; i++) // 9 arrays ( averageValues, averageVelocity, averageFluktuations,
+ { // averageTriplecorrelations, shearStressValues, relaxationFactor, 3 * fdistributions
+ temp = 1;
+ for (int ii = 0; ii < 4; ii++) // 4 values (nx1, nx2, nx3, nx4)
+ temp *= dataSetParamStr.nx[i][ii];
+ doubleCount += temp;
+ }
+ dataSetParamStr.doubleCountInBlock = doubleCount;
+ }
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageValuesArray3DPtr = block->getKernel()->getDataSet()->getAverageValues();
+ if (AverageValuesArray3DPtr&&(dataSetParamStr.nx[0][0]>0)&&(dataSetParamStr.nx[0][1]>0)&&(dataSetParamStr.nx[0][2]>0)&&(dataSetParamStr.nx[0][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageValuesArray3DPtr->getDataVector().begin(), AverageValuesArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageVelocityArray3DPtr = block->getKernel()->getDataSet()->getAverageVelocity();
+ if (AverageVelocityArray3DPtr&&(dataSetParamStr.nx[1][0]>0)&&(dataSetParamStr.nx[1][1]>0)&&(dataSetParamStr.nx[1][2]>0)&&(dataSetParamStr.nx[1][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageVelocityArray3DPtr->getDataVector().begin(), AverageVelocityArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageFluctArray3DPtr = block->getKernel()->getDataSet()->getAverageFluctuations();
+ if (AverageFluctArray3DPtr&&(dataSetParamStr.nx[2][0]>0)&&(dataSetParamStr.nx[2][1]>0)&&(dataSetParamStr.nx[2][2]>0)&&(dataSetParamStr.nx[2][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageFluctArray3DPtr->getDataVector().begin(), AverageFluctArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageTripleArray3DPtr = block->getKernel()->getDataSet()->getAverageTriplecorrelations();
+ if (AverageTripleArray3DPtr&&(dataSetParamStr.nx[3][0]>0)&&(dataSetParamStr.nx[3][1]>0)&&(dataSetParamStr.nx[3][2]>0)&&(dataSetParamStr.nx[3][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), AverageTripleArray3DPtr->getDataVector().begin(), AverageTripleArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > ShearStressValArray3DPtr = block->getKernel()->getDataSet()->getShearStressValues();
+ if (ShearStressValArray3DPtr&&(dataSetParamStr.nx[4][0]>0)&&(dataSetParamStr.nx[4][1]>0)&&(dataSetParamStr.nx[4][2]>0)&&(dataSetParamStr.nx[4][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), ShearStressValArray3DPtr->getDataVector().begin(), ShearStressValArray3DPtr->getDataVector().end());
+
+ boost::shared_ptr< CbArray3D<LBMReal, IndexerX3X2X1> > RelaxationFactor3DPtr = block->getKernel()->getDataSet()->getRelaxationFactor();
+ if (RelaxationFactor3DPtr&&(dataSetParamStr.nx[5][0]>0)&&(dataSetParamStr.nx[5][1]>0)&&(dataSetParamStr.nx[5][2]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), RelaxationFactor3DPtr->getDataVector().begin(), RelaxationFactor3DPtr->getDataVector().end());
+
+ boost::shared_ptr< D3Q27EsoTwist3DSplittedVector > D3Q27EsoTwist3DSplittedVectorPtr = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(block->getKernel()->getDataSet()->getFdistributions());
+ CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr localDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getLocalDistributions();
+ if (localDistributions&&(dataSetParamStr.nx[6][0]>0)&&(dataSetParamStr.nx[6][1]>0)&&(dataSetParamStr.nx[6][2]>0)&&(dataSetParamStr.nx[6][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), localDistributions->getDataVector().begin(), localDistributions->getDataVector().end());
+
+ CbArray4D <LBMReal, IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getNonLocalDistributions();
+ if (nonLocalDistributions&&(dataSetParamStr.nx[7][0]>0)&&(dataSetParamStr.nx[7][1]>0)&&(dataSetParamStr.nx[7][2]>0)&&(dataSetParamStr.nx[7][3]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), nonLocalDistributions->getDataVector().begin(), nonLocalDistributions->getDataVector().end());
+
+ CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr zeroDistributions = D3Q27EsoTwist3DSplittedVectorPtr->getZeroDistributions();
+ if (zeroDistributions&&(dataSetParamStr.nx[8][0]>0)&&(dataSetParamStr.nx[8][1]>0)&&(dataSetParamStr.nx[8][2]>0))
+ doubleValuesArray.insert(doubleValuesArray.end(), zeroDistributions->getDataVector().begin(), zeroDistributions->getDataVector().end());
+
+ ic++;
+ }
+ }
+
+ // register new MPI-type depending on the block-specific information
+ MPI_Type_contiguous(dataSetParamStr.doubleCountInBlock, MPI_DOUBLE, &dataSetDoubleType);
+ MPI_Type_commit(&dataSetDoubleType);
+ mpiTypeFreeFlag = true;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeDataSet start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_Info info = MPI_INFO_NULL;
+ //MPI_Info_create (&info);
+ //MPI_Info_set(info,"romio_cb_write","enable");
+ //MPI_Info_set(info,"cb_buffer_size","4194304");
+ //MPI_Info_set(info,"striping_unit","4194304");
+
+ // write to the file
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE|MPI_MODE_WRONLY, info, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ size_t sizeofOneDataSet = sizeof(DataSet) + dataSetParamStr.doubleCountInBlock * sizeof(double);
+ MPI_Offset write_offset = 0;
+
+ MPI_File_write_at(file_handler, write_offset, &dataSetParamStr, 1, dataSetParamType, MPI_STATUS_IGNORE);
+
+ for (int nb = 0; nb < blocksCount; nb++)
+ {
+ write_offset = (MPI_Offset)(sizeof(dataSetParam) + dataSetArray[nb].globalID * sizeofOneDataSet);
+ MPI_File_write_at(file_handler, write_offset, &dataSetArray[nb], 1, dataSetType, MPI_STATUS_IGNORE);
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset + sizeof(DataSet)), &doubleValuesArray[nb * dataSetParamStr.doubleCountInBlock], 1, dataSetDoubleType, MPI_STATUS_IGNORE);
+ }
+
+ MPI_File_sync(file_handler);
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeDataSet time: "<<finish-start<<" s");
+ }
+
+ delete[] dataSetArray;
+}
+
+void MPIIORestart21CoProcessor::writeBoundaryConds(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeBoundaryConds start collect data rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ int blocksCount = 0; // quantity of blocks, that belong to this process
+ size_t allBytesCount = 0; // quantity of bytes, that one process writes to the file
+ size_t count_boundCond = 0; // how many BoundaryConditions in all blocks
+ int count_indexContainer = 0; // how many indexContainer-values in all blocks
+
+ std::vector<Block3DPtr> blocksVector[25];
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ grid->getBlocks(level, rank, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ BCAdd* bcAddArray = new BCAdd[blocksCount];
+ size_t* bytesCount = new size_t[blocksCount]; // quantity of bytes, that each block writes to the file
+ std::vector<BoundaryCondition>* bcVector = new std::vector<BoundaryCondition>[blocksCount];
+ std::vector<int>* bcindexmatrixVector = new std::vector<int>[blocksCount];
+ std::vector<int>* indexContainerVector = new std::vector<int>[blocksCount];
+
+ bool bcindexmatrixCountNotInit = true;
+ int ic = 0;
+ for (int level = minInitLevel; level<=maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // all the blocks of the current level
+ {
+ BCArray3DPtr bcArr = block->getKernel()->getBCProcessor()->getBCArray();
+
+ bcAddArray[ic].globalID = block->getGlobalID(); // id of the block needed to find it while regenerating the grid
+ bcAddArray[ic].boundCond_count = 0; // how many BoundaryConditions in this block
+ bcAddArray[ic].indexContainer_count = 0; // how many indexContainer-values in this block
+ bytesCount[ic] = sizeof(BCAdd);
+ bcVector[ic].resize(0);
+ bcindexmatrixVector[ic].resize(0);
+ indexContainerVector[ic].resize(0);
+
+ for (int bc = 0; bc<bcArr->getBCVectorSize(); bc++)
+ {
+ BoundaryCondition* bouCond = new BoundaryCondition();
+ if (bcArr->bcvector[bc]==NULL)
+ {
+ memset(bouCond, 0, sizeof(BoundaryCondition));
+ }
+ else
+ {
+ bouCond->noslipBoundaryFlags = bcArr->bcvector[bc]->getNoSlipBoundary();
+ bouCond->slipBoundaryFlags = bcArr->bcvector[bc]->getSlipBoundary();
+ bouCond->velocityBoundaryFlags = bcArr->bcvector[bc]->getVelocityBoundary();
+ bouCond->densityBoundaryFlags = bcArr->bcvector[bc]->getDensityBoundary();
+ bouCond->wallModelBoundaryFlags = bcArr->bcvector[bc]->getWallModelBoundary();
+ bouCond->bcVelocityX1 = bcArr->bcvector[bc]->getBoundaryVelocityX1();
+ bouCond->bcVelocityX2 = bcArr->bcvector[bc]->getBoundaryVelocityX2();
+ bouCond->bcVelocityX3 = bcArr->bcvector[bc]->getBoundaryVelocityX3();
+ bouCond->bcDensity = bcArr->bcvector[bc]->getBoundaryDensity();
+ bouCond->bcLodiDensity = bcArr->bcvector[bc]->getDensityLodiDensity();
+ bouCond->bcLodiVelocityX1 = bcArr->bcvector[bc]->getDensityLodiVelocityX1();
+ bouCond->bcLodiVelocityX2 = bcArr->bcvector[bc]->getDensityLodiVelocityX2();
+ bouCond->bcLodiVelocityX3 = bcArr->bcvector[bc]->getDensityLodiVelocityX3();
+ bouCond->bcLodiLentgh = bcArr->bcvector[bc]->getDensityLodiLength();
+ bouCond->nx1 = bcArr->bcvector[bc]->nx1;
+ bouCond->nx2 = bcArr->bcvector[bc]->nx2;
+ bouCond->nx3 = bcArr->bcvector[bc]->nx3;
+ for (int iq = 0; iq<26; iq++)
+ bouCond->q[iq] = bcArr->bcvector[bc]->getQ(iq);
+ bouCond->algorithmType = bcArr->bcvector[bc]->getBcAlgorithmType();
+ }
+
+ bcVector[ic].push_back(*bouCond);
+ bcAddArray[ic].boundCond_count++;
+ count_boundCond++;
+ bytesCount[ic] += sizeof(BoundaryCondition);
+ }
+
+ if (bcindexmatrixCountNotInit)
+ {
+ boundCondParamStr.nx1 = static_cast<int>(bcArr->bcindexmatrix.getNX1());
+ boundCondParamStr.nx2 = static_cast<int>(bcArr->bcindexmatrix.getNX2());
+ boundCondParamStr.nx3 = static_cast<int>(bcArr->bcindexmatrix.getNX3());
+ boundCondParamStr.bcindexmatrixCount = static_cast<int>(bcArr->bcindexmatrix.getDataVector().size());
+ bcindexmatrixCountNotInit = false;
+ }
+ bcindexmatrixVector[ic].insert(bcindexmatrixVector[ic].begin(), bcArr->bcindexmatrix.getDataVector().begin(), bcArr->bcindexmatrix.getDataVector().end());
+ bytesCount[ic] += boundCondParamStr.bcindexmatrixCount * sizeof(int);
+
+ indexContainerVector[ic].insert(indexContainerVector[ic].begin(), bcArr->indexContainer.begin(), bcArr->indexContainer.end());
+ bcAddArray[ic].indexContainer_count = static_cast<int>(bcArr->indexContainer.size());
+ count_indexContainer += bcAddArray[ic].indexContainer_count;
+ bytesCount[ic] += bcAddArray[ic].indexContainer_count * sizeof(int);
+
+ allBytesCount += bytesCount[ic];
+
+ ic++;
+ }
+ }
+
+ MPI_Type_contiguous(boundCondParamStr.bcindexmatrixCount, MPI_INT, &bcindexmatrixType);
+ MPI_Type_commit(&bcindexmatrixType);
+ mpiTypeFreeFlag = true;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeBoundaryConds start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_Info info = MPI_INFO_NULL;
+ //MPI_Info_create (&info);
+ //MPI_Info_set(info,"romio_cb_write","enable");
+ //MPI_Info_set(info,"cb_buffer_size","4194304");
+ //MPI_Info_set(info,"striping_unit","4194304");
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBC.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_CREATE|MPI_MODE_WRONLY, info, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ MPI_Offset write_offset = (MPI_Offset)(sizeof(boundCondParam) + grid->getNumberOfBlocks() * sizeof(size_t));
+ size_t next_file_offset = 0;
+ if (size > 1)
+ {
+ if (rank == 0)
+ {
+ next_file_offset = write_offset + allBytesCount;
+ MPI_Send(&next_file_offset, 1, MPI_LONG_LONG_INT, 1, 5, MPI_COMM_WORLD);
+ }
+ else
+ {
+ MPI_Recv(&write_offset, 1, MPI_LONG_LONG_INT, rank - 1, 5, MPI_COMM_WORLD, MPI_STATUS_IGNORE);
+ next_file_offset = write_offset + allBytesCount;
+ if (rank < size - 1)
+ MPI_Send(&next_file_offset, 1, MPI_LONG_LONG_INT, rank + 1, 5, MPI_COMM_WORLD);
+ }
+ }
+
+ MPI_File_write_at(file_handler, 0, &boundCondParamStr, 1, boundCondParamType, MPI_STATUS_IGNORE);
+
+ MPI_Offset write_offsetIndex;
+
+ for (int nb = 0; nb < blocksCount; nb++)
+ {
+ write_offsetIndex = (MPI_Offset)(sizeof(boundCondParam) + bcAddArray[nb].globalID * sizeof(size_t));
+ MPI_File_write_at(file_handler, write_offsetIndex, &write_offset, 1, MPI_LONG_LONG_INT, MPI_STATUS_IGNORE);
+
+ MPI_File_write_at(file_handler, write_offset, &bcAddArray[nb], 1, boundCondTypeAdd, MPI_STATUS_IGNORE);
+ if (bcVector[nb].size() > 0)
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset + sizeof(BCAdd)), &bcVector[nb][0], bcAddArray[nb].boundCond_count, boundCondType, MPI_STATUS_IGNORE);
+
+ if (bcindexmatrixVector[nb].size() > 0)
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset + sizeof(BCAdd) + bcAddArray[nb].boundCond_count * sizeof(BoundaryCondition)),
+ &bcindexmatrixVector[nb][0], 1, bcindexmatrixType, MPI_STATUS_IGNORE);
+
+ if (indexContainerVector[nb].size() > 0)
+ MPI_File_write_at(file_handler, (MPI_Offset)(write_offset + sizeof(BCAdd) + bcAddArray[nb].boundCond_count * sizeof(BoundaryCondition) + boundCondParamStr.bcindexmatrixCount * sizeof(int)),
+ &indexContainerVector[nb][0], bcAddArray[nb].indexContainer_count, MPI_INT, MPI_STATUS_IGNORE);
+
+ write_offset += bytesCount[nb];
+ }
+
+ MPI_File_sync(file_handler);
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::writeBoundaryConds time: "<<finish-start<<" s");
+ }
+
+ delete[] bcAddArray;
+ delete[] bytesCount;
+ delete[] bcVector;
+ delete[] bcindexmatrixVector;
+ delete[] indexContainerVector;
+}
+
+//------------------------------------------- READ -----------------------------------------------
+void MPIIORestart21CoProcessor::restart(int step)
+{
+ if (comm->isRoot()) UBLOG(logINFO, "MPIIORestart21CoProcessor restart step: "<<step);
+ if (comm->isRoot()) UBLOG(logINFO, "Load check point - start");
+ readBlocks(step);
+ readDataSet(step);
+ readBoundaryConds(step);
+ if (comm->isRoot()) UBLOG(logINFO, "Load check point - end");
+ this->reconnect(grid);
+}
+
+void MPIIORestart21CoProcessor::readBlocks(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ //MPI_Comm_size(MPI_COMM_WORLD, &size);
+ size = 1;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBlocks start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBlocks.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ // read count of blocks
+ int blocksCount = 0;
+ //MPI_File_read_at(file_handler, rank*sizeof(int), &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, 0, &blocksCount, 1, MPI_INT, MPI_STATUS_IGNORE);
+ Block3d* block3dArray = new Block3d[blocksCount];
+
+ GridParam* gridParameters = new GridParam;
+
+ // calculate the read offset
+ MPI_Offset read_offset = (MPI_Offset)(size*sizeof(int));
+
+ // read parameters of the grid
+ MPI_File_read_at(file_handler, read_offset, gridParameters, 1, gridParamType, MPI_STATUS_IGNORE);
+ // read all the blocks
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset+sizeof(GridParam)), &block3dArray[0], blocksCount, block3dType, MPI_STATUS_IGNORE);
+
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBlocks time: "<<finish-start<<" s");
+ }
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBlocks start of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ // clear the grid
+ std::vector<Block3DPtr> blocksVector;
+ grid->getBlocks(0, blocksVector);
+ int del = 0;
+ BOOST_FOREACH(Block3DPtr block, blocksVector)
+ {
+ grid->deleteBlock(block);
+ del++;
+ }
+
+ // restore the grid
+ CoordinateTransformation3DPtr trafo(new CoordinateTransformation3D());
+ trafo->Tx1 = gridParameters->trafoParams[0];
+ trafo->Tx2 = gridParameters->trafoParams[1];
+ trafo->Tx3 = gridParameters->trafoParams[2];
+ trafo->Sx1 = gridParameters->trafoParams[3];
+ trafo->Sx2 = gridParameters->trafoParams[4];
+ trafo->Sx3 = gridParameters->trafoParams[5];
+ trafo->alpha = gridParameters->trafoParams[6];
+ trafo->beta = gridParameters->trafoParams[7];
+ trafo->gamma = gridParameters->trafoParams[8];
+
+ trafo->toX1factorX1 = gridParameters->trafoParams[9];
+ trafo->toX1factorX2 = gridParameters->trafoParams[10];
+ trafo->toX1factorX3 = gridParameters->trafoParams[11];
+ trafo->toX1delta = gridParameters->trafoParams[12];
+ trafo->toX2factorX1 = gridParameters->trafoParams[13];
+ trafo->toX2factorX2 = gridParameters->trafoParams[14];
+ trafo->toX2factorX3 = gridParameters->trafoParams[15];
+ trafo->toX2delta = gridParameters->trafoParams[16];
+ trafo->toX3factorX1 = gridParameters->trafoParams[17];
+ trafo->toX3factorX2 = gridParameters->trafoParams[18];
+ trafo->toX3factorX3 = gridParameters->trafoParams[19];
+ trafo->toX3delta = gridParameters->trafoParams[20];
+
+ trafo->fromX1factorX1 = gridParameters->trafoParams[21];
+ trafo->fromX1factorX2 = gridParameters->trafoParams[22];
+ trafo->fromX1factorX3 = gridParameters->trafoParams[23];
+ trafo->fromX1delta = gridParameters->trafoParams[24];
+ trafo->fromX2factorX1 = gridParameters->trafoParams[25];
+ trafo->fromX2factorX2 = gridParameters->trafoParams[26];
+ trafo->fromX2factorX3 = gridParameters->trafoParams[27];
+ trafo->fromX2delta = gridParameters->trafoParams[28];
+ trafo->fromX3factorX1 = gridParameters->trafoParams[29];
+ trafo->fromX3factorX2 = gridParameters->trafoParams[30];
+ trafo->fromX3factorX3 = gridParameters->trafoParams[31];
+ trafo->fromX3delta = gridParameters->trafoParams[32];
+
+ trafo->active = gridParameters->active;
+ trafo->transformation = gridParameters->transformation;
+
+ grid->setCoordinateTransformator(trafo);
+
+ grid->setDeltaX(gridParameters->deltaX);
+ grid->setBlockNX(gridParameters->blockNx1, gridParameters->blockNx2, gridParameters->blockNx3);
+ grid->setNX1(gridParameters->nx1);
+ grid->setNX2(gridParameters->nx2);
+ grid->setNX3(gridParameters->nx3);
+ grid->setPeriodicX1(gridParameters->periodicX1);
+ grid->setPeriodicX2(gridParameters->periodicX2);
+ grid->setPeriodicX3(gridParameters->periodicX3);
+
+ // regenerate blocks
+ for (int n = 0; n<blocksCount; n++)
+ {
+ Block3DPtr block(new Block3D(block3dArray[n].x1, block3dArray[n].x2, block3dArray[n].x3, block3dArray[n].level));
+ block->setActive(block3dArray[n].active);
+ block->setBundle(block3dArray[n].bundle);
+ block->setRank(block3dArray[n].rank);
+ block->setLocalRank(block3dArray[n].lrank);
+ block->setGlobalID(block3dArray[n].globalID);
+ block->setLocalID(block3dArray[n].localID);
+ block->setPart(block3dArray[n].part);
+ block->setLevel(block3dArray[n].level);
+ block->interpolationFlagCF = block3dArray[n].interpolationFlagCF;
+ block->interpolationFlagFC = block3dArray[n].interpolationFlagFC;
+
+ grid->addBlock(block);
+ }
+
+ delete gridParameters;
+ delete[] block3dArray;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBlocks end of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+}
+
+void MPIIORestart21CoProcessor::readDataSet(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readDataSet start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ int blocksCount = 0; // quantity of the blocks, that belong to this process
+
+ // read from the grid the blocks, that belong to this process
+ std::vector<Block3DPtr> blocksVector[25];
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+ for (int level = minInitLevel; level <= maxInitLevel; level++)
+ {
+ grid->getBlocks(level, rank, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ DataSet* dataSetArray = new DataSet[blocksCount];
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ MPI_File_read_at(file_handler, (MPI_Offset)0, &dataSetParamStr, 1, dataSetParamType, MPI_STATUS_IGNORE);
+
+ std::vector<double> doubleValuesArray(blocksCount * dataSetParamStr.doubleCountInBlock); // double-values in all blocks
+
+ // define MPI_types depending on the block-specific information
+ MPI_Type_contiguous(dataSetParamStr.doubleCountInBlock, MPI_DOUBLE, &dataSetDoubleType);
+ MPI_Type_commit(&dataSetDoubleType);
+ mpiTypeFreeFlag = true;
+
+ int ic = 0;
+ MPI_Offset read_offset;
+ size_t sizeofOneDataSet = size_t(sizeof(DataSet) + dataSetParamStr.doubleCountInBlock * sizeof(double));
+ for (int level = minInitLevel; level <= maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
+ {
+ read_offset = (MPI_Offset)(sizeof(dataSetParam) + block->getGlobalID() * sizeofOneDataSet);
+ MPI_File_read_at(file_handler, read_offset, &dataSetArray[ic], 1, dataSetType, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset + sizeof(DataSet)), &doubleValuesArray[ic * dataSetParamStr.doubleCountInBlock], 1, dataSetDoubleType, MPI_STATUS_IGNORE);
+ ic++;
+ }
+ }
+
+ MPI_File_close(&file_handler);
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readDataSet time: "<<finish-start<<" s");
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readDataSet start of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ size_t index = 0, nextVectorSize = 0;
+ std::vector<double> vectorsOfValues[9];
+ for (int n = 0; n<blocksCount; n++)
+ {
+ for (int b = 0; b<9; b++) // assign approciate vectors to 9 dataSet arrays
+ {
+ nextVectorSize = dataSetParamStr.nx[b][0]* dataSetParamStr.nx[b][1]* dataSetParamStr.nx[b][2]* dataSetParamStr.nx[b][3];
+ vectorsOfValues[b].assign(doubleValuesArray.data()+index, doubleValuesArray.data()+index+nextVectorSize);
+ index += nextVectorSize;
+ }
+
+ // fill dataSet arrays
+ AverageValuesArray3DPtr mAverageValues;
+ if ((dataSetParamStr.nx[0][0]==0)&&(dataSetParamStr.nx[0][1]==0)&&(dataSetParamStr.nx[0][2]==0)&&(dataSetParamStr.nx[0][3]==0))
+ mAverageValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[0], dataSetParamStr.nx[0][0], dataSetParamStr.nx[0][1], dataSetParamStr.nx[0][2], dataSetParamStr.nx[0][3]));
+
+ AverageValuesArray3DPtr mAverageVelocity;
+ if ((dataSetParamStr.nx[1][0]==0)&&(dataSetParamStr.nx[1][1]==0)&&(dataSetParamStr.nx[1][2]==0)&&(dataSetParamStr.nx[1][3]==0))
+ mAverageVelocity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageVelocity = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[1], dataSetParamStr.nx[1][0], dataSetParamStr.nx[1][1], dataSetParamStr.nx[1][2], dataSetParamStr.nx[1][3]));
+
+ AverageValuesArray3DPtr mAverageFluktuations;
+ if ((dataSetParamStr.nx[2][0]==0)&&(dataSetParamStr.nx[2][1]==0)&&(dataSetParamStr.nx[2][2]==0)&&(dataSetParamStr.nx[2][3]==0))
+ mAverageFluktuations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageFluktuations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[2], dataSetParamStr.nx[2][0], dataSetParamStr.nx[2][1], dataSetParamStr.nx[2][2], dataSetParamStr.nx[2][3]));
+
+ AverageValuesArray3DPtr mAverageTriplecorrelations;
+ if ((dataSetParamStr.nx[3][0]==0)&&(dataSetParamStr.nx[3][1]==0)&&(dataSetParamStr.nx[3][2]==0)&&(dataSetParamStr.nx[3][3]==0))
+ mAverageTriplecorrelations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mAverageTriplecorrelations = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[3], dataSetParamStr.nx[3][0], dataSetParamStr.nx[3][1], dataSetParamStr.nx[3][2], dataSetParamStr.nx[3][3]));
+
+ ShearStressValuesArray3DPtr mShearStressValues;
+ if ((dataSetParamStr.nx[4][0]==0)&&(dataSetParamStr.nx[4][1]==0)&&(dataSetParamStr.nx[4][2]==0)&&(dataSetParamStr.nx[4][3]==0))
+ mShearStressValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr();
+ else
+ mShearStressValues = CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[4], dataSetParamStr.nx[4][0], dataSetParamStr.nx[4][1], dataSetParamStr.nx[4][2], dataSetParamStr.nx[4][3]));
+
+ RelaxationFactorArray3DPtr mRelaxationFactor;
+ if ((dataSetParamStr.nx[5][0]==0)&&(dataSetParamStr.nx[5][1]==0)&&(dataSetParamStr.nx[5][2]==0))
+ mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr();
+ else
+ mRelaxationFactor = CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[5], dataSetParamStr.nx[5][0], dataSetParamStr.nx[5][1], dataSetParamStr.nx[5][2]));
+
+ DistributionArray3DPtr mFdistributions(new D3Q27EsoTwist3DSplittedVector());
+
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[6], dataSetParamStr.nx[6][0], dataSetParamStr.nx[6][1], dataSetParamStr.nx[6][2], dataSetParamStr.nx[6][3])));
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNonLocalDistributions(CbArray4D<LBMReal, IndexerX4X3X2X1>::CbArray4DPtr(new CbArray4D<LBMReal, IndexerX4X3X2X1>(vectorsOfValues[7], dataSetParamStr.nx[7][0], dataSetParamStr.nx[7][1], dataSetParamStr.nx[7][2], dataSetParamStr.nx[7][3])));
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setZeroDistributions(CbArray3D<LBMReal, IndexerX3X2X1>::CbArray3DPtr(new CbArray3D<LBMReal, IndexerX3X2X1>(vectorsOfValues[8], dataSetParamStr.nx[8][0], dataSetParamStr.nx[8][1], dataSetParamStr.nx[8][2])));
+
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX1(dataSetParamStr.nx1);
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX2(dataSetParamStr.nx2);
+ boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(mFdistributions)->setNX3(dataSetParamStr.nx3);
+
+ DataSet3DPtr dataSetPtr = DataSet3DPtr(new DataSet3D());
+ dataSetPtr->setAverageValues(mAverageValues);
+ dataSetPtr->setAverageVelocity(mAverageVelocity);
+ dataSetPtr->setAverageFluctuations(mAverageFluktuations);
+ dataSetPtr->setAverageTriplecorrelations(mAverageTriplecorrelations);
+ dataSetPtr->setShearStressValues(mShearStressValues);
+ dataSetPtr->setRelaxationFactor(mRelaxationFactor);
+ dataSetPtr->setFdistributions(mFdistributions);
+
+ // find the nesessary block and fill it
+ Block3DPtr block = grid->getBlock(dataSetArray[n].globalID);
+ //LBMKernelPtr kernel(new CompressibleCumulantLBMKernel(0, 0, 0, CompressibleCumulantLBMKernel::NORMAL));
+ LBMKernelPtr kernel = this->lbmKernel->clone();
+ kernel->setGhostLayerWidth(dataSetArray[n].ghostLayerWidth);
+ kernel->setCollisionFactor(dataSetArray[n].collFactor);
+ kernel->setDeltaT(dataSetArray[n].deltaT);
+ kernel->setCompressible(dataSetArray[n].compressible);
+ kernel->setWithForcing(dataSetArray[n].withForcing);
+ kernel->setDataSet(dataSetPtr);
+ block->setKernel(kernel);
+ }
+
+ delete[] dataSetArray;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readDataSet end of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+}
+
+void MPIIORestart21CoProcessor::readBoundaryConds(int step)
+{
+ int rank, size;
+ MPI_Comm_rank(MPI_COMM_WORLD, &rank);
+ MPI_Comm_size(MPI_COMM_WORLD, &size);
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBoundaryConds start MPI IO rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+
+ double start, finish;
+ if (comm->isRoot()) start = MPI_Wtime();
+
+ MPI_File file_handler;
+ std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpBC.bin";
+ int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
+ if (rc!=MPI_SUCCESS) throw UbException(UB_EXARGS, "couldn't open file "+filename);
+
+ int blocksCount = 0; // quantity of the blocks, that belong to this process
+
+ // read from the grid the blocks, that belong to this process
+ std::vector<Block3DPtr> blocksVector[25];
+ int minInitLevel = this->grid->getCoarsestInitializedLevel();
+ int maxInitLevel = this->grid->getFinestInitializedLevel();
+ for (int level = minInitLevel; level <= maxInitLevel; level++)
+ {
+ grid->getBlocks(level, rank, blocksVector[level]);
+ blocksCount += static_cast<int>(blocksVector[level].size());
+ }
+
+ BCAdd* bcAddArray = new BCAdd[blocksCount];
+ BoundaryCondition* nullBouCond = new BoundaryCondition();
+ memset(nullBouCond, 0, sizeof(BoundaryCondition));
+ BoundaryCondition* bcArray;
+ int* intArray1;
+ int* intArray2;
+ std::vector<BoundaryConditionsPtr> bcVector;
+ std::vector<int> bcindexmatrixV;
+ std::vector<int> indexContainerV;
+
+ if (comm->isRoot())
+ {
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBoundaryConds time: " << finish - start << " s");
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBoundaryConds start of restore of data, rank = " << rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: " << Utilities::getPhysMemUsedByMe() / 1073741824.0 << " GB");
+ }
+
+ MPI_File_read_at(file_handler, (MPI_Offset)0, &boundCondParamStr, 1, boundCondParamType, MPI_STATUS_IGNORE);
+ MPI_Type_contiguous(boundCondParamStr.bcindexmatrixCount, MPI_INT, &bcindexmatrixType);
+ MPI_Type_commit(&bcindexmatrixType);
+ mpiTypeFreeFlag = true;
+
+ int ic = 0;
+ MPI_Offset read_offset1, read_offset2;
+ for (int level = minInitLevel; level <= maxInitLevel; level++)
+ {
+ BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
+ {
+ read_offset1 = (MPI_Offset)(sizeof(boundCondParam) + block->getGlobalID() * sizeof(size_t));
+
+ MPI_File_read_at(file_handler, read_offset1, &read_offset2, 1, MPI_LONG_LONG_INT, MPI_STATUS_IGNORE);
+ MPI_File_read_at(file_handler, read_offset2, &bcAddArray[ic], 1, boundCondTypeAdd, MPI_STATUS_IGNORE);
+
+ bcArray = new BoundaryCondition[bcAddArray[ic].boundCond_count];
+ intArray1 = new int[boundCondParamStr.bcindexmatrixCount];
+ intArray2 = new int[bcAddArray[ic].indexContainer_count];
+
+ if (bcAddArray[ic].boundCond_count > 0)
+ {
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset2 + sizeof(BCAdd)), &bcArray[0], bcAddArray[ic].boundCond_count, boundCondType, MPI_STATUS_IGNORE);
+ }
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset2 + sizeof(BCAdd) + bcAddArray[ic].boundCond_count * sizeof(BoundaryCondition)),
+ &intArray1[0], 1, bcindexmatrixType, MPI_STATUS_IGNORE);
+ if (bcAddArray[ic].indexContainer_count > 0)
+ {
+ MPI_File_read_at(file_handler, (MPI_Offset)(read_offset2 + sizeof(BCAdd) + bcAddArray[ic].boundCond_count * sizeof(BoundaryCondition) + boundCondParamStr.bcindexmatrixCount * sizeof(int)),
+ &intArray2[0], bcAddArray[ic].indexContainer_count, MPI_INT, MPI_STATUS_IGNORE);
+ }
+
+ bcindexmatrixV.resize(0);
+ indexContainerV.resize(0);
+ bcVector.resize(0);
+
+ for (size_t ibc = 0; ibc<bcAddArray[ic].boundCond_count; ibc++)
+ {
+ BoundaryConditionsPtr bc;
+ if (memcmp(&bcArray[ibc], nullBouCond, sizeof(BoundaryCondition))==0)
+ bc = BoundaryConditionsPtr();
+ else
+ {
+ bc = BoundaryConditionsPtr(new BoundaryConditions);
+ bc->noslipBoundaryFlags = bcArray[ibc].noslipBoundaryFlags;
+ bc->slipBoundaryFlags = bcArray[ibc].slipBoundaryFlags;
+ bc->densityBoundaryFlags = bcArray[ibc].densityBoundaryFlags;
+ bc->velocityBoundaryFlags = bcArray[ibc].velocityBoundaryFlags;
+ bc->wallModelBoundaryFlags = bcArray[ibc].wallModelBoundaryFlags;
+ bc->bcVelocityX1 = bcArray[ibc].bcVelocityX1;
+ bc->bcVelocityX2 = bcArray[ibc].bcVelocityX2;
+ bc->bcVelocityX3 = bcArray[ibc].bcVelocityX3;
+ bc->bcDensity = bcArray[ibc].bcDensity;
+ bc->bcLodiDensity = bcArray[ibc].bcLodiDensity;
+ bc->bcLodiVelocityX1 = bcArray[ibc].bcLodiVelocityX1;
+ bc->bcLodiVelocityX2 = bcArray[ibc].bcLodiVelocityX2;
+ bc->bcLodiVelocityX3 = bcArray[ibc].bcLodiVelocityX3;
+ bc->bcLodiLentgh = bcArray[ibc].bcLodiLentgh;
+
+ bc->nx1 = bcArray[ibc].nx1;
+ bc->nx2 = bcArray[ibc].nx2;
+ bc->nx3 = bcArray[ibc].nx3;
+ for (int iq = 0; iq<26; iq++)
+ bc->setQ(bcArray[ibc].q[iq], iq);
+ bc->setBcAlgorithmType(bcArray[ibc].algorithmType);
+ }
+
+ bcVector.push_back(bc);
+ }
+
+ for (int b1 = 0; b1 < boundCondParamStr.bcindexmatrixCount; b1++)
+ bcindexmatrixV.push_back(intArray1[b1]);
+
+ for (int b2 = 0; b2 < bcAddArray[ic].indexContainer_count; b2++)
+ indexContainerV.push_back(intArray2[b2]);
+
+ CbArray3D<int, IndexerX3X2X1> bcim(bcindexmatrixV, boundCondParamStr.nx1, boundCondParamStr.nx2, boundCondParamStr.nx3);
+ Block3DPtr block1 = grid->getBlock(bcAddArray[ic].globalID);
+
+ //BCProcessorPtr bcProc(new BCProcessor());
+ BCProcessorPtr bcProc = bcProcessor->clone(block1->getKernel());
+ //BCArray3DPtr bcArr = bcProc->getBCArray();
+ BCArray3DPtr bcArr(new BCArray3D());
+ bcArr->bcindexmatrix = bcim;
+ bcArr->bcvector = bcVector;
+ bcArr->indexContainer = indexContainerV;
+ bcProc->setBCArray(bcArr);
+
+ block1->getKernel()->setBCProcessor(bcProc);
+
+ delete bcArray;
+ delete intArray1;
+ delete intArray2;
+
+ ic++;
+ }
+ }
+ MPI_File_close(&file_handler);
+
+ delete nullBouCond;
+
+ if (comm->isRoot())
+ {
+ UBLOG(logINFO, "MPIIORestart21CoProcessor::readBoundaryConds end of restore of data, rank = "<<rank);
+ UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
+ }
+}
+
+void MPIIORestart21CoProcessor::setChunk(int val)
+{
+ chunk = val;
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart21CoProcessor::setLBMKernel(LBMKernelPtr kernel)
+{
+ this->lbmKernel = kernel;
+}
+//////////////////////////////////////////////////////////////////////////
+void MPIIORestart21CoProcessor::setBCProcessor(BCProcessorPtr bcProcessor)
+{
+ this->bcProcessor = bcProcessor;
+}
+
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.h b/source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.h
new file mode 100644
index 000000000..038292d33
--- /dev/null
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart21CoProcessor.h
@@ -0,0 +1,185 @@
+#ifndef _MPIIORestart21CoProcessor_H_
+#define _MPIIORestart21CoProcessor_H_
+
+#include "mpi.h"
+
+#include "CoProcessor.h"
+#include "Communicator.h"
+#include "WbWriter.h"
+
+#include <boost/shared_ptr.hpp>
+
+class MPIIORestart21CoProcessor;
+typedef boost::shared_ptr<MPIIORestart21CoProcessor> MPIIORestart21CoProcessorPtr;
+
+//! \class MPIWriteBlocksCoProcessor
+//! \brief Writes the grid each timestep into the files and reads the grip from the files before regenerating
+class MPIIORestart21CoProcessor: public CoProcessor
+{
+ //! \struct GridParam
+ //! \brief Structure describes parameters of the grid
+ //! \details The structure is nessasary to restore the grid correctly
+ struct GridParam
+ {
+ double trafoParams[33];
+ double deltaX;
+ int blockNx1;
+ int blockNx2;
+ int blockNx3;
+ int nx1;
+ int nx2;
+ int nx3;
+ bool periodicX1;
+ bool periodicX2;
+ bool periodicX3;
+ bool active;
+ bool transformation;
+ };
+
+ //! \struct Block3d
+ //! \brief Structure contains information of the block
+ //! \details The structure is used to write the data describing the block in the grid when saving the grid
+ //! and to read it when restoring the grid
+ struct Block3d
+ {
+ int x1;
+ int x2;
+ int x3;
+ int bundle;
+ int rank;
+ int lrank;
+ int part;
+ int globalID;
+ int localID;
+ int level;
+ int interpolationFlagCF;
+ int interpolationFlagFC;
+ int counter;
+ bool active;
+ };
+
+ //! \struct dataSetParam
+ //! \brief Structure describes parameters of the dataSet that are equal in all blocks
+ //! \details The structure used to store some parameters needed to restore dataSet arrays
+ struct dataSetParam
+ {
+ int nx1;
+ int nx2;
+ int nx3;
+ int nx[9][4]; // 9 arrays x (nx1, nx2, nx3, nx4)
+ int doubleCountInBlock; // how many double-values are in all arrays dataSet in one (any) block
+ };
+
+ //! \struct dataSet
+ //! \brief Structure containes information identifying the block
+ //! \details The structure is used to find the needed block in the grid when restoring a dataSet
+ struct DataSet
+ {
+ double collFactor;
+ double deltaT;
+ int globalID;
+ int ghostLayerWidth;
+ bool compressible;
+ bool withForcing;
+ };
+
+ //! \struct BoundaryCondition
+ //! \brief Structure containes information about boundary conditions of the block
+ //! \details The structure is used to write data describing boundary conditions of the blocks when saving the grid
+ //! and to read it when restoring the grid
+ struct BoundaryCondition
+ {
+ long long noslipBoundaryFlags; // MPI_LONG_LONG
+ long long slipBoundaryFlags;
+ long long velocityBoundaryFlags;
+ long long densityBoundaryFlags;
+ long long wallModelBoundaryFlags;
+
+ float bcVelocityX1;
+ float bcVelocityX2;
+ float bcVelocityX3;
+ float bcDensity;
+
+ float bcLodiDensity;
+ float bcLodiVelocityX1;
+ float bcLodiVelocityX2;
+ float bcLodiVelocityX3;
+ float bcLodiLentgh;
+
+ float nx1,nx2,nx3;
+ float q[26]; // MPI_FLOAT
+
+ char algorithmType;
+ };
+
+ //! \struct boundCondParam
+ //! \brief Structure describes parameters of the boundaryConditions that are equal in all blocks
+ //! \details The structure used to store some parameters needed to restore boundaryConditions arrays
+ struct boundCondParam
+ {
+ int nx1;
+ int nx2;
+ int nx3;
+ int bcindexmatrixCount; // how many bcindexmatrix-values in one (any) block
+ };
+
+ //! \struct BCAdd
+ //! \brief Structure containes information identifying the block
+ //! and some parameters of the arrays of boundary conditions that are equal in all blocks
+ //! \details The structure is used to find the needed block in the grid when restoring a dataSet
+ //! and to set common parameters
+ struct BCAdd
+ {
+ int globalID;
+ //int x1; // to find the right block
+ //int x2;
+ //int x3;
+ //int level;
+ int boundCond_count; // how many BoundaryCondition-structures are in this block
+ int indexContainer_count; // how many indexContainer-values are in this block
+ };
+
+public:
+ MPIIORestart21CoProcessor(Grid3DPtr grid, UbSchedulerPtr s, const std::string& path, CommunicatorPtr comm);
+ virtual ~MPIIORestart21CoProcessor();
+ //! Each timestep writes the grid into the files
+ void process(double step);
+ //! Reads the grid from the files before grid reconstruction
+ void restart(int step);
+ //! Writes the blocks of the grid into the file outputBlocks.bin
+ void writeBlocks(int step);
+ //! Writes the datasets of the blocks into the file outputDataSet.bin
+ void writeDataSet(int step);
+ //! Writes the boundary conditions of the blocks into the file outputBoundCond.bin
+ void writeBoundaryConds(int step);
+ //! Reads the blocks of the grid from the file outputBlocks.bin
+ void readBlocks(int step);
+ //! Reads the datasets of the blocks from the file outputDataSet.bin
+ void readDataSet(int step);
+ //! Reads the boundary conditions of the blocks from the file outputBoundCond.bin
+ void readBoundaryConds(int step);
+ //! The function sets number of ranks that read simultaneously
+ void setChunk(int val);
+ //! The function sets LBMKernel
+ void setLBMKernel(LBMKernelPtr kernel);
+ //!The function sets BCProcessor
+ void setBCProcessor(BCProcessorPtr bcProcessor);
+ //!The function truncates the data files
+ void clearAllFiles(int step);
+
+protected:
+ std::string path;
+ CommunicatorPtr comm;
+ bool mpiTypeFreeFlag;
+
+private:
+ MPI_Datatype gridParamType, block3dType, dataSetParamType, dataSetType, dataSetDoubleType, boundCondParamType, boundCondType, boundCondTypeAdd, bcindexmatrixType;
+ dataSetParam dataSetParamStr;
+ boundCondParam boundCondParamStr;
+ int chunk;
+ LBMKernelPtr lbmKernel;
+ BCProcessorPtr bcProcessor;
+
+};
+
+#endif
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.cpp b/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.cpp
index 778a06060..29776c614 100644
--- a/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.cpp
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.cpp
@@ -5,7 +5,7 @@
#include "D3Q27EsoTwist3DSplittedVector.h"
#include <UbSystem.h>
#include <MemoryUtil.h>
-#include "RenumberBlockVisitor.h"
+#include "MetisPartitioningGridVisitor.h"
MPIIORestart2CoProcessor::MPIIORestart2CoProcessor(Grid3DPtr grid, UbSchedulerPtr s,
const std::string& path,
@@ -119,7 +119,15 @@ void MPIIORestart2CoProcessor::process(double step)
writeBlocks((int)step);
writeDataSet((int)step);
writeBoundaryConds((int)step);
+
+
+ //MPI_Barrier(MPI_COMM_WORLD);
+
if (comm->isRoot()) UBLOG(logINFO, "Save check point - end");
+
+
+ //readDataSet((int)step);
+
}
}
//////////////////////////////////////////////////////////////////////////
@@ -162,13 +170,17 @@ void MPIIORestart2CoProcessor::writeBlocks(int step)
//MPI_Comm_size(MPI_COMM_WORLD, &size);
size=1;
- if (comm->isRoot())
+
+ //if (comm->isRoot())
{
- grid->deleteBlockIDs();
- RenumberBlockVisitor renumber;
- grid->accept(renumber);
+ //grid->deleteBlockIDs();
+ //RenumberBlockVisitor renumber;
+ //grid->accept(renumber);
+ grid->renumberBlockIDs();
}
- grid->updateDistributedBlocks(comm);
+ //grid->updateDistributedBlocks(comm);
+
+//UBLOG(logINFO, "MPIIORestart2CoProcessor::writeBlocks BlockIDs size = "<<grid->getBlockIDs().size()<<" rank = "<<rank);
if (comm->isRoot())
{
@@ -458,6 +470,8 @@ void MPIIORestart2CoProcessor::writeDataSet(int step)
DataSet* dataSetArray = new DataSet[blocksCount];
std::vector<double> doubleValuesArray; // double-values (arrays of f's) in all blocks
+
+ //dataSetArrayTest = new DataSet[blocksCount];
if (comm->isRoot())
{
@@ -465,17 +479,27 @@ void MPIIORestart2CoProcessor::writeDataSet(int step)
UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
}
+//UBLOG(logINFO, "MPIIORestart2CoProcessor::writeDataSet minInitLevel="<<minInitLevel<<" maxInitLevel="<<maxInitLevel<<" blocksCount="<<blocksCount<<" rank = "<<rank);
+
int ic = 0;
for (int level = minInitLevel; level<=maxInitLevel; level++)
{
BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
{
dataSetArray[ic].globalID = block->getGlobalID(); // id of the block needed to find it while regenerating the grid
+ //UBLOG(logINFO, "MPIIORestart2CoProcessor::writeDataSet dataSetArray[n].globalID: "<<dataSetArray[ic].globalID<< " rank = "<<rank<<" ic = "<<ic);
dataSetArray[ic].ghostLayerWidth = block->getKernel()->getGhostLayerWidth();
dataSetArray[ic].collFactor = block->getKernel()->getCollisionFactor();
dataSetArray[ic].deltaT = block->getKernel()->getDeltaT();
dataSetArray[ic].compressible = block->getKernel()->getCompressible();
dataSetArray[ic].withForcing = block->getKernel()->getWithForcing();
+
+ //dataSetArrayTest[ic].globalID = block->getGlobalID(); // id of the block needed to find it while regenerating the grid
+ //dataSetArrayTest[ic].ghostLayerWidth = block->getKernel()->getGhostLayerWidth();
+ //dataSetArrayTest[ic].collFactor = block->getKernel()->getCollisionFactor();
+ //dataSetArrayTest[ic].deltaT = block->getKernel()->getDeltaT();
+ //dataSetArrayTest[ic].compressible = block->getKernel()->getCompressible();
+ //dataSetArrayTest[ic].withForcing = block->getKernel()->getWithForcing();
boost::shared_ptr< CbArray4D<LBMReal, IndexerX4X3X2X1> > AverageValuesArray3DPtr = block->getKernel()->getDataSet()->getAverageValues();
if (AverageValuesArray3DPtr&&(blockParamStr.nx[0][0]>0)&&(blockParamStr.nx[0][1]>0)&&(blockParamStr.nx[0][2]>0)&&(blockParamStr.nx[0][3]>0))
@@ -746,6 +770,10 @@ void MPIIORestart2CoProcessor::restart(int step)
if (comm->isRoot()) UBLOG(logINFO, "MPIIORestart2CoProcessor restart step: "<<step);
if (comm->isRoot()) UBLOG(logINFO, "Load check point - start");
readBlocks(step);
+
+ Grid3DVisitorPtr metisVisitor(new MetisPartitioningGridVisitor(comm, MetisPartitioningGridVisitor::LevelBased, D3Q27System::BSW, MetisPartitioner::KWAY));
+ grid->accept(metisVisitor);
+
readDataSet(step);
readBoundaryConds(step);
if (comm->isRoot()) UBLOG(logINFO, "Load check point - end");
@@ -933,7 +961,7 @@ void MPIIORestart2CoProcessor::readDataSet(int step)
DataSet* dataSetArray = new DataSet[blocksCount];
std::vector<double> doubleValuesArray(blocksCount * blockParamStr.doubleCountInBlock); // double-values in all blocks
-
+
MPI_File file_handler;
std::string filename = path+"/mpi_io_cp/mpi_io_cp_"+UbSystem::toString(step)+"/cpDataSet.bin";
int rc = MPI_File_open(MPI_COMM_WORLD, filename.c_str(), MPI_MODE_RDONLY, MPI_INFO_NULL, &file_handler);
@@ -947,6 +975,7 @@ void MPIIORestart2CoProcessor::readDataSet(int step)
BOOST_FOREACH(Block3DPtr block, blocksVector[level]) // blocks of the current level
{
read_offset = (MPI_Offset)(block->getGlobalID() * sizeofOneDataSet);
+ //UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet read_offset="<<read_offset<<" sizeofOneDataSet="<<sizeofOneDataSet<<" GlobalID="<<block->getGlobalID()<< " rank="<<rank);
MPI_File_read_at(file_handler, read_offset, &dataSetArray[ic], 1, dataSetType, MPI_STATUS_IGNORE);
MPI_File_read_at(file_handler, (MPI_Offset)(read_offset + sizeof(DataSet)), &doubleValuesArray[ic*blockParamStr.doubleCountInBlock], 1, dataSetDoubleType, MPI_STATUS_IGNORE);
ic++;
@@ -955,6 +984,7 @@ void MPIIORestart2CoProcessor::readDataSet(int step)
MPI_File_close(&file_handler);
+
if (comm->isRoot())
{
finish = MPI_Wtime();
@@ -962,6 +992,19 @@ void MPIIORestart2CoProcessor::readDataSet(int step)
UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet start of restore of data, rank = "<<rank);
UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
}
+
+ //for (int n = 0; n<blocksCount; n++)
+ //{
+ //if(dataSetArray[n].globalID != dataSetArrayTest[n].globalID)
+ //{
+ //UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet dataSetArray[n].globalID: "<<dataSetArray[n].globalID<< " rank = "<<rank<<" n = "<<n);
+ ////UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet dataSetArray[n].globalID: "<<dataSetArray[n].globalID);
+ ////UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet SetArrayTest[n].globalID: "<<dataSetArrayTest[n].globalID);
+ //}
+ //}
+
+ //UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet grid size 1: "<<grid->getNumberOfBlocks()<<" rank = "<<rank);
+ //UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet BlockIDs size 1: "<<grid->getBlockIDs().size()<<" rank = "<<rank);
size_t index = 0, nextVectorSize = 0;
std::vector<double> vectorsOfValues[9];
@@ -1033,7 +1076,13 @@ void MPIIORestart2CoProcessor::readDataSet(int step)
// find the nesessary block and fill it
Block3DPtr block = grid->getBlock(dataSetArray[n].globalID);
- //LBMKernelPtr kernel(new CompressibleCumulantLBMKernel(0, 0, 0, CompressibleCumulantLBMKernel::NORMAL));
+ //Block3DPtr block = grid->getBlock(2);
+ if (!block)
+ {
+ UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet don't find block dataSetArray[n].globalID: "<<dataSetArray[n].globalID<< " rank = "<<rank<<" n = "<<n);
+ UBLOG(logINFO, "MPIIORestart2CoProcessor::readDataSet grid size 2: "<<grid->getNumberOfBlocks()<<" rank = "<<rank);
+ }
+ ////LBMKernelPtr kernel(new CompressibleCumulantLBMKernel(0, 0, 0, CompressibleCumulantLBMKernel::NORMAL));
LBMKernelPtr kernel = this->lbmKernel->clone();
kernel->setGhostLayerWidth(dataSetArray[n].ghostLayerWidth);
kernel->setCollisionFactor(dataSetArray[n].collFactor);
@@ -1097,8 +1146,8 @@ void MPIIORestart2CoProcessor::readBoundaryConds(int step)
if (comm->isRoot())
{
- finish = MPI_Wtime();
- UBLOG(logINFO, "MPIIORestart2CoProcessor::readBoundaryConds time: " << finish - start << " s");
+ //finish = MPI_Wtime();
+ //UBLOG(logINFO, "MPIIORestart2CoProcessor::readBoundaryConds time: " << finish - start << " s");
UBLOG(logINFO, "MPIIORestart2CoProcessor::readBoundaryConds start of restore of data, rank = " << rank);
UBLOG(logINFO, "Physical Memory currently used by current process: " << Utilities::getPhysMemUsedByMe() / 1073741824.0 << " GB");
}
@@ -1203,6 +1252,8 @@ void MPIIORestart2CoProcessor::readBoundaryConds(int step)
if (comm->isRoot())
{
UBLOG(logINFO, "MPIIORestart2CoProcessor::readBoundaryConds end of restore of data, rank = "<<rank);
+ finish = MPI_Wtime();
+ UBLOG(logINFO, "MPIIORestart2CoProcessor::readBoundaryConds time: " << finish - start << " s");
UBLOG(logINFO, "Physical Memory currently used by current process: "<<Utilities::getPhysMemUsedByMe()/1073741824.0<<" GB");
}
}
diff --git a/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.h b/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.h
index 197e3b05b..9500ac7cb 100644
--- a/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.h
+++ b/source/VirtualFluidsCore/CoProcessors/MPIIORestart2CoProcessor.h
@@ -168,6 +168,8 @@ private:
int chunk;
LBMKernelPtr lbmKernel;
BCProcessorPtr bcProcessor;
+
+ DataSet* dataSetArrayTest;
};
diff --git a/source/VirtualFluidsCore/CoProcessors/TimeAveragedValuesCoProcessor.cpp b/source/VirtualFluidsCore/CoProcessors/TimeAveragedValuesCoProcessor.cpp
index e398a0e82..47774d6cc 100644
--- a/source/VirtualFluidsCore/CoProcessors/TimeAveragedValuesCoProcessor.cpp
+++ b/source/VirtualFluidsCore/CoProcessors/TimeAveragedValuesCoProcessor.cpp
@@ -210,6 +210,8 @@ void TimeAveragedValuesCoProcessor::addData(const Block3DPtr block)
datanames.resize(0);
datanames.push_back("level");
+
+ datanames.push_back("Rho");
if ((options&Density) == Density)
{
@@ -281,6 +283,9 @@ void TimeAveragedValuesCoProcessor::addData(const Block3DPtr block)
maxX2 -= 2;
maxX3 -= 2;
+ LBMReal f[D3Q27System::ENDF+1];
+ LBMReal vx1,vx2,vx3,rho;
+
//D3Q27BoundaryConditionPtr bcPtr;
int nr = (int)nodes.size();
@@ -301,6 +306,11 @@ void TimeAveragedValuesCoProcessor::addData(const Block3DPtr block)
data[index++].push_back(level);
+ distributions->getDistribution(f, ix1, ix2, ix3);
+ calcMacros(f, rho, vx1, vx2, vx3);
+
+ data[index++].push_back(rho);
+
if ((options&Density) == Density)
{
data[index++].push_back((*ar)(0, ix1, ix2, ix3));
diff --git a/source/VirtualFluidsCore/Data/D3Q27EsoTwist3DSplittedVector.h b/source/VirtualFluidsCore/Data/D3Q27EsoTwist3DSplittedVector.h
index 7a6a85da2..767c85a23 100644
--- a/source/VirtualFluidsCore/Data/D3Q27EsoTwist3DSplittedVector.h
+++ b/source/VirtualFluidsCore/Data/D3Q27EsoTwist3DSplittedVector.h
@@ -63,9 +63,10 @@ protected:
CbArray3D<LBMReal,IndexerX3X2X1>::CbArray3DPtr zeroDistributions;
size_t NX1, NX2, NX3;
- friend class MPIIORestartCoProcessor;
+ friend class MPIIORestart1CoProcessor;
friend class MPIIORestart2CoProcessor;
- friend class MPIIORestart3CoProcessor;
+ friend class MPIIORestart11CoProcessor;
+ friend class MPIIORestart21CoProcessor;
friend class boost::serialization::access;
template<class Archive>
diff --git a/source/VirtualFluidsCore/Grid/Block3D.h b/source/VirtualFluidsCore/Grid/Block3D.h
index a2e6d0e91..aaba47197 100644
--- a/source/VirtualFluidsCore/Grid/Block3D.h
+++ b/source/VirtualFluidsCore/Grid/Block3D.h
@@ -108,6 +108,7 @@ public:
std::string toString() ;
static int getMaxGlobalID() { return counter; }
+ static void setMaxGlobalID(int c) { counter = 0; }
private:
int x1;
int x2;
@@ -131,9 +132,10 @@ private:
int level;
static int counter;
- friend class MPIIORestartCoProcessor;
+ friend class MPIIORestart1CoProcessor;
friend class MPIIORestart2CoProcessor;
- friend class MPIIORestart3CoProcessor;
+ friend class MPIIORestart11CoProcessor;
+ friend class MPIIORestart21CoProcessor;
friend class boost::serialization::access;
template<class Archive>
diff --git a/source/VirtualFluidsCore/Grid/Grid3D.cpp b/source/VirtualFluidsCore/Grid/Grid3D.cpp
index e7a01c447..7943635ee 100644
--- a/source/VirtualFluidsCore/Grid/Grid3D.cpp
+++ b/source/VirtualFluidsCore/Grid/Grid3D.cpp
@@ -1943,6 +1943,29 @@ void Grid3D::deleteBlockIDs()
{
this->blockIdMap.clear();
}
+//////////////////////////////////////////////////////////////////////////
+void Grid3D::renumberBlockIDs()
+{
+ deleteBlockIDs();
+
+ int startLevel = getCoarsestInitializedLevel();
+ int stopLevel = getFinestInitializedLevel();
+ int counter = 0;
+
+ for (int l = startLevel; l <= stopLevel; l++)
+ {
+ std::vector<Block3DPtr> blockVector;
+ getBlocks(l, blockVector);
+ BOOST_FOREACH(Block3DPtr block, blockVector)
+ {
+ block->setGlobalID(counter);
+ blockIdMap.insert(std::make_pair(counter, block));
+ Block3D::setMaxGlobalID(counter);
+ counter++;
+ }
+ }
+}
+
//////////////////////////////////////////////////////////////////////////
void Grid3D::updateDistributedBlocks(CommunicatorPtr comm)
{
@@ -1965,6 +1988,7 @@ void Grid3D::updateDistributedBlocks(CommunicatorPtr comm)
blocks.push_back(block->getX3());
blocks.push_back(l);
blocks.push_back(block->getGlobalID());
+ blocks.push_back(block->getRank());
}
}
}
@@ -1986,10 +2010,11 @@ void Grid3D::updateDistributedBlocks(CommunicatorPtr comm)
levelSet.resize(Grid3DSystem::MAXLEVEL+1);
int rsize = blocks.size();
- for (int i = 0; i < rsize; i+=5)
+ for (int i = 0; i < rsize; i+=6)
{
Block3DPtr block(new Block3D(blocks[i], blocks[i+1], blocks[i+2], blocks[i+3]));
block->setGlobalID(blocks[i+4]);
+ block->setRank(blocks[i+5]);
this->addBlock(block);
}
diff --git a/source/VirtualFluidsCore/Grid/Grid3D.h b/source/VirtualFluidsCore/Grid/Grid3D.h
index e737a8d59..5662b51cb 100644
--- a/source/VirtualFluidsCore/Grid/Grid3D.h
+++ b/source/VirtualFluidsCore/Grid/Grid3D.h
@@ -75,6 +75,7 @@ public:
//const Block3DMap& getBlocks(int level);
const BlockIDMap& getBlockIDs();
void deleteBlockIDs();
+ void renumberBlockIDs();
void updateDistributedBlocks(CommunicatorPtr comm);
Block3DPtr getSuperBlock(Block3DPtr block);
Block3DPtr getSuperBlock(int ix1, int ix2, int ix3, int level);
diff --git a/source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.cpp b/source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.cpp
new file mode 100644
index 000000000..4a19222bf
--- /dev/null
+++ b/source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.cpp
@@ -0,0 +1,1081 @@
+#include "CompressibleCumulant2LBMKernel.h"
+#include "D3Q27System.h"
+#include "InterpolationProcessor.h"
+#include "D3Q27EsoTwist3DSplittedVector.h"
+#include <math.h>
+#include <omp.h>
+
+#define PROOF_CORRECTNESS
+
+//////////////////////////////////////////////////////////////////////////
+CompressibleCumulant2LBMKernel::CompressibleCumulant2LBMKernel()
+{
+ this->nx1 = 0;
+ this->nx2 = 0;
+ this->nx3 = 0;
+ this->parameter = NORMAL;
+ this->OxyyMxzz = 1.0;
+ this->compressible = true;
+ this->bulkOmegaToOmega = false;
+ this->OxxPyyPzz = 1.0;
+}
+//////////////////////////////////////////////////////////////////////////
+CompressibleCumulant2LBMKernel::CompressibleCumulant2LBMKernel(int nx1, int nx2, int nx3, Parameter p)
+{
+ this->nx1 = nx1;
+ this->nx2 = nx2;
+ this->nx3 = nx3;
+ this->parameter = p;
+ this->OxyyMxzz = 1.0;
+ this->compressible = true;
+ this->bulkOmegaToOmega = false;
+ this->OxxPyyPzz = 1.0;
+}
+//////////////////////////////////////////////////////////////////////////
+CompressibleCumulant2LBMKernel::~CompressibleCumulant2LBMKernel(void)
+{
+
+}
+//////////////////////////////////////////////////////////////////////////
+void CompressibleCumulant2LBMKernel::init()
+{
+ DistributionArray3DPtr d(new D3Q27EsoTwist3DSplittedVector(nx1+2, nx2+2, nx3+2, -999.0));
+ dataSet->setFdistributions(d);
+}
+//////////////////////////////////////////////////////////////////////////
+LBMKernelPtr CompressibleCumulant2LBMKernel::clone()
+{
+ LBMKernelPtr kernel(new CompressibleCumulant2LBMKernel(nx1, nx2, nx3, parameter));
+ boost::dynamic_pointer_cast<CompressibleCumulant2LBMKernel>(kernel)->init();
+ kernel->setCollisionFactor(this->collFactor);
+ kernel->setBCProcessor(bcProcessor->clone(kernel));
+ kernel->setWithForcing(withForcing);
+ kernel->setForcingX1(muForcingX1);
+ kernel->setForcingX2(muForcingX2);
+ kernel->setForcingX3(muForcingX3);
+ kernel->setIndex(ix1, ix2, ix3);
+ kernel->setDeltaT(deltaT);
+ switch (parameter)
+ {
+ case NORMAL:
+ boost::dynamic_pointer_cast<CompressibleCumulant2LBMKernel>(kernel)->OxyyMxzz = 1.0;
+ break;
+ case MAGIC:
+ boost::dynamic_pointer_cast<CompressibleCumulant2LBMKernel>(kernel)->OxyyMxzz = 2.0 +(-collFactor);
+ break;
+ }
+
+ if (bulkOmegaToOmega)
+ {
+ boost::dynamic_pointer_cast<CompressibleCumulant2LBMKernel>(kernel)->OxxPyyPzz = collFactor;
+ }
+ else
+ {
+ boost::dynamic_pointer_cast<CompressibleCumulant2LBMKernel>(kernel)->OxxPyyPzz = one;
+ }
+ return kernel;
+}
+//////////////////////////////////////////////////////////////////////////
+void CompressibleCumulant2LBMKernel::calculate()
+{
+ timer.resetAndStart();
+ collideAll();
+ timer.stop();
+}
+//////////////////////////////////////////////////////////////////////////
+void CompressibleCumulant2LBMKernel::collideAll()
+{
+ using namespace D3Q27System;
+
+ //initializing of forcing stuff
+ if (withForcing)
+ {
+ muForcingX1.DefineVar("x1", &muX1); muForcingX1.DefineVar("x2", &muX2); muForcingX1.DefineVar("x3", &muX3);
+ muForcingX2.DefineVar("x1", &muX1); muForcingX2.DefineVar("x2", &muX2); muForcingX2.DefineVar("x3", &muX3);
+ muForcingX3.DefineVar("x1", &muX1); muForcingX3.DefineVar("x2", &muX2); muForcingX3.DefineVar("x3", &muX3);
+
+ muDeltaT = deltaT;
+
+ muForcingX1.DefineVar("dt", &muDeltaT);
+ muForcingX2.DefineVar("dt", &muDeltaT);
+ muForcingX3.DefineVar("dt", &muDeltaT);
+
+ muNu = (1.0/3.0)*(1.0/collFactor - 1.0/2.0);
+
+ muForcingX1.DefineVar("nu", &muNu);
+ muForcingX2.DefineVar("nu", &muNu);
+ muForcingX3.DefineVar("nu", &muNu);
+
+ LBMReal forcingX1 = 0;
+ LBMReal forcingX2 = 0;
+ LBMReal forcingX3 = 0;
+ }
+ /////////////////////////////////////
+
+ localDistributions = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(dataSet->getFdistributions())->getLocalDistributions();
+ nonLocalDistributions = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(dataSet->getFdistributions())->getNonLocalDistributions();
+ zeroDistributions = boost::dynamic_pointer_cast<D3Q27EsoTwist3DSplittedVector>(dataSet->getFdistributions())->getZeroDistributions();
+
+ BCArray3DPtr bcArray = this->getBCProcessor()->getBCArray();
+
+ const int bcArrayMaxX1 = (int)bcArray->getNX1();
+ const int bcArrayMaxX2 = (int)bcArray->getNX2();
+ const int bcArrayMaxX3 = (int)bcArray->getNX3();
+
+ int minX1 = ghostLayerWidth;
+ int minX2 = ghostLayerWidth;
+ int minX3 = ghostLayerWidth;
+ int maxX1 = bcArrayMaxX1-ghostLayerWidth;
+ int maxX2 = bcArrayMaxX2-ghostLayerWidth;
+ int maxX3 = bcArrayMaxX3-ghostLayerWidth;
+
+ LBMReal omega = collFactor;
+
+
+ //#pragma omp parallel num_threads(8)
+ {
+ // int i = omp_get_thread_num();
+ // printf_s("Hello from thread %d\n", i);
+ //}
+ //#pragma omp for
+ for (int x3 = minX3; x3 < maxX3; x3++)
+ {
+ for (int x2 = minX2; x2 < maxX2; x2++)
+ {
+ for (int x1 = minX1; x1 < maxX1; x1++)
+ {
+ if (!bcArray->isSolid(x1, x2, x3) && !bcArray->isUndefined(x1, x2, x3))
+ {
+ int x1p = x1 + 1;
+ int x2p = x2 + 1;
+ int x3p = x3 + 1;
+ //////////////////////////////////////////////////////////////////////////
+ //read distribution
+ ////////////////////////////////////////////////////////////////////////////
+ //////////////////////////////////////////////////////////////////////////
+
+ //E N T
+ //c c c
+ //////////
+ //W S B
+ //a a a
+
+ //Rest ist b
+
+ //mfxyz
+ //a - negative
+ //b - null
+ //c - positive
+
+ // a b c
+ //-1 0 1
+
+ LBMReal mfcbb = (*this->localDistributions)(D3Q27System::ET_E, x1, x2, x3);
+ LBMReal mfbcb = (*this->localDistributions)(D3Q27System::ET_N, x1, x2, x3);
+ LBMReal mfbbc = (*this->localDistributions)(D3Q27System::ET_T, x1, x2, x3);
+ LBMReal mfccb = (*this->localDistributions)(D3Q27System::ET_NE, x1, x2, x3);
+ LBMReal mfacb = (*this->localDistributions)(D3Q27System::ET_NW, x1p, x2, x3);
+ LBMReal mfcbc = (*this->localDistributions)(D3Q27System::ET_TE, x1, x2, x3);
+ LBMReal mfabc = (*this->localDistributions)(D3Q27System::ET_TW, x1p, x2, x3);
+ LBMReal mfbcc = (*this->localDistributions)(D3Q27System::ET_TN, x1, x2, x3);
+ LBMReal mfbac = (*this->localDistributions)(D3Q27System::ET_TS, x1, x2p, x3);
+ LBMReal mfccc = (*this->localDistributions)(D3Q27System::ET_TNE, x1, x2, x3);
+ LBMReal mfacc = (*this->localDistributions)(D3Q27System::ET_TNW, x1p, x2, x3);
+ LBMReal mfcac = (*this->localDistributions)(D3Q27System::ET_TSE, x1, x2p, x3);
+ LBMReal mfaac = (*this->localDistributions)(D3Q27System::ET_TSW, x1p, x2p, x3);
+
+ LBMReal mfabb = (*this->nonLocalDistributions)(D3Q27System::ET_W, x1p, x2, x3);
+ LBMReal mfbab = (*this->nonLocalDistributions)(D3Q27System::ET_S, x1, x2p, x3);
+ LBMReal mfbba = (*this->nonLocalDistributions)(D3Q27System::ET_B, x1, x2, x3p);
+ LBMReal mfaab = (*this->nonLocalDistributions)(D3Q27System::ET_SW, x1p, x2p, x3);
+ LBMReal mfcab = (*this->nonLocalDistributions)(D3Q27System::ET_SE, x1, x2p, x3);
+ LBMReal mfaba = (*this->nonLocalDistributions)(D3Q27System::ET_BW, x1p, x2, x3p);
+ LBMReal mfcba = (*this->nonLocalDistributions)(D3Q27System::ET_BE, x1, x2, x3p);
+ LBMReal mfbaa = (*this->nonLocalDistributions)(D3Q27System::ET_BS, x1, x2p, x3p);
+ LBMReal mfbca = (*this->nonLocalDistributions)(D3Q27System::ET_BN, x1, x2, x3p);
+ LBMReal mfaaa = (*this->nonLocalDistributions)(D3Q27System::ET_BSW, x1p, x2p, x3p);
+ LBMReal mfcaa = (*this->nonLocalDistributions)(D3Q27System::ET_BSE, x1, x2p, x3p);
+ LBMReal mfaca = (*this->nonLocalDistributions)(D3Q27System::ET_BNW, x1p, x2, x3p);
+ LBMReal mfcca = (*this->nonLocalDistributions)(D3Q27System::ET_BNE, x1, x2, x3p);
+
+ LBMReal mfbbb = (*this->zeroDistributions)(x1, x2, x3);
+
+ ////////////////////////////////////////////////////////////////////////////////////
+ LBMReal drho = ((((mfccc+mfaaa)+(mfaca+mfcac))+((mfacc+mfcaa)+(mfaac+mfcca)))+
+ (((mfbac+mfbca)+(mfbaa+mfbcc))+((mfabc+mfcba)+(mfaba+mfcbc))+((mfacb+mfcab)+(mfaab+mfccb)))+
+ ((mfabb+mfcbb)+(mfbab+mfbcb))+(mfbba+mfbbc))+mfbbb;
+
+ LBMReal rho = one+drho;
+ ////////////////////////////////////////////////////////////////////////////////////
+ LBMReal vvx = ((((mfccc-mfaaa)+(mfcac-mfaca))+((mfcaa-mfacc)+(mfcca-mfaac)))+
+ (((mfcba-mfabc)+(mfcbc-mfaba))+((mfcab-mfacb)+(mfccb-mfaab)))+
+ (mfcbb-mfabb))/rho;
+ LBMReal vvy = ((((mfccc-mfaaa)+(mfaca-mfcac))+((mfacc-mfcaa)+(mfcca-mfaac)))+
+ (((mfbca-mfbac)+(mfbcc-mfbaa))+((mfacb-mfcab)+(mfccb-mfaab)))+
+ (mfbcb-mfbab))/rho;
+ LBMReal vvz = ((((mfccc-mfaaa)+(mfcac-mfaca))+((mfacc-mfcaa)+(mfaac-mfcca)))+
+ (((mfbac-mfbca)+(mfbcc-mfbaa))+((mfabc-mfcba)+(mfcbc-mfaba)))+
+ (mfbbc-mfbba))/rho;
+ ////////////////////////////////////////////////////////////////////////////////////
+
+ //forcing
+ ///////////////////////////////////////////////////////////////////////////////////////////
+ if (withForcing)
+ {
+ muX1 = static_cast<double>(x1-1+ix1*maxX1);
+ muX2 = static_cast<double>(x2-1+ix2*maxX2);
+ muX3 = static_cast<double>(x3-1+ix3*maxX3);
+
+ forcingX1 = muForcingX1.Eval();
+ forcingX2 = muForcingX2.Eval();
+ forcingX3 = muForcingX3.Eval();
+
+ vvx += forcingX1*deltaT*0.5; // X
+ vvy += forcingX2*deltaT*0.5; // Y
+ vvz += forcingX3*deltaT*0.5; // Z
+ }
+ ///////////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ LBMReal oMdrho = one; // comp special
+ ////////////////////////////////////////////////////////////////////////////////////
+ LBMReal m0, m1, m2;
+ LBMReal vx2;
+ LBMReal vy2;
+ LBMReal vz2;
+ vx2 = vvx*vvx;
+ vy2 = vvy*vvy;
+ vz2 = vvz*vvz;
+ ////////////////////////////////////////////////////////////////////////////////////
+ LBMReal wadjust;
+ LBMReal qudricLimitP = 0.001;// * 0.0001f;
+ LBMReal qudricLimitM = 0.001;// * 0.0001f;
+ LBMReal qudricLimitD = 0.001;// * 0.001f;
+ //LBMReal s9 = minusomega;
+ //test
+ //s9 = 0.;
+ ////////////////////////////////////////////////////////////////////////////////////
+ //Hin
+ ////////////////////////////////////////////////////////////////////////////////////
+ // mit 1/36, 1/9, 1/36, 1/9, 4/9, 1/9, 1/36, 1/9, 1/36 Konditionieren
+ ////////////////////////////////////////////////////////////////////////////////////
+ // Z - Dir
+ m2 = mfaaa+mfaac;
+ m1 = mfaac-mfaaa;
+ m0 = m2+mfaab;
+ mfaaa = m0;
+ m0 += c1o36 * oMdrho;
+ mfaab = m1-m0 * vvz;
+ mfaac = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaba+mfabc;
+ m1 = mfabc-mfaba;
+ m0 = m2+mfabb;
+ mfaba = m0;
+ m0 += c1o9 * oMdrho;
+ mfabb = m1-m0 * vvz;
+ mfabc = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaca+mfacc;
+ m1 = mfacc-mfaca;
+ m0 = m2+mfacb;
+ mfaca = m0;
+ m0 += c1o36 * oMdrho;
+ mfacb = m1-m0 * vvz;
+ mfacc = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfbaa+mfbac;
+ m1 = mfbac-mfbaa;
+ m0 = m2+mfbab;
+ mfbaa = m0;
+ m0 += c1o9 * oMdrho;
+ mfbab = m1-m0 * vvz;
+ mfbac = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfbba+mfbbc;
+ m1 = mfbbc-mfbba;
+ m0 = m2+mfbbb;
+ mfbba = m0;
+ m0 += c4o9 * oMdrho;
+ mfbbb = m1-m0 * vvz;
+ mfbbc = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfbca+mfbcc;
+ m1 = mfbcc-mfbca;
+ m0 = m2+mfbcb;
+ mfbca = m0;
+ m0 += c1o9 * oMdrho;
+ mfbcb = m1-m0 * vvz;
+ mfbcc = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfcaa+mfcac;
+ m1 = mfcac-mfcaa;
+ m0 = m2+mfcab;
+ mfcaa = m0;
+ m0 += c1o36 * oMdrho;
+ mfcab = m1-m0 * vvz;
+ mfcac = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfcba+mfcbc;
+ m1 = mfcbc-mfcba;
+ m0 = m2+mfcbb;
+ mfcba = m0;
+ m0 += c1o9 * oMdrho;
+ mfcbb = m1-m0 * vvz;
+ mfcbc = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfcca+mfccc;
+ m1 = mfccc-mfcca;
+ m0 = m2+mfccb;
+ mfcca = m0;
+ m0 += c1o36 * oMdrho;
+ mfccb = m1-m0 * vvz;
+ mfccc = m2-two* m1 * vvz+vz2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ // mit 1/6, 0, 1/18, 2/3, 0, 2/9, 1/6, 0, 1/18 Konditionieren
+ ////////////////////////////////////////////////////////////////////////////////////
+ // Y - Dir
+ m2 = mfaaa+mfaca;
+ m1 = mfaca-mfaaa;
+ m0 = m2+mfaba;
+ mfaaa = m0;
+ m0 += c1o6 * oMdrho;
+ mfaba = m1-m0 * vvy;
+ mfaca = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaab+mfacb;
+ m1 = mfacb-mfaab;
+ m0 = m2+mfabb;
+ mfaab = m0;
+ mfabb = m1-m0 * vvy;
+ mfacb = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaac+mfacc;
+ m1 = mfacc-mfaac;
+ m0 = m2+mfabc;
+ mfaac = m0;
+ m0 += c1o18 * oMdrho;
+ mfabc = m1-m0 * vvy;
+ mfacc = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfbaa+mfbca;
+ m1 = mfbca-mfbaa;
+ m0 = m2+mfbba;
+ mfbaa = m0;
+ m0 += c2o3 * oMdrho;
+ mfbba = m1-m0 * vvy;
+ mfbca = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfbab+mfbcb;
+ m1 = mfbcb-mfbab;
+ m0 = m2+mfbbb;
+ mfbab = m0;
+ mfbbb = m1-m0 * vvy;
+ mfbcb = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfbac+mfbcc;
+ m1 = mfbcc-mfbac;
+ m0 = m2+mfbbc;
+ mfbac = m0;
+ m0 += c2o9 * oMdrho;
+ mfbbc = m1-m0 * vvy;
+ mfbcc = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfcaa+mfcca;
+ m1 = mfcca-mfcaa;
+ m0 = m2+mfcba;
+ mfcaa = m0;
+ m0 += c1o6 * oMdrho;
+ mfcba = m1-m0 * vvy;
+ mfcca = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfcab+mfccb;
+ m1 = mfccb-mfcab;
+ m0 = m2+mfcbb;
+ mfcab = m0;
+ mfcbb = m1-m0 * vvy;
+ mfccb = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfcac+mfccc;
+ m1 = mfccc-mfcac;
+ m0 = m2+mfcbc;
+ mfcac = m0;
+ m0 += c1o18 * oMdrho;
+ mfcbc = m1-m0 * vvy;
+ mfccc = m2-two* m1 * vvy+vy2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ // mit 1, 0, 1/3, 0, 0, 0, 1/3, 0, 1/9 Konditionieren
+ ////////////////////////////////////////////////////////////////////////////////////
+ // X - Dir
+ m2 = mfaaa+mfcaa;
+ m1 = mfcaa-mfaaa;
+ m0 = m2+mfbaa;
+ mfaaa = m0;
+ m0 += one* oMdrho;
+ mfbaa = m1-m0 * vvx;
+ mfcaa = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaba+mfcba;
+ m1 = mfcba-mfaba;
+ m0 = m2+mfbba;
+ mfaba = m0;
+ mfbba = m1-m0 * vvx;
+ mfcba = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaca+mfcca;
+ m1 = mfcca-mfaca;
+ m0 = m2+mfbca;
+ mfaca = m0;
+ m0 += c1o3 * oMdrho;
+ mfbca = m1-m0 * vvx;
+ mfcca = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaab+mfcab;
+ m1 = mfcab-mfaab;
+ m0 = m2+mfbab;
+ mfaab = m0;
+ mfbab = m1-m0 * vvx;
+ mfcab = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfabb+mfcbb;
+ m1 = mfcbb-mfabb;
+ m0 = m2+mfbbb;
+ mfabb = m0;
+ mfbbb = m1-m0 * vvx;
+ mfcbb = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfacb+mfccb;
+ m1 = mfccb-mfacb;
+ m0 = m2+mfbcb;
+ mfacb = m0;
+ mfbcb = m1-m0 * vvx;
+ mfccb = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfaac+mfcac;
+ m1 = mfcac-mfaac;
+ m0 = m2+mfbac;
+ mfaac = m0;
+ m0 += c1o3 * oMdrho;
+ mfbac = m1-m0 * vvx;
+ mfcac = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfabc+mfcbc;
+ m1 = mfcbc-mfabc;
+ m0 = m2+mfbbc;
+ mfabc = m0;
+ mfbbc = m1-m0 * vvx;
+ mfcbc = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m2 = mfacc+mfccc;
+ m1 = mfccc-mfacc;
+ m0 = m2+mfbcc;
+ mfacc = m0;
+ m0 += c1o9 * oMdrho;
+ mfbcc = m1-m0 * vvx;
+ mfccc = m2-two* m1 * vvx+vx2 * m0;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+
+
+ ////////////////////////////////////////////////////////////////////////////////////
+ // Cumulants
+ ////////////////////////////////////////////////////////////////////////////////////
+
+ //LBMReal OxxPyyPzz = one; // bulk viscosity
+
+ ////////////////////////////////////////////////////////////
+ //3.
+ //////////////////////////////
+ //LBMReal OxyyPxzz = one;//three * (two - omega) / (three - omega);//
+ //LBMReal OxyyMxzz = one;//six * (two - omega) / (six - omega);//
+ //LBMReal Oxyz = one;//twelve * (two - omega) / (twelve + omega);//
+
+ LBMReal OxyyPxzz = eight*(-two+omega)*(one+two*omega)/(-eight-fourteen*omega+seven*omega*omega);//one;
+
+ LBMReal OxyyMxzz = eight*(-two+omega)*(-seven+four*omega)/(fiftysix-fifty*omega+nine*omega*omega);//one;
+
+ LBMReal Oxyz = twentyfour*(-two+omega)*(-two-seven*omega+three*omega*omega)/(fourtyeight+c152*omega-c130*omega*omega+twentynine*omega*omega*omega);
+ //////////////////////////////
+ //LBMReal OxyyPxzz = two-omega;//
+ //LBMReal OxyyMxzz = two-omega;//
+ //////////////////////////////
+ //LBMReal OxyyPxzz = (eight * (omega - two)) / (omega - eight);//Ginzburg
+ //LBMReal OxyyMxzz = (eight * (omega - two)) / (omega - eight);//Ginzburg
+ //////////////////////////////
+ //LBMReal OxyyPxzz = omega;//BGK
+ //LBMReal OxyyMxzz = omega;//BGK
+ //////////////////////////////
+ //LBMReal OxyyPxzz = (one + omega) / two;//1P5
+ //LBMReal OxyyMxzz = (one + omega) / two;//1P5
+ //////////////////////////////
+ //LBMReal OxyyPxzz = (three - omega) / two;//0P5
+ //LBMReal OxyyMxzz = (three - omega) / two;//0P5
+ //////////////////////////////
+ //LBMReal OxyyPxzz = (one + (eight * (omega - two)) / (omega - eight)) / two;//one + Ginzburg / two ... Car
+ //LBMReal OxyyMxzz = (one + (eight * (omega - two)) / (omega - eight)) / two;//one + Ginzburg / two ... Car
+ ////////////////////////////////////////////////////////////
+ //4.
+ //////////////////////////////
+ LBMReal O4 = one;
+ //////////////////////////////
+ //LBMReal O4 = omega;//TRT
+ ////////////////////////////////////////////////////////////
+ //5.
+ //////////////////////////////
+ LBMReal O5 = one;
+ ////////////////////////////////////////////////////////////
+ //6.
+ //////////////////////////////
+ LBMReal O6 = one;
+ ////////////////////////////////////////////////////////////
+
+
+ //central moments to cumulants
+ //4.
+ LBMReal CUMcbb = mfcbb-((mfcaa+c1o3) * mfabb+two * mfbba * mfbab)/rho; //ab 15.05.2015 verwendet
+ LBMReal CUMbcb = mfbcb-((mfaca+c1o3) * mfbab+two * mfbba * mfabb)/rho; //ab 15.05.2015 verwendet
+ LBMReal CUMbbc = mfbbc-((mfaac+c1o3) * mfbba+two * mfbab * mfabb)/rho; //ab 15.05.2015 verwendet
+
+ LBMReal CUMcca = mfcca-(((mfcaa * mfaca+two * mfbba * mfbba)+c1o3 * (mfcaa+mfaca))/rho-c1o9*(drho/rho));
+ LBMReal CUMcac = mfcac-(((mfcaa * mfaac+two * mfbab * mfbab)+c1o3 * (mfcaa+mfaac))/rho-c1o9*(drho/rho));
+ LBMReal CUMacc = mfacc-(((mfaac * mfaca+two * mfabb * mfabb)+c1o3 * (mfaac+mfaca))/rho-c1o9*(drho/rho));
+
+ //5.
+ LBMReal CUMbcc = mfbcc-((mfaac * mfbca+mfaca * mfbac+four * mfabb * mfbbb+two * (mfbab * mfacb+mfbba * mfabc))+c1o3 * (mfbca+mfbac))/rho;
+ LBMReal CUMcbc = mfcbc-((mfaac * mfcba+mfcaa * mfabc+four * mfbab * mfbbb+two * (mfabb * mfcab+mfbba * mfbac))+c1o3 * (mfcba+mfabc))/rho;
+ LBMReal CUMccb = mfccb-((mfcaa * mfacb+mfaca * mfcab+four * mfbba * mfbbb+two * (mfbab * mfbca+mfabb * mfcba))+c1o3 * (mfacb+mfcab))/rho;
+
+ //6.
+
+ LBMReal CUMccc = mfccc+((-four * mfbbb * mfbbb
+ -(mfcaa * mfacc+mfaca * mfcac+mfaac * mfcca)
+ -four * (mfabb * mfcbb+mfbab * mfbcb+mfbba * mfbbc)
+ -two * (mfbca * mfbac+mfcba * mfabc+mfcab * mfacb))/rho
+ +(four * (mfbab * mfbab * mfaca+mfabb * mfabb * mfcaa+mfbba * mfbba * mfaac)
+ +two * (mfcaa * mfaca * mfaac)
+ +sixteen * mfbba * mfbab * mfabb)/(rho * rho)
+ -c1o3 * (mfacc+mfcac+mfcca)/rho
+ -c1o9 * (mfcaa+mfaca+mfaac)/rho
+ +(two * (mfbab * mfbab+mfabb * mfabb+mfbba * mfbba)
+ +(mfaac * mfaca+mfaac * mfcaa+mfaca * mfcaa)+c1o3 *(mfaac+mfaca+mfcaa))/(rho * rho) * c2o3
+ +c1o27*((drho * drho-drho)/(rho*rho)));
+ //+ c1o27*(one -three/rho +two/(rho*rho)));
+
+
+
+
+ //2.
+ // linear combinations
+ LBMReal mxxPyyPzz = mfcaa+mfaca+mfaac;
+ LBMReal mxxMyy = mfcaa-mfaca;
+ LBMReal mxxMzz = mfcaa-mfaac;
+
+ //////////////////////////////////////////////////////////////////////////
+ // LBMReal magicBulk=(CUMacc+CUMcac+CUMcca)*(one/OxxPyyPzz-c1o2)*c3o2*8.;
+
+ //////////////////////////////////////////////////////////////////////////
+ //limiter-Scheise Teil 1
+ //LBMReal oxxyy,oxxzz,oxy,oxz,oyz;
+ //LBMReal smag=0.001;
+ //oxxyy = omega+(one-omega)*abs(mxxMyy)/(abs(mxxMyy)+smag);
+ //oxxzz = omega+(one-omega)*abs(mxxMzz)/(abs(mxxMzz)+smag);
+ //oxy = omega+(one-omega)*abs(mfbba)/(abs(mfbba)+smag);
+ //oxz = omega+(one-omega)*abs(mfbab)/(abs(mfbab)+smag);
+ //oyz = omega+(one-omega)*abs(mfabb)/(abs(mfabb)+smag);
+
+ ////////////////////////////////////////////////////////////////////////////
+ ////Teil 1b
+ //LBMReal constante = 1000.0;
+ //LBMReal nuEddi = constante * abs(mxxPyyPzz);
+ //LBMReal omegaLimit = one / (one / omega + three * nuEddi);
+
+ //{
+ // LBMReal dxux = c1o2 * (-omegaLimit) *(mxxMyy + mxxMzz) + OxxPyyPzz * (mfaaa - mxxPyyPzz);
+ // LBMReal dyuy = dxux + omegaLimit * c3o2 * mxxMyy;
+ // LBMReal dzuz = dxux + omegaLimit * c3o2 * mxxMzz;
+
+ ////relax
+ //mxxPyyPzz += OxxPyyPzz*(mfaaa - mxxPyyPzz)- three * (one - c1o2 * OxxPyyPzz) * (vx2 * dxux + vy2 * dyuy + vz2 * dzuz);
+ //mxxMyy += omegaLimit * (-mxxMyy) - three * (one + c1o2 * (-omegaLimit)) * (vx2 * dxux + vy2 * dyuy);
+ //mxxMzz += omegaLimit * (-mxxMzz) - three * (one + c1o2 * (-omegaLimit)) * (vx2 * dxux + vz2 * dzuz);
+
+ //}
+ //mfabb += omegaLimit * (-mfabb);
+ //mfbab += omegaLimit * (-mfbab);
+ //mfbba += omegaLimit * (-mfbba);
+ ////////////////////////////////////////////////////////////////////////////
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ //incl. correction (hat noch nicht so gut funktioniert...Optimierungsbedarf??)
+
+ LBMReal dxux = c1o2 * (-omega) *(mxxMyy+mxxMzz)+c1o2 * OxxPyyPzz * (mfaaa-mxxPyyPzz);
+ LBMReal dyuy = dxux+omega * c3o2 * mxxMyy;
+ LBMReal dzuz = dxux+omega * c3o2 * mxxMzz;
+
+ LBMReal Dxy =-three*omega*mfbba;
+ LBMReal Dxz =-three*omega*mfbab;
+ LBMReal Dyz =-three*omega*mfabb;
+
+
+
+ //relax
+ mxxPyyPzz += OxxPyyPzz*(mfaaa-mxxPyyPzz)-three * (one-c1o2 * OxxPyyPzz) * (vx2 * dxux+vy2 * dyuy+vz2 * dzuz);//-magicBulk*OxxPyyPzz;
+ mxxMyy += omega * (-mxxMyy)-three * (one+c1o2 * (-omega)) * (vx2 * dxux-vy2 * dyuy);
+ mxxMzz += omega * (-mxxMzz)-three * (one+c1o2 * (-omega)) * (vx2 * dxux-vz2 * dzuz);
+
+ //////////////////////////////////////////////////////////////////////////
+ //limiter-Scheise Teil 2
+ //mxxMyy += oxxyy * (-mxxMyy) - three * (one + c1o2 * (-omega)) * (vx2 * dxux + vy2 * dyuy);
+ //mxxMzz += oxxzz * (-mxxMzz) - three * (one + c1o2 * (-omega)) * (vx2 * dxux + vz2 * dzuz);
+ //////////////////////////////////////////////////////////////////////////
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+
+ /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ ////no correction
+ //mxxPyyPzz += OxxPyyPzz*(mfaaa-mxxPyyPzz);//-magicBulk*OxxPyyPzz;
+ //mxxMyy += -(-omega) * (-mxxMyy);
+ //mxxMzz += -(-omega) * (-mxxMzz);
+ /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ mfabb += omega * (-mfabb);
+ mfbab += omega * (-mfbab);
+ mfbba += omega * (-mfbba);
+
+ //////////////////////////////////////////////////////////////////////////
+ //limiter-Scheise Teil 3
+ //mfabb += oyz * (-mfabb);
+ //mfbab += oxz * (-mfbab);
+ //mfbba += oxy * (-mfbba);
+ //////////////////////////////////////////////////////////////////////////
+
+ // linear combinations back
+ mfcaa = c1o3 * (mxxMyy+mxxMzz+mxxPyyPzz);
+ mfaca = c1o3 * (-two* mxxMyy+mxxMzz+mxxPyyPzz);
+ mfaac = c1o3 * (mxxMyy-two* mxxMzz+mxxPyyPzz);
+
+ //3.
+ // linear combinations
+
+ LBMReal mxxyPyzz = mfcba+mfabc;
+ LBMReal mxxyMyzz = mfcba-mfabc;
+
+ LBMReal mxxzPyyz = mfcab+mfacb;
+ LBMReal mxxzMyyz = mfcab-mfacb;
+
+ LBMReal mxyyPxzz = mfbca+mfbac;
+ LBMReal mxyyMxzz = mfbca-mfbac;
+
+ //relax
+ //////////////////////////////////////////////////////////////////////////
+ //das ist der limiter
+ wadjust = Oxyz+(one-Oxyz)*abs(mfbbb)/(abs(mfbbb)+qudricLimitD);
+ mfbbb += wadjust * (-mfbbb);
+ wadjust = OxyyPxzz+(one-OxyyPxzz)*abs(mxxyPyzz)/(abs(mxxyPyzz)+qudricLimitP);
+ mxxyPyzz += wadjust * (-mxxyPyzz);
+ wadjust = OxyyMxzz+(one-OxyyMxzz)*abs(mxxyMyzz)/(abs(mxxyMyzz)+qudricLimitM);
+ mxxyMyzz += wadjust * (-mxxyMyzz);
+ wadjust = OxyyPxzz+(one-OxyyPxzz)*abs(mxxzPyyz)/(abs(mxxzPyyz)+qudricLimitP);
+ mxxzPyyz += wadjust * (-mxxzPyyz);
+ wadjust = OxyyMxzz+(one-OxyyMxzz)*abs(mxxzMyyz)/(abs(mxxzMyyz)+qudricLimitM);
+ mxxzMyyz += wadjust * (-mxxzMyyz);
+ wadjust = OxyyPxzz+(one-OxyyPxzz)*abs(mxyyPxzz)/(abs(mxyyPxzz)+qudricLimitP);
+ mxyyPxzz += wadjust * (-mxyyPxzz);
+ wadjust = OxyyMxzz+(one-OxyyMxzz)*abs(mxyyMxzz)/(abs(mxyyMxzz)+qudricLimitM);
+ mxyyMxzz += wadjust * (-mxyyMxzz);
+ //////////////////////////////////////////////////////////////////////////
+ //ohne limiter
+ //mfbbb += OxyyMxzz * (-mfbbb);
+ //mxxyPyzz += OxyyPxzz * (-mxxyPyzz);
+ //mxxyMyzz += OxyyMxzz * (-mxxyMyzz);
+ //mxxzPyyz += OxyyPxzz * (-mxxzPyyz);
+ //mxxzMyyz += OxyyMxzz * (-mxxzMyyz);
+ //mxyyPxzz += OxyyPxzz * (-mxyyPxzz);
+ //mxyyMxzz += OxyyMxzz * (-mxyyMxzz);
+ //////////////////////////////////////////////////////////////////////////
+
+ //// linear combinations back
+ mfcba = (mxxyMyzz+mxxyPyzz) * c1o2;
+ mfabc = (-mxxyMyzz+mxxyPyzz) * c1o2;
+ mfcab = (mxxzMyyz+mxxzPyyz) * c1o2;
+ mfacb = (-mxxzMyyz+mxxzPyyz) * c1o2;
+ mfbca = (mxyyMxzz+mxyyPxzz) * c1o2;
+ mfbac = (-mxyyMxzz+mxyyPxzz) * c1o2;
+
+ //4.
+ //////////////////////////////////////////////////////////////////////////
+ //mit limiter
+ // wadjust = O4+(one-O4)*abs(CUMacc)/(abs(CUMacc)+qudricLimit);
+ //CUMacc += wadjust * (-CUMacc);
+ // wadjust = O4+(one-O4)*abs(CUMcac)/(abs(CUMcac)+qudricLimit);
+ //CUMcac += wadjust * (-CUMcac);
+ // wadjust = O4+(one-O4)*abs(CUMcca)/(abs(CUMcca)+qudricLimit);
+ //CUMcca += wadjust * (-CUMcca);
+
+ // wadjust = O4+(one-O4)*abs(CUMbbc)/(abs(CUMbbc)+qudricLimit);
+ //CUMbbc += wadjust * (-CUMbbc);
+ // wadjust = O4+(one-O4)*abs(CUMbcb)/(abs(CUMbcb)+qudricLimit);
+ //CUMbcb += wadjust * (-CUMbcb);
+ // wadjust = O4+(one-O4)*abs(CUMcbb)/(abs(CUMcbb)+qudricLimit);
+ //CUMcbb += wadjust * (-CUMcbb);
+ //////////////////////////////////////////////////////////////////////////
+ //////////////////////////////////////////////////////////////////////////
+ LBMReal A = (four + two*omega - three*omega*omega) / (two - seven*omega + five*omega*omega);
+ LBMReal B = (four + twentyeight*omega - fourteen*omega*omega) / (six - twentyone*omega + fiveteen*omega*omega);
+ //////////////////////////////////////////////////////////////////////////
+
+
+ //ohne limiter
+ //CUMacc += O4 * (-CUMacc);
+ //CUMcac += O4 * (-CUMcac);
+ //CUMcca += O4 * (-CUMcca);
+
+ //CUMbbc += O4 * (-CUMbbc);
+ //CUMbcb += O4 * (-CUMbcb);
+ //CUMcbb += O4 * (-CUMcbb);
+ CUMacc = -O4*(one / omega - c1o2) * (dyuy + dzuz) * c2o3 * A + (one - O4) * (CUMacc);
+ CUMcac = -O4*(one / omega - c1o2) * (dxux + dzuz) * c2o3 * A + (one - O4) * (CUMcac);
+ CUMcca = -O4*(one / omega - c1o2) * (dyuy + dxux) * c2o3 * A + (one - O4) * (CUMcca);
+ CUMbbc = -O4*(one / omega - c1o2) * Dxy * c1o3 * B + (one - O4) * (CUMbbc);
+ CUMbcb = -O4*(one / omega - c1o2) * Dxz * c1o3 * B + (one - O4) * (CUMbcb);
+ CUMcbb = -O4*(one / omega - c1o2) * Dyz * c1o3 * B + (one - O4) * (CUMcbb);
+ //////////////////////////////////////////////////////////////////////////
+
+
+ //5.
+ CUMbcc += O5 * (-CUMbcc);
+ CUMcbc += O5 * (-CUMcbc);
+ CUMccb += O5 * (-CUMccb);
+
+ //6.
+ CUMccc += O6 * (-CUMccc);
+
+
+
+ //back cumulants to central moments
+ //4.
+ mfcbb = CUMcbb+((mfcaa+c1o3) * mfabb+two * mfbba * mfbab)/rho;
+ mfbcb = CUMbcb+((mfaca+c1o3) * mfbab+two * mfbba * mfabb)/rho;
+ mfbbc = CUMbbc+((mfaac+c1o3) * mfbba+two * mfbab * mfabb)/rho;
+
+ mfcca = CUMcca+(((mfcaa * mfaca+two * mfbba * mfbba)+c1o3 * (mfcaa+mfaca))/rho-c1o9*(drho/rho));//(one/rho-one));
+ mfcac = CUMcac+(((mfcaa * mfaac+two * mfbab * mfbab)+c1o3 * (mfcaa+mfaac))/rho-c1o9*(drho/rho));//(one/rho-one));
+ mfacc = CUMacc+(((mfaac * mfaca+two * mfabb * mfabb)+c1o3 * (mfaac+mfaca))/rho-c1o9*(drho/rho));//(one/rho-one));
+
+ //5.
+ mfbcc = CUMbcc+((mfaac * mfbca+mfaca * mfbac+four * mfabb * mfbbb+two * (mfbab * mfacb+mfbba * mfabc))+c1o3 * (mfbca+mfbac))/rho;
+ mfcbc = CUMcbc+((mfaac * mfcba+mfcaa * mfabc+four * mfbab * mfbbb+two * (mfabb * mfcab+mfbba * mfbac))+c1o3 * (mfcba+mfabc))/rho;
+ mfccb = CUMccb+((mfcaa * mfacb+mfaca * mfcab+four * mfbba * mfbbb+two * (mfbab * mfbca+mfabb * mfcba))+c1o3 * (mfacb+mfcab))/rho;
+
+ //6.
+
+ mfccc = CUMccc-((-four * mfbbb * mfbbb
+ -(mfcaa * mfacc+mfaca * mfcac+mfaac * mfcca)
+ -four * (mfabb * mfcbb+mfbab * mfbcb+mfbba * mfbbc)
+ -two * (mfbca * mfbac+mfcba * mfabc+mfcab * mfacb))/rho
+ +(four * (mfbab * mfbab * mfaca+mfabb * mfabb * mfcaa+mfbba * mfbba * mfaac)
+ +two * (mfcaa * mfaca * mfaac)
+ +sixteen * mfbba * mfbab * mfabb)/(rho * rho)
+ -c1o3 * (mfacc+mfcac+mfcca)/rho
+ -c1o9 * (mfcaa+mfaca+mfaac)/rho
+ +(two * (mfbab * mfbab+mfabb * mfabb+mfbba * mfbba)
+ +(mfaac * mfaca+mfaac * mfcaa+mfaca * mfcaa)+c1o3 *(mfaac+mfaca+mfcaa))/(rho * rho) * c2o3
+ +c1o27*((drho * drho-drho)/(rho*rho)));
+ ////////////////////////////////////////////////////////////////////////////////////
+ //forcing
+ mfbaa=-mfbaa;
+ mfaba=-mfaba;
+ mfaab=-mfaab;
+ //////////////////////////////////////////////////////////////////////////////////////
+
+ ////////////////////////////////////////////////////////////////////////////////////
+ //back
+ ////////////////////////////////////////////////////////////////////////////////////
+ //mit 1, 0, 1/3, 0, 0, 0, 1/3, 0, 1/9 Konditionieren
+ ////////////////////////////////////////////////////////////////////////////////////
+ // Z - Dir
+ m0 = mfaac * c1o2+mfaab * (vvz-c1o2)+(mfaaa+one* oMdrho) * (vz2-vvz) * c1o2;
+ m1 = -mfaac-two* mfaab * vvz+mfaaa * (one-vz2)-one* oMdrho * vz2;
+ m2 = mfaac * c1o2+mfaab * (vvz+c1o2)+(mfaaa+one* oMdrho) * (vz2+vvz) * c1o2;
+ mfaaa = m0;
+ mfaab = m1;
+ mfaac = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfabc * c1o2+mfabb * (vvz-c1o2)+mfaba * (vz2-vvz) * c1o2;
+ m1 = -mfabc-two* mfabb * vvz+mfaba * (one-vz2);
+ m2 = mfabc * c1o2+mfabb * (vvz+c1o2)+mfaba * (vz2+vvz) * c1o2;
+ mfaba = m0;
+ mfabb = m1;
+ mfabc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfacc * c1o2+mfacb * (vvz-c1o2)+(mfaca+c1o3 * oMdrho) * (vz2-vvz) * c1o2;
+ m1 = -mfacc-two* mfacb * vvz+mfaca * (one-vz2)-c1o3 * oMdrho * vz2;
+ m2 = mfacc * c1o2+mfacb * (vvz+c1o2)+(mfaca+c1o3 * oMdrho) * (vz2+vvz) * c1o2;
+ mfaca = m0;
+ mfacb = m1;
+ mfacc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfbac * c1o2+mfbab * (vvz-c1o2)+mfbaa * (vz2-vvz) * c1o2;
+ m1 = -mfbac-two* mfbab * vvz+mfbaa * (one-vz2);
+ m2 = mfbac * c1o2+mfbab * (vvz+c1o2)+mfbaa * (vz2+vvz) * c1o2;
+ mfbaa = m0;
+ mfbab = m1;
+ mfbac = m2;
+ /////////b//////////////////////////////////////////////////////////////////////////
+ m0 = mfbbc * c1o2+mfbbb * (vvz-c1o2)+mfbba * (vz2-vvz) * c1o2;
+ m1 = -mfbbc-two* mfbbb * vvz+mfbba * (one-vz2);
+ m2 = mfbbc * c1o2+mfbbb * (vvz+c1o2)+mfbba * (vz2+vvz) * c1o2;
+ mfbba = m0;
+ mfbbb = m1;
+ mfbbc = m2;
+ /////////b//////////////////////////////////////////////////////////////////////////
+ m0 = mfbcc * c1o2+mfbcb * (vvz-c1o2)+mfbca * (vz2-vvz) * c1o2;
+ m1 = -mfbcc-two* mfbcb * vvz+mfbca * (one-vz2);
+ m2 = mfbcc * c1o2+mfbcb * (vvz+c1o2)+mfbca * (vz2+vvz) * c1o2;
+ mfbca = m0;
+ mfbcb = m1;
+ mfbcc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfcac * c1o2+mfcab * (vvz-c1o2)+(mfcaa+c1o3 * oMdrho) * (vz2-vvz) * c1o2;
+ m1 = -mfcac-two* mfcab * vvz+mfcaa * (one-vz2)-c1o3 * oMdrho * vz2;
+ m2 = mfcac * c1o2+mfcab * (vvz+c1o2)+(mfcaa+c1o3 * oMdrho) * (vz2+vvz) * c1o2;
+ mfcaa = m0;
+ mfcab = m1;
+ mfcac = m2;
+ /////////c//////////////////////////////////////////////////////////////////////////
+ m0 = mfcbc * c1o2+mfcbb * (vvz-c1o2)+mfcba * (vz2-vvz) * c1o2;
+ m1 = -mfcbc-two* mfcbb * vvz+mfcba * (one-vz2);
+ m2 = mfcbc * c1o2+mfcbb * (vvz+c1o2)+mfcba * (vz2+vvz) * c1o2;
+ mfcba = m0;
+ mfcbb = m1;
+ mfcbc = m2;
+ /////////c//////////////////////////////////////////////////////////////////////////
+ m0 = mfccc * c1o2+mfccb * (vvz-c1o2)+(mfcca+c1o9 * oMdrho) * (vz2-vvz) * c1o2;
+ m1 = -mfccc-two* mfccb * vvz+mfcca * (one-vz2)-c1o9 * oMdrho * vz2;
+ m2 = mfccc * c1o2+mfccb * (vvz+c1o2)+(mfcca+c1o9 * oMdrho) * (vz2+vvz) * c1o2;
+ mfcca = m0;
+ mfccb = m1;
+ mfccc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ //mit 1/6, 2/3, 1/6, 0, 0, 0, 1/18, 2/9, 1/18 Konditionieren
+ ////////////////////////////////////////////////////////////////////////////////////
+ // Y - Dir
+ m0 = mfaca * c1o2+mfaba * (vvy-c1o2)+(mfaaa+c1o6 * oMdrho) * (vy2-vvy) * c1o2;
+ m1 = -mfaca-two* mfaba * vvy+mfaaa * (one-vy2)-c1o6 * oMdrho * vy2;
+ m2 = mfaca * c1o2+mfaba * (vvy+c1o2)+(mfaaa+c1o6 * oMdrho) * (vy2+vvy) * c1o2;
+ mfaaa = m0;
+ mfaba = m1;
+ mfaca = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfacb * c1o2+mfabb * (vvy-c1o2)+(mfaab+c2o3 * oMdrho) * (vy2-vvy) * c1o2;
+ m1 = -mfacb-two* mfabb * vvy+mfaab * (one-vy2)-c2o3 * oMdrho * vy2;
+ m2 = mfacb * c1o2+mfabb * (vvy+c1o2)+(mfaab+c2o3 * oMdrho) * (vy2+vvy) * c1o2;
+ mfaab = m0;
+ mfabb = m1;
+ mfacb = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfacc * c1o2+mfabc * (vvy-c1o2)+(mfaac+c1o6 * oMdrho) * (vy2-vvy) * c1o2;
+ m1 = -mfacc-two* mfabc * vvy+mfaac * (one-vy2)-c1o6 * oMdrho * vy2;
+ m2 = mfacc * c1o2+mfabc * (vvy+c1o2)+(mfaac+c1o6 * oMdrho) * (vy2+vvy) * c1o2;
+ mfaac = m0;
+ mfabc = m1;
+ mfacc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfbca * c1o2+mfbba * (vvy-c1o2)+mfbaa * (vy2-vvy) * c1o2;
+ m1 = -mfbca-two* mfbba * vvy+mfbaa * (one-vy2);
+ m2 = mfbca * c1o2+mfbba * (vvy+c1o2)+mfbaa * (vy2+vvy) * c1o2;
+ mfbaa = m0;
+ mfbba = m1;
+ mfbca = m2;
+ /////////b//////////////////////////////////////////////////////////////////////////
+ m0 = mfbcb * c1o2+mfbbb * (vvy-c1o2)+mfbab * (vy2-vvy) * c1o2;
+ m1 = -mfbcb-two* mfbbb * vvy+mfbab * (one-vy2);
+ m2 = mfbcb * c1o2+mfbbb * (vvy+c1o2)+mfbab * (vy2+vvy) * c1o2;
+ mfbab = m0;
+ mfbbb = m1;
+ mfbcb = m2;
+ /////////b//////////////////////////////////////////////////////////////////////////
+ m0 = mfbcc * c1o2+mfbbc * (vvy-c1o2)+mfbac * (vy2-vvy) * c1o2;
+ m1 = -mfbcc-two* mfbbc * vvy+mfbac * (one-vy2);
+ m2 = mfbcc * c1o2+mfbbc * (vvy+c1o2)+mfbac * (vy2+vvy) * c1o2;
+ mfbac = m0;
+ mfbbc = m1;
+ mfbcc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfcca * c1o2+mfcba * (vvy-c1o2)+(mfcaa+c1o18 * oMdrho) * (vy2-vvy) * c1o2;
+ m1 = -mfcca-two* mfcba * vvy+mfcaa * (one-vy2)-c1o18 * oMdrho * vy2;
+ m2 = mfcca * c1o2+mfcba * (vvy+c1o2)+(mfcaa+c1o18 * oMdrho) * (vy2+vvy) * c1o2;
+ mfcaa = m0;
+ mfcba = m1;
+ mfcca = m2;
+ /////////c//////////////////////////////////////////////////////////////////////////
+ m0 = mfccb * c1o2+mfcbb * (vvy-c1o2)+(mfcab+c2o9 * oMdrho) * (vy2-vvy) * c1o2;
+ m1 = -mfccb-two* mfcbb * vvy+mfcab * (one-vy2)-c2o9 * oMdrho * vy2;
+ m2 = mfccb * c1o2+mfcbb * (vvy+c1o2)+(mfcab+c2o9 * oMdrho) * (vy2+vvy) * c1o2;
+ mfcab = m0;
+ mfcbb = m1;
+ mfccb = m2;
+ /////////c//////////////////////////////////////////////////////////////////////////
+ m0 = mfccc * c1o2+mfcbc * (vvy-c1o2)+(mfcac+c1o18 * oMdrho) * (vy2-vvy) * c1o2;
+ m1 = -mfccc-two* mfcbc * vvy+mfcac * (one-vy2)-c1o18 * oMdrho * vy2;
+ m2 = mfccc * c1o2+mfcbc * (vvy+c1o2)+(mfcac+c1o18 * oMdrho) * (vy2+vvy) * c1o2;
+ mfcac = m0;
+ mfcbc = m1;
+ mfccc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ //mit 1/36, 1/9, 1/36, 1/9, 4/9, 1/9, 1/36, 1/9, 1/36 Konditionieren
+ ////////////////////////////////////////////////////////////////////////////////////
+ // X - Dir
+ m0 = mfcaa * c1o2+mfbaa * (vvx-c1o2)+(mfaaa+c1o36 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcaa-two* mfbaa * vvx+mfaaa * (one-vx2)-c1o36 * oMdrho * vx2;
+ m2 = mfcaa * c1o2+mfbaa * (vvx+c1o2)+(mfaaa+c1o36 * oMdrho) * (vx2+vvx) * c1o2;
+ mfaaa = m0;
+ mfbaa = m1;
+ mfcaa = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfcba * c1o2+mfbba * (vvx-c1o2)+(mfaba+c1o9 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcba-two* mfbba * vvx+mfaba * (one-vx2)-c1o9 * oMdrho * vx2;
+ m2 = mfcba * c1o2+mfbba * (vvx+c1o2)+(mfaba+c1o9 * oMdrho) * (vx2+vvx) * c1o2;
+ mfaba = m0;
+ mfbba = m1;
+ mfcba = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfcca * c1o2+mfbca * (vvx-c1o2)+(mfaca+c1o36 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcca-two* mfbca * vvx+mfaca * (one-vx2)-c1o36 * oMdrho * vx2;
+ m2 = mfcca * c1o2+mfbca * (vvx+c1o2)+(mfaca+c1o36 * oMdrho) * (vx2+vvx) * c1o2;
+ mfaca = m0;
+ mfbca = m1;
+ mfcca = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfcab * c1o2+mfbab * (vvx-c1o2)+(mfaab+c1o9 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcab-two* mfbab * vvx+mfaab * (one-vx2)-c1o9 * oMdrho * vx2;
+ m2 = mfcab * c1o2+mfbab * (vvx+c1o2)+(mfaab+c1o9 * oMdrho) * (vx2+vvx) * c1o2;
+ mfaab = m0;
+ mfbab = m1;
+ mfcab = m2;
+ ///////////b////////////////////////////////////////////////////////////////////////
+ m0 = mfcbb * c1o2+mfbbb * (vvx-c1o2)+(mfabb+c4o9 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcbb-two* mfbbb * vvx+mfabb * (one-vx2)-c4o9 * oMdrho * vx2;
+ m2 = mfcbb * c1o2+mfbbb * (vvx+c1o2)+(mfabb+c4o9 * oMdrho) * (vx2+vvx) * c1o2;
+ mfabb = m0;
+ mfbbb = m1;
+ mfcbb = m2;
+ ///////////b////////////////////////////////////////////////////////////////////////
+ m0 = mfccb * c1o2+mfbcb * (vvx-c1o2)+(mfacb+c1o9 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfccb-two* mfbcb * vvx+mfacb * (one-vx2)-c1o9 * oMdrho * vx2;
+ m2 = mfccb * c1o2+mfbcb * (vvx+c1o2)+(mfacb+c1o9 * oMdrho) * (vx2+vvx) * c1o2;
+ mfacb = m0;
+ mfbcb = m1;
+ mfccb = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+ ////////////////////////////////////////////////////////////////////////////////////
+ m0 = mfcac * c1o2+mfbac * (vvx-c1o2)+(mfaac+c1o36 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcac-two* mfbac * vvx+mfaac * (one-vx2)-c1o36 * oMdrho * vx2;
+ m2 = mfcac * c1o2+mfbac * (vvx+c1o2)+(mfaac+c1o36 * oMdrho) * (vx2+vvx) * c1o2;
+ mfaac = m0;
+ mfbac = m1;
+ mfcac = m2;
+ ///////////c////////////////////////////////////////////////////////////////////////
+ m0 = mfcbc * c1o2+mfbbc * (vvx-c1o2)+(mfabc+c1o9 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfcbc-two* mfbbc * vvx+mfabc * (one-vx2)-c1o9 * oMdrho * vx2;
+ m2 = mfcbc * c1o2+mfbbc * (vvx+c1o2)+(mfabc+c1o9 * oMdrho) * (vx2+vvx) * c1o2;
+ mfabc = m0;
+ mfbbc = m1;
+ mfcbc = m2;
+ ///////////c////////////////////////////////////////////////////////////////////////
+ m0 = mfccc * c1o2+mfbcc * (vvx-c1o2)+(mfacc+c1o36 * oMdrho) * (vx2-vvx) * c1o2;
+ m1 = -mfccc-two* mfbcc * vvx+mfacc * (one-vx2)-c1o36 * oMdrho * vx2;
+ m2 = mfccc * c1o2+mfbcc * (vvx+c1o2)+(mfacc+c1o36 * oMdrho) * (vx2+vvx) * c1o2;
+ mfacc = m0;
+ mfbcc = m1;
+ mfccc = m2;
+ ////////////////////////////////////////////////////////////////////////////////////
+
+ //////////////////////////////////////////////////////////////////////////
+ //proof correctness
+ //////////////////////////////////////////////////////////////////////////
+#ifdef PROOF_CORRECTNESS
+ LBMReal drho_post = (mfaaa+mfaac+mfaca+mfcaa+mfacc+mfcac+mfccc+mfcca)
+ +(mfaab+mfacb+mfcab+mfccb)+(mfaba+mfabc+mfcba+mfcbc)+(mfbaa+mfbac+mfbca+mfbcc)
+ +(mfabb+mfcbb)+(mfbab+mfbcb)+(mfbba+mfbbc)+mfbbb;
+ //LBMReal dif = fabs(rho - rho_post);
+ LBMReal dif = drho - drho_post;
+#ifdef SINGLEPRECISION
+ if (dif > 10.0E-7 || dif < -10.0E-7)
+#else
+ if (dif > 10.0E-15 || dif < -10.0E-15)
+#endif
+ {
+ UB_THROW(UbException(UB_EXARGS, "rho="+UbSystem::toString(drho)+", rho_post="+UbSystem::toString(drho_post)
+ +" dif="+UbSystem::toString(dif)
+ +" rho is not correct for node "+UbSystem::toString(x1)+","+UbSystem::toString(x2)+","+UbSystem::toString(x3)));
+ //UBLOG(logERROR,"LBMKernelETD3Q27CCLB::collideAll(): rho is not correct for node "+UbSystem::toString(x1)+","+UbSystem::toString(x2)+","+UbSystem::toString(x3));
+ //exit(EXIT_FAILURE);
+ }
+#endif
+ //////////////////////////////////////////////////////////////////////////
+ //write distribution
+ //////////////////////////////////////////////////////////////////////////
+ (*this->localDistributions)(D3Q27System::ET_E, x1, x2, x3) = mfabb;
+ (*this->localDistributions)(D3Q27System::ET_N, x1, x2, x3) = mfbab;
+ (*this->localDistributions)(D3Q27System::ET_T, x1, x2, x3) = mfbba;
+ (*this->localDistributions)(D3Q27System::ET_NE, x1, x2, x3) = mfaab;
+ (*this->localDistributions)(D3Q27System::ET_NW, x1p, x2, x3) = mfcab;
+ (*this->localDistributions)(D3Q27System::ET_TE, x1, x2, x3) = mfaba;
+ (*this->localDistributions)(D3Q27System::ET_TW, x1p, x2, x3) = mfcba;
+ (*this->localDistributions)(D3Q27System::ET_TN, x1, x2, x3) = mfbaa;
+ (*this->localDistributions)(D3Q27System::ET_TS, x1, x2p, x3) = mfbca;
+ (*this->localDistributions)(D3Q27System::ET_TNE, x1, x2, x3) = mfaaa;
+ (*this->localDistributions)(D3Q27System::ET_TNW, x1p, x2, x3) = mfcaa;
+ (*this->localDistributions)(D3Q27System::ET_TSE, x1, x2p, x3) = mfaca;
+ (*this->localDistributions)(D3Q27System::ET_TSW, x1p, x2p, x3) = mfcca;
+
+ (*this->nonLocalDistributions)(D3Q27System::ET_W, x1p, x2, x3) = mfcbb;
+ (*this->nonLocalDistributions)(D3Q27System::ET_S, x1, x2p, x3) = mfbcb;
+ (*this->nonLocalDistributions)(D3Q27System::ET_B, x1, x2, x3p) = mfbbc;
+ (*this->nonLocalDistributions)(D3Q27System::ET_SW, x1p, x2p, x3) = mfccb;
+ (*this->nonLocalDistributions)(D3Q27System::ET_SE, x1, x2p, x3) = mfacb;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BW, x1p, x2, x3p) = mfcbc;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BE, x1, x2, x3p) = mfabc;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BS, x1, x2p, x3p) = mfbcc;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BN, x1, x2, x3p) = mfbac;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BSW, x1p, x2p, x3p) = mfccc;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BSE, x1, x2p, x3p) = mfacc;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BNW, x1p, x2, x3p) = mfcac;
+ (*this->nonLocalDistributions)(D3Q27System::ET_BNE, x1, x2, x3p) = mfaac;
+
+ (*this->zeroDistributions)(x1, x2, x3) = mfbbb;
+ //////////////////////////////////////////////////////////////////////////
+
+ }
+ }
+ }
+ }
+
+ }
+}
+//////////////////////////////////////////////////////////////////////////
+double CompressibleCumulant2LBMKernel::getCallculationTime()
+{
+ //return timer.getDuration();
+ return timer.getTotalTime();
+}
+//////////////////////////////////////////////////////////////////////////
+void CompressibleCumulant2LBMKernel::setBulkOmegaToOmega(bool value)
+{
+ bulkOmegaToOmega = value;
+}
diff --git a/source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.h b/source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.h
new file mode 100644
index 000000000..5b720e695
--- /dev/null
+++ b/source/VirtualFluidsCore/LBM/CompressibleCumulant2LBMKernel.h
@@ -0,0 +1,72 @@
+#ifndef CompressibleCumulant2LBMKernel_h__
+#define CompressibleCumulant2LBMKernel_h__
+
+#include "LBMKernel.h"
+#include "BCProcessor.h"
+#include "D3Q27System.h"
+#include <boost/serialization/export.hpp>
+#include "basics/utilities/UbTiming.h"
+#include "basics/container/CbArray4D.h"
+#include "basics/container/CbArray3D.h"
+
+class CompressibleCumulant2LBMKernel;
+typedef boost::shared_ptr<CompressibleCumulant2LBMKernel> CompressibleCumulant2LBMKernelPtr;
+
+//! \brief compressible cumulant LBM kernel.
+//! \details CFD solver that use Cascaded Cumulant Lattice Boltzmann method for D3Q27 model
+//! \author K. Kutscher, M. Geier
+class CompressibleCumulant2LBMKernel : public LBMKernel
+{
+public:
+ //! This option set relaxation parameter: NORMAL
+ enum Parameter{NORMAL, MAGIC};
+public:
+ CompressibleCumulant2LBMKernel();
+ //! Constructor
+ //! \param nx1 number of nodes in x dimension
+ //! \param nx2 number of nodes in y dimension
+ //! \param nx3 number of nodes in z dimension
+ //! \param p set relaxation parameter: NORMAL is OxyyMxzz = 1.0 and MAGIC is OxyyMxzz = 2.0 +(-collFactor)
+ CompressibleCumulant2LBMKernel(int nx1, int nx2, int nx3, Parameter p);
+ virtual ~CompressibleCumulant2LBMKernel(void);
+ virtual void calculate();
+ virtual LBMKernelPtr clone();
+ double getCallculationTime();
+ void setBulkOmegaToOmega(bool value);
+protected:
+ friend class boost::serialization::access;
+ template<class Archive>
+ void serialize(Archive & ar, const unsigned int version)
+ {
+ ar & boost::serialization::base_object<LBMKernel>(*this);
+ ar & OxyyMxzz;
+ ar & parameter;
+ }
+
+ virtual void collideAll();
+ virtual void init();
+ LBMReal f[D3Q27System::ENDF+1];
+
+ UbTimer timer;
+
+ LBMReal OxyyMxzz;
+ Parameter parameter;
+
+ CbArray4D<LBMReal,IndexerX4X3X2X1>::CbArray4DPtr localDistributions;
+ CbArray4D<LBMReal,IndexerX4X3X2X1>::CbArray4DPtr nonLocalDistributions;
+ CbArray3D<LBMReal,IndexerX3X2X1>::CbArray3DPtr zeroDistributions;
+
+ mu::value_type muX1,muX2,muX3;
+ mu::value_type muDeltaT;
+ mu::value_type muNu;
+ LBMReal forcingX1;
+ LBMReal forcingX2;
+ LBMReal forcingX3;
+
+ // bulk viscosity
+ bool bulkOmegaToOmega;
+ LBMReal OxxPyyPzz;
+};
+#endif // CompressibleCumulantLBMKernel_h__
+
+
diff --git a/source/VirtualFluidsCore/Utilities/ConfigurationFile.hpp b/source/VirtualFluidsCore/Utilities/ConfigurationFile.hpp
index 473d9a518..7231f601f 100644
--- a/source/VirtualFluidsCore/Utilities/ConfigurationFile.hpp
+++ b/source/VirtualFluidsCore/Utilities/ConfigurationFile.hpp
@@ -1,5 +1,5 @@
-#ifndef Configuration_h__
-#define Configuration_h__
+#ifndef ConfigurationFile_h__
+#define ConfigurationFile_h__
#include <map>
#include <string>
diff --git a/source/VirtualFluidsCore/Visitors/BoundaryConditionsBlockVisitor.cpp b/source/VirtualFluidsCore/Visitors/BoundaryConditionsBlockVisitor.cpp
index da1d816d5..59265a084 100644
--- a/source/VirtualFluidsCore/Visitors/BoundaryConditionsBlockVisitor.cpp
+++ b/source/VirtualFluidsCore/Visitors/BoundaryConditionsBlockVisitor.cpp
@@ -68,13 +68,13 @@ void BoundaryConditionsBlockVisitor::visit(Grid3DPtr grid, Block3DPtr block)
if (bca)
{
bca = bca->clone();
- bca->addNode(x1, x2, x3);
- bca->addBcPointer(bcPtr);
+ bca->setNodeIndex(x1, x2, x3);
+ bca->setBcPointer(bcPtr);
bca->addDistributions(distributions);
bca->setCollFactor(collFactor);
bca->setCompressible(compressible);
- bcProcessor->addBC(bca);
bca->setBcArray(bcArray);
+ bcProcessor->addBC(bca);
}
}
}
diff --git a/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.cpp b/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.cpp
index 190c47eee..20df4e0ba 100644
--- a/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.cpp
+++ b/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.cpp
@@ -2,70 +2,65 @@
#include "Grid3DSystem.h"
#include <boost/foreach.hpp>
+
GenBlocksGridVisitor::GenBlocksGridVisitor(GbObject3DPtr boundingBox) :
- boundingBox(boundingBox),
- nx1(0),
- nx2(0),
- nx3(0),
- withDeltaX(true)
+ boundingBox(boundingBox)
{
}
-GenBlocksGridVisitor::GenBlocksGridVisitor(int nx1, int nx2, int nx3) :
- nx1(nx1),
- nx2(nx2),
- nx3(nx3),
- withDeltaX(false)
-{
-}
//////////////////////////////////////////////////////////////////////////
-void GenBlocksGridVisitor::visit( const Grid3DPtr grid )
+void GenBlocksGridVisitor::visit(const Grid3DPtr grid)
{
- findOrigin(grid);
+ double orgX1 = boundingBox->getX1Minimum();
+ double orgX2 = boundingBox->getX2Minimum();
+ double orgX3 = boundingBox->getX3Minimum();
+
+ double dx = grid->getDeltaX(0);
+
UbTupleInt3 blockNX = grid->getBlockNX();
- double dx;
- double geoMaxX1 = boundingBox->getX1Maximum();
- double geoMaxX2 = boundingBox->getX2Maximum();
- double geoMaxX3 = boundingBox->getX3Maximum();
- if (withDeltaX)
- {
- dx = grid->getDeltaX(0);
- blockLentghX1 = (double)val<1>(blockNX)*dx;
- blockLentghX2 = (double)val<2>(blockNX)*dx;
- blockLentghX3 = (double)val<3>(blockNX)*dx;
- }
- else
- {
- int gNX1 = grid->getNX1();
- dx = boundingBox->getLengthX1()/double(val<1>(blockNX)*gNX1);
- grid->setDeltaX(dx);
- blockLentghX1 = val<1>(blockNX)*dx;
- blockLentghX2 = val<2>(blockNX)*dx;
- blockLentghX3 = val<3>(blockNX)*dx;
- }
+ double blockLentghX1 = (double)val<1>(blockNX)*dx;
+ double blockLentghX2 = (double)val<2>(blockNX)*dx;
+ double blockLentghX3 = (double)val<3>(blockNX)*dx;
- CoordinateTransformation3DPtr trafo(new CoordinateTransformation3D(orgX1,orgX2,orgX3,blockLentghX1,blockLentghX2,blockLentghX3));
+ CoordinateTransformation3DPtr trafo(new CoordinateTransformation3D(orgX1, orgX2, orgX3, blockLentghX1, blockLentghX2, blockLentghX3));
grid->setCoordinateTransformator(trafo);
- genBlocks(grid);
-
+ genBlocks(grid);
}
//////////////////////////////////////////////////////////////////////////
-void GenBlocksGridVisitor::fillExtentWithBlocks( Grid3DPtr grid )
+void GenBlocksGridVisitor::fillExtentWithBlocks(Grid3DPtr grid)
{
- for(int x3 = val<3>(minInd); x3 < val<3>(maxInd); x3++)
+ for (int x3 = val<3>(minInd); x3 < val<3>(maxInd); x3++)
{
- for(int x2 = val<2>(minInd); x2 < val<2>(maxInd); x2++)
+ for (int x2 = val<2>(minInd); x2 < val<2>(maxInd); x2++)
{
- for(int x1 = val<1>(minInd); x1 < val<1>(maxInd); x1++)
+ for (int x1 = val<1>(minInd); x1 < val<1>(maxInd); x1++)
{
- Block3DPtr block( new Block3D(x1,x2,x3,0) );
+ Block3DPtr block(new Block3D(x1, x2, x3, 0));
grid->addBlock(block);
}
}
}
+
+ //double dx = grid->getDeltaX(0);
+ //UbTupleInt3 blockNX = grid->getBlockNX();
+ //int maxIX1 = ceil(boundingBox->getX1Maximum() / ((double)val<1>(blockNX)*dx));
+ //int maxIX2 = ceil(boundingBox->getX2Maximum() / ((double)val<2>(blockNX)*dx));
+ //int maxIX3 = ceil(boundingBox->getX3Maximum() / ((double)val<3>(blockNX)*dx));
+
+ //for (int x3 = 0; x3 < maxIX1; x3++)
+ //{
+ // for (int x2 = 0; x2 < maxIX2; x2++)
+ // {
+ // for (int x1 = 0; x1 < maxIX3; x1++)
+ // {
+ // Block3DPtr block(new Block3D(x1, x2, x3, 0));
+ // grid->addBlock(block);
+ // }
+ // }
+ //}
}
//////////////////////////////////////////////////////////////////////////
void GenBlocksGridVisitor::genBlocks(Grid3DPtr grid)
@@ -75,12 +70,14 @@ void GenBlocksGridVisitor::genBlocks(Grid3DPtr grid)
double geoMaxX2 = boundingBox->getX2Maximum();
double geoMaxX3 = boundingBox->getX3Maximum();
maxInd = grid->getBlockIndexes(geoMaxX1, geoMaxX2, geoMaxX3);
+
UbTupleDouble3 blockCoord = grid->getBlockWorldCoordinates(static_cast<int>(val<1>(maxInd)), static_cast<int>(val<2>(maxInd)), static_cast<int>(val<3>(maxInd)), 0);
- if(geoMaxX1 > val<1>(blockCoord))
+ double dx = grid->getDeltaX(0);
+ if (fabs(geoMaxX1-val<1>(blockCoord)) > dx)
val<1>(maxInd) += 1;
- if(geoMaxX2 > val<2>(blockCoord))
+ if (fabs(geoMaxX2-val<2>(blockCoord)) > dx)
val<2>(maxInd) += 1;
- if(geoMaxX3 > val<3>(blockCoord))
+ if (fabs(geoMaxX3-val<3>(blockCoord)) > dx)
val<3>(maxInd) += 1;
this->fillExtentWithBlocks(grid);
@@ -89,20 +86,4 @@ void GenBlocksGridVisitor::genBlocks(Grid3DPtr grid)
grid->setNX2(val<2>(maxInd));
grid->setNX3(val<3>(maxInd));
}
-//////////////////////////////////////////////////////////////////////////
-void GenBlocksGridVisitor::findOrigin( Grid3DPtr grid )
-{
- orgX1 = boundingBox->getX1Minimum();
- orgX2 = boundingBox->getX2Minimum();
- orgX3 = boundingBox->getX3Minimum();
-
- //double minX1, minX2, minX3;
- //minX1 = boundingBox->getX1Minimum();
- //minX2 = boundingBox->getX2Minimum();
- //minX3 = boundingBox->getX3Minimum();
-
- //if(minX1 <= orgX1) orgX1 = minX1;
- //if(minX2 <= orgX2) orgX2 = minX2;
- //if(minX3 <= orgX3) orgX3 = minX3;
-}
diff --git a/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.h b/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.h
index 8a793be1d..59aeace85 100644
--- a/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.h
+++ b/source/VirtualFluidsCore/Visitors/GenBlocksGridVisitor.h
@@ -8,20 +8,14 @@ class GenBlocksGridVisitor : public Grid3DVisitor
{
public:
GenBlocksGridVisitor(GbObject3DPtr boundingBox);
- GenBlocksGridVisitor(int nx1, int nx2, int nx3);
virtual ~GenBlocksGridVisitor(){}
void visit(Grid3DPtr grid);
private:
- double orgX1, orgX2, orgX3;
UbTupleInt3 minInd, maxInd;
- int nx1, nx2, nx3;
- double blockLentghX1, blockLentghX2, blockLentghX3;
- bool withDeltaX;
GbObject3DPtr boundingBox;
void fillExtentWithBlocks(Grid3DPtr grid);
- void findOrigin(Grid3DPtr grid);
void genBlocks(Grid3DPtr grid);
};
diff --git a/source/VirtualFluidsCore/Visitors/SpongeLayerBlockVisitor.cpp b/source/VirtualFluidsCore/Visitors/SpongeLayerBlockVisitor.cpp
index 10170f8cb..0249f9f64 100644
--- a/source/VirtualFluidsCore/Visitors/SpongeLayerBlockVisitor.cpp
+++ b/source/VirtualFluidsCore/Visitors/SpongeLayerBlockVisitor.cpp
@@ -4,7 +4,7 @@
using namespace std;
-SpongeLayerBlockVisitor::SpongeLayerBlockVisitor( GbCuboid3DPtr boundingBox ) : Block3DVisitor(0, Grid3DSystem::MAXLEVEL), boundingBox(boundingBox)
+SpongeLayerBlockVisitor::SpongeLayerBlockVisitor(GbCuboid3DPtr boundingBox) : Block3DVisitor(0, Grid3DSystem::MAXLEVEL), boundingBox(boundingBox)
{
}
@@ -14,37 +14,24 @@ SpongeLayerBlockVisitor::~SpongeLayerBlockVisitor()
}
//////////////////////////////////////////////////////////////////////////
-void SpongeLayerBlockVisitor::visit( Grid3DPtr grid, Block3DPtr block )
+void SpongeLayerBlockVisitor::visit(Grid3DPtr grid, Block3DPtr block)
{
- double minX1,minX2,minX3,maxX1,maxX2,maxX3;
- int gridRank = grid->getRank();
+ if (block->getRank() == grid->getRank())
+ {
+ UbTupleDouble3 org = grid->getBlockWorldCoordinates(block);
+ UbTupleDouble3 blockLengths = grid->getBlockLengths(block);
- int minInitLevel = grid->getCoarsestInitializedLevel();
- int maxInitLevel = grid->getFinestInitializedLevel();
+ double minX1 = val<1>(org);
+ double minX2 = val<2>(org);
+ double minX3 = val<3>(org);
+ double maxX1 = val<1>(org)+val<1>(blockLengths);
+ double maxX2 = val<2>(org)+val<2>(blockLengths);
+ double maxX3 = val<3>(org)+val<3>(blockLengths);
- double numSolids = 0.0;
- double numFluids = 0.0;
- for (int level = minInitLevel; level<=maxInitLevel; level++)
- {
- vector<Block3DPtr> blockVector;
- grid->getBlocks(level, gridRank, blockVector);
- BOOST_FOREACH(Block3DPtr block, blockVector)
+ if (boundingBox->isCellInsideGbObject3D(minX1, minX2, minX3, maxX1, maxX2, maxX3))
{
- UbTupleDouble3 org = grid->getBlockWorldCoordinates(block);
- UbTupleDouble3 blockLengths = grid->getBlockLengths(block);
-
- minX1 = val<1>(org);
- minX2 = val<2>(org);
- minX3 = val<3>(org);
- maxX1 = val<1>(org)+val<1>(blockLengths);
- maxX2 = val<2>(org)+val<2>(blockLengths);
- maxX3 = val<3>(org)+val<3>(blockLengths);
-
- if (boundingBox->isCellInsideGbObject3D(minX1,minX2,minX3,maxX1,maxX2,maxX3))
- {
- LBMKernelPtr kernel = block->getKernel();
- kernel->setCollisionFactor(kernel->getCollisionFactor()*0.5);
- }
+ LBMKernelPtr kernel = block->getKernel();
+ kernel->setCollisionFactor(LBMSystem::calcCollisionFactor(0.01, block->getLevel()));
}
}
}
--
GitLab